Kolab Groupware OBS

buildroundcubemailtarball.sh Changed

roundcubemail-1.5.tar.gz/composer.json Changed

roundcubemail-1.5.tar.gz/composer.lock Changed

@@ -4,7 +4,7 @@
         "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
         "This file is @generated automatically"
     ,
-    "content-hash": "23bf59023591e912aa8b9802e63b7f3e",
+    "content-hash": "80e5727f0676092a7ab32f1696ed0136",
     "packages": 
         {
             "name": "caxy/php-htmldiff",
@@ -126,6 +126,83 @@
             "time": "2021-02-26T10:19:33+00:00"
         },
         {
+            "name": "desarrolla2/cache",
+            "version": "dev-master",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/desarrolla2/Cache.git",
+                "reference": "11d0e29ebd7ae12e2b53d90d7a9757b1c51c04e5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/desarrolla2/Cache/zipball/11d0e29ebd7ae12e2b53d90d7a9757b1c51c04e5",
+                "reference": "11d0e29ebd7ae12e2b53d90d7a9757b1c51c04e5",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2.0",
+                "psr/simple-cache": "^1.0"
+            },
+            "provide": {
+                "psr/simple-cache-implementation": "1.0"
+            },
+            "require-dev": {
+                "cache/integration-tests": "dev-master",
+                "ext-apcu": "*",
+                "ext-json": "*",
+                "ext-memcached": "*",
+                "ext-mysqli": "*",
+                "ext-redis": "*",
+                "mikey179/vfsstream": "v1.6.10",
+                "mongodb/mongodb": "^1.3",
+                "phpstan/phpstan": "^0.12.29",
+                "phpunit/phpunit": "^8.3 || ^9.0",
+                "predis/predis": "~1.0.0",
+                "symfony/phpunit-bridge": "^5.2"
+            },
+            "default-branch": true,
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Desarrolla2\\Cache\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": 
+                "MIT"
+            ,
+            "authors": 
+                {
+                    "name": "Daniel González",
+                    "homepage": "http://desarrolla2.com/"
+                },
+                {
+                    "name": "Arnold Daniels",
+                    "homepage": "https://jasny.net/"
+                }
+            ,
+            "description": "Provides an cache interface for several adapters Apc, Apcu, File, Mongo, Memcache, Memcached, Mysql, Mongo, Redis is supported.",
+            "homepage": "https://github.com/desarrolla2/Cache/",
+            "keywords": 
+                "apc",
+                "apcu",
+                "cache",
+                "file",
+                "memcache",
+                "memcached",
+                "mongo",
+                "mysql",
+                "psr-16",
+                "redis",
+                "simple-cache"
+            ,
+            "support": {
+                "issues": "https://github.com/desarrolla2/Cache/issues",
+                "source": "https://github.com/desarrolla2/Cache/tree/master"
+            },
+            "time": "2022-03-29T07:08:52+00:00"
+        },
+        {
             "name": "endroid/qr-code",
             "version": "1.6.6",
             "source": {
@@ -1494,6 +1571,66 @@
             "time": "2022-08-18T16:18:26+00:00"
         },
         {
+            "name": "monolog/monolog",
+            "version": "1.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/Seldaek/monolog.git",
+                "reference": "d16496318c3e08e3bccfc3866e104e49cf25488a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/Seldaek/monolog/zipball/d16496318c3e08e3bccfc3866e104e49cf25488a",
+                "reference": "d16496318c3e08e3bccfc3866e104e49cf25488a",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0"
+            },
+            "require-dev": {
+                "mlehner/gelf-php": "1.0.*"
+            },
+            "suggest": {
+                "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+                "ext-mongo": "Allow sending log messages to a MongoDB server",
+                "mlehner/gelf-php": "Allow sending log messages to a GrayLog2 server"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-0": {
+                    "Monolog": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": 
+                "MIT"
+            ,
+            "authors": 
+                {
+                    "name": "Jordi Boggiano",
+                    "email": "j.boggiano@seld.be",
+                    "homepage": "http://seld.be",
+                    "role": "Developer"
+                }
+            ,
+            "description": "Logging for PHP 5.3",
+            "homepage": "http://github.com/Seldaek/monolog",
+            "keywords": 
+                "log",
+                "logging"
+            ,
+            "support": {
+                "issues": "https://github.com/Seldaek/monolog/issues",
+                "source": "https://github.com/Seldaek/monolog/tree/1.2.1"
+            },
+            "time": "2012-08-29T11:53:20+00:00"
+        },
+        {
             "name": "pear/auth_sasl",
             "version": "v1.1.0",
             "source": {
@@ -2357,6 +2494,57 @@
             "time": "2021-05-03T11:20:27+00:00"
         },
         {
+            "name": "psr/simple-cache",
+            "version": "1.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/simple-cache.git",
+                "reference": "408d5eafb83c57f6365a3ca330ff23aa4a5fa39b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/simple-cache/zipball/408d5eafb83c57f6365a3ca330ff23aa4a5fa39b",
+                "reference": "408d5eafb83c57f6365a3ca330ff23aa4a5fa39b",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\SimpleCache\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": 
+                "MIT"
+            ,
+            "authors": 
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "http://www.php-fig.org/"
+                }

roundcubemail-1.5.tar.gz/temp/js_cache/tinymce-langs-5.8.2.zip Changed

roundcubemail-1.5.tar.gz/vendor/autoload.php Changed

roundcubemail-1.5.tar.gz/vendor/composer/autoload_namespaces.php Changed

roundcubemail-1.5.tar.gz/vendor/composer/autoload_psr4.php Changed

@@ -23,6 +23,7 @@
     'Sabre\\CardDAV\\' => array($vendorDir . '/sabre/dav/lib/CardDAV'),
     'Sabre\\CalDAV\\' => array($vendorDir . '/sabre/dav/lib/CalDAV'),
     'RtfHtmlPhp\\' => array($vendorDir . '/roundcube/rtf-html-php/src'),
+    'Psr\\SimpleCache\\' => array($vendorDir . '/psr/simple-cache/src'),
     'Psr\\Log\\' => array($vendorDir . '/psr/log/Psr/Log'),
     'Psr\\Http\\Message\\' => array($vendorDir . '/psr/http-message/src'),
     'Prophecy\\' => array($vendorDir . '/phpspec/prophecy/src/Prophecy'),
@@ -33,6 +34,7 @@
     'GuzzleHttp\\' => array($vendorDir . '/guzzlehttp/guzzle/src'),
     'Endroid\\QrCode\\' => array($vendorDir . '/endroid/qr-code/src'),
     'Doctrine\\Instantiator\\' => array($vendorDir . '/doctrine/instantiator/src/Doctrine/Instantiator'),
+    'Desarrolla2\\Cache\\' => array($vendorDir . '/desarrolla2/cache/src'),
     'DeepCopy\\' => array($vendorDir . '/myclabs/deep-copy/src/DeepCopy'),
     'Base32\\' => array($vendorDir . '/christian-riesen/base32/src'),
 );

roundcubemail-1.5.tar.gz/vendor/composer/autoload_real.php Changed

@@ -2,7 +2,7 @@
 
 // autoload_real.php @generated by Composer
 
-class ComposerAutoloaderInit0617067ec580b01ba3426ee0746c531e
+class ComposerAutoloaderInitca664ae5b236666df0e3b04e07f50482
 {
     private static $loader;
 
@@ -24,9 +24,9 @@
 
         require __DIR__ . '/platform_check.php';
 
-        spl_autoload_register(array('ComposerAutoloaderInit0617067ec580b01ba3426ee0746c531e', 'loadClassLoader'), true, true);
+        spl_autoload_register(array('ComposerAutoloaderInitca664ae5b236666df0e3b04e07f50482', 'loadClassLoader'), true, true);
         self::$loader = $loader = new \Composer\Autoload\ClassLoader(\dirname(\dirname(__FILE__)));
-        spl_autoload_unregister(array('ComposerAutoloaderInit0617067ec580b01ba3426ee0746c531e', 'loadClassLoader'));
+        spl_autoload_unregister(array('ComposerAutoloaderInitca664ae5b236666df0e3b04e07f50482', 'loadClassLoader'));
 
         $includePaths = require __DIR__ . '/include_paths.php';
         $includePaths = get_include_path();
@@ -36,7 +36,7 @@
         if ($useStaticLoader) {
             require __DIR__ . '/autoload_static.php';
 
-            call_user_func(\Composer\Autoload\ComposerStaticInit0617067ec580b01ba3426ee0746c531e::getInitializer($loader));
+            call_user_func(\Composer\Autoload\ComposerStaticInitca664ae5b236666df0e3b04e07f50482::getInitializer($loader));
         } else {
             $map = require __DIR__ . '/autoload_namespaces.php';
             foreach ($map as $namespace => $path) {
@@ -57,19 +57,19 @@
         $loader->register(true);
 
         if ($useStaticLoader) {
-            $includeFiles = Composer\Autoload\ComposerStaticInit0617067ec580b01ba3426ee0746c531e::$files;
+            $includeFiles = Composer\Autoload\ComposerStaticInitca664ae5b236666df0e3b04e07f50482::$files;
         } else {
             $includeFiles = require __DIR__ . '/autoload_files.php';
         }
         foreach ($includeFiles as $fileIdentifier => $file) {
-            composerRequire0617067ec580b01ba3426ee0746c531e($fileIdentifier, $file);
+            composerRequireca664ae5b236666df0e3b04e07f50482($fileIdentifier, $file);
         }
 
         return $loader;
     }
 }
 
-function composerRequire0617067ec580b01ba3426ee0746c531e($fileIdentifier, $file)
+function composerRequireca664ae5b236666df0e3b04e07f50482($fileIdentifier, $file)
 {
     if (empty($GLOBALS'__composer_autoload_files'$fileIdentifier)) {
         require $file;

roundcubemail-1.5.tar.gz/vendor/composer/autoload_static.php Changed

@@ -4,7 +4,7 @@
 
 namespace Composer\Autoload;
 
-class ComposerStaticInit0617067ec580b01ba3426ee0746c531e
+class ComposerStaticInitca664ae5b236666df0e3b04e07f50482
 {
     public static $files = array (
         '320cde22f66dd4f5d3fd621d3e88b98f' => __DIR__ . '/..' . '/symfony/polyfill-ctype/bootstrap.php',
@@ -59,6 +59,7 @@
         ),
         'P' => 
         array (
+            'Psr\\SimpleCache\\' => 16,
             'Psr\\Log\\' => 8,
             'Psr\\Http\\Message\\' => 17,
             'Prophecy\\' => 9,
@@ -84,6 +85,7 @@
         'D' => 
         array (
             'Doctrine\\Instantiator\\' => 22,
+            'Desarrolla2\\Cache\\' => 18,
             'DeepCopy\\' => 9,
         ),
         'B' => 
@@ -163,6 +165,10 @@
         array (
             0 => __DIR__ . '/..' . '/roundcube/rtf-html-php/src',
         ),
+        'Psr\\SimpleCache\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/psr/simple-cache/src',
+        ),
         'Psr\\Log\\' => 
         array (
             0 => __DIR__ . '/..' . '/psr/log/Psr/Log',
@@ -203,6 +209,10 @@
         array (
             0 => __DIR__ . '/..' . '/doctrine/instantiator/src/Doctrine/Instantiator',
         ),
+        'Desarrolla2\\Cache\\' => 
+        array (
+            0 => __DIR__ . '/..' . '/desarrolla2/cache/src',
+        ),
         'DeepCopy\\' => 
         array (
             0 => __DIR__ . '/..' . '/myclabs/deep-copy/src/DeepCopy',
@@ -297,6 +307,10 @@
         ),
         'M' => 
         array (
+            'Monolog' => 
+            array (
+                0 => __DIR__ . '/..' . '/monolog/monolog/src',
+            ),
             'Mail' => 
             array (
                 0 => __DIR__ . '/..' . '/pear/mail_mime',
@@ -1029,11 +1043,11 @@
     public static function getInitializer(ClassLoader $loader)
     {
         return \Closure::bind(function () use ($loader) {
-            $loader->prefixLengthsPsr4 = ComposerStaticInit0617067ec580b01ba3426ee0746c531e::$prefixLengthsPsr4;
-            $loader->prefixDirsPsr4 = ComposerStaticInit0617067ec580b01ba3426ee0746c531e::$prefixDirsPsr4;
-            $loader->prefixesPsr0 = ComposerStaticInit0617067ec580b01ba3426ee0746c531e::$prefixesPsr0;
-            $loader->fallbackDirsPsr0 = ComposerStaticInit0617067ec580b01ba3426ee0746c531e::$fallbackDirsPsr0;
-            $loader->classMap = ComposerStaticInit0617067ec580b01ba3426ee0746c531e::$classMap;
+            $loader->prefixLengthsPsr4 = ComposerStaticInitca664ae5b236666df0e3b04e07f50482::$prefixLengthsPsr4;
+            $loader->prefixDirsPsr4 = ComposerStaticInitca664ae5b236666df0e3b04e07f50482::$prefixDirsPsr4;
+            $loader->prefixesPsr0 = ComposerStaticInitca664ae5b236666df0e3b04e07f50482::$prefixesPsr0;
+            $loader->fallbackDirsPsr0 = ComposerStaticInitca664ae5b236666df0e3b04e07f50482::$fallbackDirsPsr0;
+            $loader->classMap = ComposerStaticInitca664ae5b236666df0e3b04e07f50482::$classMap;
 
         }, null, ClassLoader::class);
     }

roundcubemail-1.5.tar.gz/vendor/composer/installed.json Changed

@@ -126,6 +126,86 @@
             "install-path": "../christian-riesen/base32"
         },
         {
+            "name": "desarrolla2/cache",
+            "version": "dev-master",
+            "version_normalized": "dev-master",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/desarrolla2/Cache.git",
+                "reference": "11d0e29ebd7ae12e2b53d90d7a9757b1c51c04e5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/desarrolla2/Cache/zipball/11d0e29ebd7ae12e2b53d90d7a9757b1c51c04e5",
+                "reference": "11d0e29ebd7ae12e2b53d90d7a9757b1c51c04e5",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2.0",
+                "psr/simple-cache": "^1.0"
+            },
+            "provide": {
+                "psr/simple-cache-implementation": "1.0"
+            },
+            "require-dev": {
+                "cache/integration-tests": "dev-master",
+                "ext-apcu": "*",
+                "ext-json": "*",
+                "ext-memcached": "*",
+                "ext-mysqli": "*",
+                "ext-redis": "*",
+                "mikey179/vfsstream": "v1.6.10",
+                "mongodb/mongodb": "^1.3",
+                "phpstan/phpstan": "^0.12.29",
+                "phpunit/phpunit": "^8.3 || ^9.0",
+                "predis/predis": "~1.0.0",
+                "symfony/phpunit-bridge": "^5.2"
+            },
+            "time": "2022-03-29T07:08:52+00:00",
+            "default-branch": true,
+            "type": "library",
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Desarrolla2\\Cache\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": 
+                "MIT"
+            ,
+            "authors": 
+                {
+                    "name": "Daniel González",
+                    "homepage": "http://desarrolla2.com/"
+                },
+                {
+                    "name": "Arnold Daniels",
+                    "homepage": "https://jasny.net/"
+                }
+            ,
+            "description": "Provides an cache interface for several adapters Apc, Apcu, File, Mongo, Memcache, Memcached, Mysql, Mongo, Redis is supported.",
+            "homepage": "https://github.com/desarrolla2/Cache/",
+            "keywords": 
+                "apc",
+                "apcu",
+                "cache",
+                "file",
+                "memcache",
+                "memcached",
+                "mongo",
+                "mysql",
+                "psr-16",
+                "redis",
+                "simple-cache"
+            ,
+            "support": {
+                "issues": "https://github.com/desarrolla2/Cache/issues",
+                "source": "https://github.com/desarrolla2/Cache/tree/master"
+            },
+            "install-path": "../desarrolla2/cache"
+        },
+        {
             "name": "doctrine/instantiator",
             "version": "1.5.0",
             "version_normalized": "1.5.0.0",
@@ -1657,6 +1737,69 @@
             "install-path": "../masterminds/html5"
         },
         {
+            "name": "monolog/monolog",
+            "version": "1.2.1",
+            "version_normalized": "1.2.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/Seldaek/monolog.git",
+                "reference": "d16496318c3e08e3bccfc3866e104e49cf25488a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/Seldaek/monolog/zipball/d16496318c3e08e3bccfc3866e104e49cf25488a",
+                "reference": "d16496318c3e08e3bccfc3866e104e49cf25488a",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0"
+            },
+            "require-dev": {
+                "mlehner/gelf-php": "1.0.*"
+            },
+            "suggest": {
+                "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+                "ext-mongo": "Allow sending log messages to a MongoDB server",
+                "mlehner/gelf-php": "Allow sending log messages to a GrayLog2 server"
+            },
+            "time": "2012-08-29T11:53:20+00:00",
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.3.x-dev"
+                }
+            },
+            "installation-source": "dist",
+            "autoload": {
+                "psr-0": {
+                    "Monolog": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": 
+                "MIT"
+            ,
+            "authors": 
+                {
+                    "name": "Jordi Boggiano",
+                    "email": "j.boggiano@seld.be",
+                    "homepage": "http://seld.be",
+                    "role": "Developer"
+                }
+            ,
+            "description": "Logging for PHP 5.3",
+            "homepage": "http://github.com/Seldaek/monolog",
+            "keywords": 
+                "log",
+                "logging"
+            ,
+            "support": {
+                "issues": "https://github.com/Seldaek/monolog/issues",
+                "source": "https://github.com/Seldaek/monolog/tree/1.2.1"
+            },
+            "install-path": "../monolog/monolog"
+        },
+        {
             "name": "myclabs/deep-copy",
             "version": "1.11.1",
             "version_normalized": "1.11.1.0",
@@ -3440,6 +3583,60 @@
             "install-path": "../psr/log"
         },
         {
+            "name": "psr/simple-cache",
+            "version": "1.0.1",
+            "version_normalized": "1.0.1.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/simple-cache.git",
+                "reference": "408d5eafb83c57f6365a3ca330ff23aa4a5fa39b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/simple-cache/zipball/408d5eafb83c57f6365a3ca330ff23aa4a5fa39b",
+                "reference": "408d5eafb83c57f6365a3ca330ff23aa4a5fa39b",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.3.0"
+            },
+            "time": "2017-10-23T01:57:42+00:00",
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "installation-source": "dist",
+            "autoload": {
+                "psr-4": {
+                    "Psr\\SimpleCache\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": 
+                "MIT"
+            ,
+            "authors": 
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "http://www.php-fig.org/"
+                }

roundcubemail-1.5.tar.gz/vendor/composer/installed.php Changed

@@ -28,6 +28,17 @@
             'reference' => '2e82dab3baa008e24a505649b0d583c31d31e894',
             'dev_requirement' => false,
         ),
+        'desarrolla2/cache' => array(
+            'pretty_version' => 'dev-master',
+            'version' => 'dev-master',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../desarrolla2/cache',
+            'aliases' => array(
+                0 => '9999999-dev',
+            ),
+            'reference' => '11d0e29ebd7ae12e2b53d90d7a9757b1c51c04e5',
+            'dev_requirement' => false,
+        ),
         'doctrine/instantiator' => array(
             'pretty_version' => '1.5.0',
             'version' => '1.5.0.0',
@@ -309,6 +320,15 @@
             'reference' => '897eb517a343a2281f11bc5556d6548db7d93947',
             'dev_requirement' => false,
         ),
+        'monolog/monolog' => array(
+            'pretty_version' => '1.2.1',
+            'version' => '1.2.1.0',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../monolog/monolog',
+            'aliases' => array(),
+            'reference' => 'd16496318c3e08e3bccfc3866e104e49cf25488a',
+            'dev_requirement' => false,
+        ),
         'myclabs/deep-copy' => array(
             'pretty_version' => '1.11.1',
             'version' => '1.11.1.0',
@@ -576,6 +596,21 @@
             'reference' => 'd49695b909c3b7628b6289db5479a1c204601f11',
             'dev_requirement' => false,
         ),
+        'psr/simple-cache' => array(
+            'pretty_version' => '1.0.1',
+            'version' => '1.0.1.0',
+            'type' => 'library',
+            'install_path' => __DIR__ . '/../psr/simple-cache',
+            'aliases' => array(),
+            'reference' => '408d5eafb83c57f6365a3ca330ff23aa4a5fa39b',
+            'dev_requirement' => false,
+        ),
+        'psr/simple-cache-implementation' => array(
+            'dev_requirement' => false,
+            'provided' => array(
+                0 => '1.0',
+            ),
+        ),
         'ralouphie/getallheaders' => array(
             'pretty_version' => '3.0.3',
             'version' => '3.0.3.0',

roundcubemail-1.5.tar.gz/vendor/desarrolla2 Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/.formatter.yml Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/.github Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/.github/workflows Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/.github/workflows/php.yml Added

@@ -0,0 +1,74 @@
+name: PHP
+
+on:
+  push:
+    branches:  master 
+  pull_request:
+    branches:  master 
+
+jobs:
+  run:
+    runs-on: ubuntu-latest
+    services:
+      mysql:
+        image: mysql:5.7
+        ports:
+          - 3306:3306
+        env:
+          MYSQL_ALLOW_EMPTY_PASSWORD: yes
+      redis:
+        image: redis:6.0
+        ports:
+          - 6379:6379
+      mongo:
+        image: mongo:4.2-bionic
+        ports:
+          - 27017:27017
+      memcached:
+        image: memcached:1.6
+        ports:
+          - 11211:11211
+
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - php: 7.2
+            composer: '--prefer-lowest'
+            desc: "Lowest versions"
+          - php: 7.4
+            composer: '--prefer-lowest'
+            desc: "Lowest versions"
+          - php: 7.2
+          - php: 7.3
+          - php: 7.4
+            coverage: '--coverage-clover /tmp/clover.xml'
+          - php: 8.0
+          - php: 8.1
+    name: PHP ${{ matrix.php }} ${{ matrix.desc }}
+
+    steps:
+    - uses: actions/checkout@v2
+
+    - name: Setup PHP
+      uses: shivammathur/setup-php@v2
+      with:
+        php-version: ${{ matrix.php }}
+        coverage: xdebug
+        extensions: apcu, mongodb, memcached
+        ini-values: apc.enable_cli=1,mysqli.default_host=127.0.0.1,mysqli.default_port=3306,mysqli.default_user=root
+
+    - name: Validate composer.json and composer.lock
+      run: composer validate
+
+    - name: Install dependencies
+      run: composer update --prefer-dist --no-progress ${{ matrix.composer }}
+
+    - name: Run PHPUnit
+      run: vendor/bin/phpunit ${{ matrix.coverage }}
+
+    - name: Upload coverage to Scrutinizer
+      if: ${{ matrix.coverage }}
+      run: >
+        wget https://scrutinizer-ci.com/ocular.phar -O "/tmp/ocular.phar" &&
+        php "/tmp/ocular.phar" code-coverage:upload --format=php-clover /tmp/clover.xml

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/.gitignore Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/.scrutinizer.yml Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/LICENSE Added

@@ -0,0 +1,19 @@
+Copyright (c) 2012-2013 Desarrolla2 - http://desarrolla2.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is furnished
+to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/README.md Added

@@ -0,0 +1,172 @@
+# Desarolla2 Cache
+
+A **simple cache** library, implementing the PSR-16(https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-16-simple-cache.md) standard using **immutable** objects.
+
+!life-is-hard-cache-is(https://user-images.githubusercontent.com/100821/41566888-ecd60cde-735d-11e8-893f-da42b2cd65e7.jpg)
+
+Caching is typically used throughout an applicatiton. Immutability ensure that modifying the cache behaviour in one
+location doesn't result in unexpected behaviour due to changes in unrelated code.
+
+_Desarolla2 Cache aims to be the most complete, correct and best performing PSR-16 implementation available._
+
+!Latest versionico-versionlink-packagist
+!Latest versionico-pre-releaselink-packagist
+!Software Licenseico-licenselink-license
+!Build Statusico-github-actionslink-github-actions
+!Coverage Statusico-coveragelink-scrutinizer
+!Quality Scoreico-code-qualitylink-scrutinizer
+!Total Downloadsico-downloadslink-downloads
+!Today Downloadsico-today-downloadslink-downloads
+!Gitterico-gitterlink-gitter
+
+
+## Installation
+
+```
+composer require desarrolla2/cache
+```
+
+## Usage
+
+
+``` php
+use Desarrolla2\Cache\Memory as Cache;
+
+$cache = new Cache();
+
+$value = $cache->get('key');
+
+if (!isset($value)) {
+    $value = do_something(); 
+    $cache->set('key', $value, 3600);
+}
+
+echo $value;
+```
+
+## Adapters
+
+* Apcu(docs/implementations/apcu.md)
+* File(docs/implementations/file.md)
+* Memcached(docs/implementations/memcached.md)
+* Memory(docs/implementations/memory.md)
+* MongoDB(docs/implementations/mongodb.md)
+* Mysqli(docs/implementations/mysqli.md)
+* NotCache(docs/implementations/notcache.md)
+* PhpFile(docs/implementations/phpfile.md)
+* Predis(docs/implementations/predis.md)
+* Redis(docs/implementations/redis.md)
+
+The following implementation allows you to combine cache adapters.
+
+* Chain(docs/implementations/chain.md)
+
+### Options
+
+You can set options for cache using the `withOption` or `withOptions` method.
+Note that all cache objects are immutable, setting an option creates a new
+object.
+
+#### TTL
+
+All cache implementations support the `ttl` option. This sets the default
+time (in seconds) that cache will survive. It defaults to one hour (3600
+seconds).
+
+Setting the TTL to 0 or a negative number, means the cache should live forever.
+
+## Methods
+
+### PSR-16 methods
+
+Each cache implementation has the following `Psr\SimpleCache\CacheInterface`
+methods:
+
+##### `get(string $key , mixed $default)`
+Retrieve the value corresponding to a provided key
+
+##### `has(string $key)`
+Retrieve the if value corresponding to a provided key exist
+
+##### `set(string $key, mixed $value , int $ttl)`
+Add a value to the cache under a unique key
+
+##### `delete(string $key)`
+Delete a value from the cache
+
+##### `clear()`
+Clear all cache
+
+##### `getMultiple(array $keys)`
+Obtains multiple cache items by their unique keys
+
+##### `setMultiple(array $values , int $ttl)`
+Persists a set of key => value pairs in the cache
+
+##### `deleteMultiple(array $keys)`
+Deletes multiple cache items in a single operation
+
+### Additional methods
+
+The `Desarrolla2\Cache\CacheInterface` also has the following methods:
+
+##### `withOption(string $key, string $value)`
+Set option for implementation. Creates a new instance.
+
+##### `withOptions(array $options)`
+Set multiple options for implementation. Creates a new instance.
+
+##### `getOption(string $key)`
+Get option for implementation.
+
+
+## Packers
+
+Cache objects typically hold a `Desarrolla2\Cache\Packer\PackerInterface`
+object. By default, packing is done using `serialize` and `unserialize`.
+
+Available packers are:
+
+* `SerializePacker` using `serialize` and `unserialize`
+* `JsonPacker` using `json_encode` and `json_decode`
+* `NopPacker` does no packing
+* `MongoDBBinaryPacker` using `serialize` and `unserialize` to store as BSON Binary(http://php.net/manual/en/class.mongodb-bson-binary.php)
+
+#### PSR-16 incompatible packers
+
+The `JsonPacker` does not fully comply with PSR-16, as packing and
+unpacking an object will probably not result in an object of the same class.
+
+The `NopPacker` is intended when caching string data only (like HTML output) or
+if the caching backend supports structured data. Using it when storing objects
+will might give unexpected results.
+
+## Contributors
+
+!Daniel González(https://avatars1.githubusercontent.com/u/661529?v=3&s=80)(https://github.com/desarrolla2)
+Twitter: @desarrolla2(https://twitter.com/desarrolla2)\
+!Arnold Daniels(https://avatars3.githubusercontent.com/u/100821?v=3&s=80)(https://github.com/jasny)
+Twitter: @ArnoldDaniels(https://twitter.com/ArnoldDaniels)
+
+ico-version: https://img.shields.io/packagist/v/desarrolla2/Cache.svg?style=flat-square
+ico-pre-release: https://img.shields.io/packagist/vpre/desarrolla2/Cache.svg?style=flat-square
+ico-license: https://img.shields.io/badge/license-MIT-brightgreen.svg?style=flat-square
+ico-travis: https://img.shields.io/travis/desarrolla2/Cache/master.svg?style=flat-square
+ico-coveralls: https://img.shields.io/coveralls/desarrolla2/Cache/master.svg?style=flat-square
+ico-code-quality: https://img.shields.io/scrutinizer/g/desarrolla2/cache.svg?style=flat-square
+ico-coverage: https://scrutinizer-ci.com/g/desarrolla2/Cache/badges/coverage.png?b=master
+ico-sensiolabs: https://img.shields.io/sensiolabs/i/5f139261-1ac1-4559-846a-723e09319a88.svg?style=flat-square
+ico-downloads: https://img.shields.io/packagist/dt/desarrolla2/cache.svg?style=flat-square
+ico-today-downloads: https://img.shields.io/packagist/dd/desarrolla2/cache.svg?style=flat-square
+ico-gitter: https://img.shields.io/badge/GITTER-JOIN%20CHAT%20%E2%86%92-brightgreen.svg?style=flat-square
+ico-github-actions: https://github.com/desarrolla2/Cache/workflows/PHP/badge.svg
+
+link-packagist: https://packagist.org/packages/desarrolla2/cache
+link-license: http://hassankhan.mit-license.org
+link-travis: https://travis-ci.org/desarrolla2/Cache
+link-github-actions: https://github.com/desarrolla2/Cache/actions
+link-coveralls: https://coveralls.io/github/desarrolla2/Cache
+link-scrutinizer: https://scrutinizer-ci.com/g/desarrolla2/cache
+link-sensiolabs: https://insight.sensiolabs.com/projects/5f139261-1ac1-4559-846a-723e09319a88
+link-downloads: https://packagist.org/packages/desarrolla2/cache
+link-gitter: https://gitter.im/desarrolla2/Cache?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/build.xml Added

@@ -0,0 +1,100 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<project name="Cache" default="build">
+
+    <target name="install" depends="composer"
+            description="Prepare for execution"/>
+
+    <target name="build" depends="install, init"
+            description="Run all tests and build everything"/>
+
+    <target name="metrics" depends="build, phpunit, phpdoc, pdepend, phpcs, phpmd"
+            description="Generate Metrics"/>
+
+    <target name="clean"
+            description="Cleanup build artifacts">
+        <delete dir="cache"/>
+        <delete dir="build"/>
+    </target>
+
+    <target name="init" depends="clean"
+            description="Prepare for build">
+        <mkdir dir="cache/htmlpurifier"/>
+        <mkdir dir="build/api"/>
+        <mkdir dir="build/coverage"/>
+        <mkdir dir="build/pdepend"/>
+        <mkdir dir="build/phpcs"/>
+        <mkdir dir="build/phpmd"/>
+    </target>
+
+    <target name="composer"
+            description="Composer install">
+        <exec executable="composer">
+            <arg value="install"/>
+        </exec>
+    </target>
+
+    <target name="phpdoc"
+            description="Generate API documentation using PHPDocumentor">
+        <exec executable="phpdoc">
+            <arg value="-d"/>
+            <arg value="src"/>
+            <arg value="-t"/>
+            <arg value="build/api/"/>
+        </exec>
+    </target>
+
+    <target name="phpunit"
+            description="Run unit tests using PHPUnit">
+        <exec executable="phpunit">
+            <arg value="-c"/>
+            <arg value="phpunit.xml"/>
+        </exec>
+    </target>
+
+    <target name="pdepend"
+            description="Generate software metrics charts using PHP_Depend">
+        <exec executable="pdepend">
+            <arg value="--jdepend-chart=build/pdepend/dependencies.svg"/>
+            <arg value="--overview-pyramid=build/pdepend/overview-pyramid.svg"/>
+            <arg value="src"/>
+        </exec>
+    </target>
+
+    <target name="phpcs"
+            description="Generate coding standard metrics using PHPCS">
+        <exec executable="phpcs">
+            <arg value="--standard=PSR2"/>
+            <arg value="--report-full=build/phpcs/full.txt"/>
+            <arg value="--report-summary=build/phpcs/sumary.txt"/>
+            <arg value="src"/>
+            <arg value="tests"/>
+        </exec>
+    </target>
+
+    <target name="phpmd"
+            description="Generate coding metrics for mess code using PHPMD">
+        <exec executable="phpmd">
+            <arg value="src"/>
+            <arg value="text"/>
+            <arg value="codesize,unusedcode,naming,design,controversial"/>
+            <arg value="--reportfile"/>
+            <arg value="build/phpmd/report.txt"/>
+        </exec>
+
+    </target>
+
+    <target name="cs" description="">
+        <parallel>
+            <exec executable="php-cs-fixer">
+                <arg line="fix src"/>
+            </exec>
+            <exec executable="php-formatter">
+                <arg line="formatter:header:fix src"/>
+            </exec>
+            <exec executable="php-formatter">
+                <arg line="formatter:use:sort src"/>
+            </exec>
+        </parallel>
+    </target>
+</project>

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/composer.json Added

@@ -0,0 +1,68 @@
+{
+    "name": "desarrolla2/cache",
+    "description": "Provides an cache interface for several adapters Apc, Apcu, File, Mongo, Memcache, Memcached, Mysql, Mongo, Redis is supported.",
+    "keywords": 
+        "cache",
+        "simple-cache",
+        "psr-16",
+        "apc",
+        "apcu",
+        "file",
+        "memcached",
+        "memcache",
+        "mysql",
+        "mongo",
+        "redis"
+    ,
+    "type": "library",
+    "license": "MIT",
+    "homepage": "https://github.com/desarrolla2/Cache/",
+    "authors": 
+        {
+            "name": "Daniel González",
+            "homepage": "http://desarrolla2.com/"
+        },
+        {
+            "name": "Arnold Daniels",
+            "homepage": "https://jasny.net/"
+        }
+    ,
+    "provide": {
+        "psr/simple-cache-implementation": "1.0"
+    },    
+    "require": {
+        "php": ">=7.2.0",
+        "psr/simple-cache": "^1.0"
+    },
+    "require-dev": {
+        "ext-apcu": "*",
+        "ext-json": "*",
+        "ext-mysqli": "*",
+        "ext-memcached": "*",
+        "ext-redis": "*",
+        "predis/predis": "~1.0.0",
+        "mongodb/mongodb": "^1.3",
+        "cache/integration-tests": "dev-master",
+        "phpunit/phpunit": "^8.3 || ^9.0",
+        "phpstan/phpstan": "^0.12.29",
+        "symfony/phpunit-bridge": "^5.2",
+        "mikey179/vfsstream": "v1.6.10"
+    },
+    "autoload": {
+        "psr-4": {
+            "Desarrolla2\\Cache\\": "src/"
+        }
+    },
+    "autoload-dev": {
+        "psr-4": {
+            "Desarrolla2\\Test\\Cache\\": "tests/"
+        }
+    },
+    "scripts": {
+        "test": 
+            "phpstan analyse",
+            "phpunit --colors=always",
+            "phpcs -p src"
+        
+    }   
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/apcu.md Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/chain.md Added

@@ -0,0 +1,37 @@
+# Chain
+
+The Cache chain allows you to use multiple implementations to store cache. For
+instance, you can use both fast volatile (in-memory) storage and slower
+non-volatile (disk) storage. Alternatively you can have a local storage
+as well as a shared storage service. 
+
+``` php
+use Desarrolla2\Cache\Chain as CacheChain;
+use Desarrolla2\Cache\Memory as MemoryCache;
+use Desarrolla2\Cache\Predis as PredisCache;
+
+$cache = new CacheChain(
+    (new MemoryCache())->withOption('ttl', 3600),
+    (new PredisCache())->withOption('ttl', 10800)
+);
+```
+
+The Chain cache implementation doesn't use any option. It uses the `Nop` packer
+by default.
+
+Typically it's useful to specify a maximum `ttl` for each implementation. This
+means that the volatile memory only holds items that are used often.
+
+The following actions propogate to all cache adapters in the chain
+
+* `set`
+* `setMultiple`
+* `delete`
+* `deleteMultiple`
+* `clear`
+
+For the following actions all nodes are tried in sequence
+
+* `has`
+* `get`
+* `getMultiple`
\ No newline at end of file

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/file.md Added

@@ -0,0 +1,82 @@
+# File
+
+Save the cache as file to on the filesystem.
+
+You must pass a cache directory to the constructor.
+
+``` php
+use Desarrolla2\Cache\File as FileCache;
+
+$cache = new FileCache(sys_get_temp_dir() . '/cache');
+```
+
+### Options
+
+| name         | type                              | default        |                                       |
+| ------------ | --------------------------------- | -------------- | ------------------------------------- |
+| ttl          | int                               | null           | Maximum time to live in seconds       |
+| ttl-strategy | string ('embed', 'file', 'mtime') | "embed"        | Strategy to store the TTL             |
+| prefix       | string                            | ""             | Key prefix                            |
+| filename     | string or callable                | "%s.php.cache" | Filename as sprintf format            |
+
+#### TTL strategy option
+
+The ttl strategy determines how the TTL is stored. Typical filesystems don't
+allow custom file properties, so we'll have to use one of these strategies:
+
+| strategy |                                                 |
+| -------- | ----------------------------------------------- |
+| embed    | Embed the TTL as first line of the file         |
+| file     | Create a TTL file in addition to the cache file |
+| mtime    | Use mtime + max ttl                         |
+
+The 'mtime' strategy is not PSR-16 compliant, as the TTL passed to the `set()`
+method is ignored. Only the `ttl` option for is used on `get()` and `has()`.
+
+mtime: https://www.unixtutorial.org/2008/04/atime-ctime-mtime-in-unix-filesystems/
+
+#### Filename option
+
+The `filename` will be parsed using `sprintf` where '%s' is substituted with
+the key. The default extension is automatically determined based on the
+packer.
+
+Instead of a string, `filename` may also be set to a callable, like a callable
+object or closure. In that case the callable will be called to create a
+filename as
+
+    $filename = $callable($key);
+
+##### BasicFilename
+
+The library comes with invokable object as callable for the filename. The
+`BasicFilename` object works as described above.
+
+##### TrieFilename
+
+The `TrieFilename` object will create a prefix tree directory structure. This
+is useful where a lot of cache files would cause to many files in a directory.
+
+Specify the `sprintf` format and the directory level to the constructor when
+creating a `TrieFilename` object.
+
+``` php
+use Desarrolla2\Cache\File as FileCache;
+use Desarrolla2\Cache\File\TrieFilename;
+
+$callback = new TrieFilename('%s.php.cache', 2);
+
+$cache = (new FileCache(sys_get_temp_dir() . '/cache'))
+    ->withOption('filename', $callback);
+```
+
+In this case, adding an item with key `foobar` would be create a file at
+
+    /tmp/cache/f/fo/foobar.php.cache
+
+### Packer
+
+By default the `SerializePacker`(../packers/serialize.md) is used. The
+`NopPacker`(../packers/nop.md) can be used if the values are strings.
+Other packers, like the `JsonPacker`(../packers/json.md) are also
+useful with file cache.

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/memcached.md Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/memory.md Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/mongodb.md Added

@@ -0,0 +1,45 @@
+# Mongo
+
+Use it to store the cache in a Mongo database. Requires the mongodb extension
+and the mongodb/mongodb(https://github.com/mongodb/mongo-php-library)
+library.
+
+You must pass a `MongoDB\Collection` object to the cache constructor.
+
+``` php
+<?php
+
+use Desarrolla2\Cache\Mongo as MongoCache;
+use MongoDB\Client;
+
+$client = new Client('mongodb://localhost:27017');
+$database = $client->selectDatabase('mycache');
+$collection = $database->selectCollection('cache');
+
+$cache = new MongoCache($collection);
+```
+
+MonoDB will always automatically create the database and collection if needed. 
+
+### Options
+
+| name       | type      | default |                                       |
+| ---------  | ----      | ------- | ------------------------------------- |
+| initialize | bool      | true    | Enable auto-initialize                |
+| ttl        | int       | null    | Maximum time to live in seconds       |
+| prefix     | string    | ""      | Key prefix                            |
+
+#### Initialize option
+
+If `initialize` is enabled, the cache implementation will automatically create
+a ttl index(https://docs.mongodb.com/manual/core/index-ttl/). In production
+it's better to disable auto-initialization and create the ttl index explicitly
+when setting up the database. This prevents a `createIndex()` call on each
+request. 
+
+### Packer
+
+By default the `MongoDBBinaryPacker`(../packers/mongodbbinary.md) is used. It
+serializes the data and stores it in a Binary BSON variable(http://php.net/manual/en/class.mongodb-bson-binary.php). 
+If the data is a UTF-8 string of simple array or stdClass object, it may be
+useful to use the `NopPacker`(../packers/nop.md) instead.

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/mysqli.md Added

@@ -0,0 +1,47 @@
+# Mysqli
+
+Cache to a MySQL database(https://www.mysql.com/) using the
+mysqli(http://php.net/manual/en/book.mysqli.php) PHP extension.
+
+You must pass a `mysqli` connection object to the constructor.
+
+``` php
+<?php
+    
+use Desarrolla2\Cache\Mysqli as MysqliCache;
+
+$db = new mysqli('localhost');
+$cache = new MysqliCache($db);
+```
+
+### Options
+
+| name       | type      | default |                                       |
+| ---------  | ----      | ------- | ------------------------------------- |
+| initialize | bool      | true    | Enable auto-initialize                |
+| ttl        | int       | null    | Maximum time to live in seconds       |
+| prefix     | string    | ""      | Key prefix                            |
+
+#### Initialize option
+
+If `initialize` is enabled, the cache implementation will automatically create
+a scheduled event(https://dev.mysql.com/doc/refman/5.7/en/event-scheduler.html).
+
+```
+DELIMITER ;;
+
+CREATE TABLE IF NOT EXISTS `cache` (`key` VARCHAR(255), `value` TEXT, `ttl` INT UNSIGNED, PRIMARY KEY (`key`));;
+
+CREATE EVENT `apply_ttl_cache` ON SCHEDULE 1 HOUR 
+DO BEGIN
+    DELETE FROM `cache` WHERE `ttl` < NOW();
+END;;
+```
+
+In production it's better to disable auto-initialization and create the event
+explicitly when setting up the database. This prevents a `CREATE TABLE` and
+`CREATE EVENT` query on each request. 
+
+### Packer
+
+By default the `SerializePacker`(../packers/serialize.md) is used.

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/notcache.md Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/phpfile.md Added

@@ -0,0 +1,74 @@
+# PhpFile
+
+Save the cache as PHP script to on the filesystem using 
+`var_export`(http://php.net/manual/en/function.var-export.php) when storing
+cache and `include`(http://php.net/manual/en/function.include.php) when
+loading cache.
+
+The implementation leverages the PHP engine’s in-memory file caching (opcache)
+to cache application data in addition to code. This method is particularly fast
+in PHP7.2+ due to opcode cache optimizations.
+
+PHP file caching should primarily be used for arrays and objects. There is no
+performance benefit over APCu for storing strings.
+
+read more
+
+``` php
+use Desarrolla2\Cache\PhpFile as PhpFileCache;
+
+$cache = new PhpFileCache();
+```
+
+### Options
+
+| name      | type               | default        |                                       |
+| --------- | ------------------ | -------------- | ------------------------------------- |
+| ttl       | int                | null           | Maximum time to live in seconds       |
+| prefix    | string             | ""             | Key prefix                            |
+| filename  | string or callable | "%s.php"       | Filename as sprintf format            |
+
+#### Filename option
+
+The `filename` will be parsed using `sprintf` where '%s' is substituted with
+the key.
+
+Instead of a string, `filename` may also be set to a callable, like a callable
+object or closure. In that case the callable will be called to create a
+filename as
+
+    $filename = $callable($key);
+
+##### BasicFilename
+
+The library comes with invokable object as callable for the filename. The
+`BasicFilename` object works as described above.
+
+##### TrieFilename
+
+The `TrieFilename` object will create a prefix tree directory structure. This
+is useful where a lot of cache files would cause to many files in a directory.
+
+Specify the `sprintf` format and the directory level to the constructor when
+creating a `TrieFilename` object.
+
+``` php
+use Desarrolla2\Cache\File as FileCache;
+use Desarrolla2\Cache\File\TrieFilename;
+
+$callback = new TrieFilename('%s.php', 2);
+
+$cache = (new FileCache(sys_get_temp_dir() . '/cache'))
+    ->withOption('filename', $callback);
+```
+
+In this case, adding an item with key `foobar` would be create a file at
+
+    /tmp/cache/f/fo/foobar.php
+
+### Packer
+
+By default the `NopPacker`(../packers/nop.md) is used. Other packers should
+not be used.
+
+read more: https://medium.com/@dylanwenzlau/500x-faster-caching-than-redis-memcache-apc-in-php-hhvm-dcd26e8447ad

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/predis.md Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/implementations/redis.md Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/docs/performance.md Added

@@ -0,0 +1,40 @@
+# Performance test
+
+Here are my performance tests, you can view the results ordered from faster to slower.
+
+| Adapter         | 10.000 set    | 10.000 has    | 10.000 get |
+| :-------------- | -----------:  | -----------:  | ---------: | 
+| NoCache         | 0.0637        | 0.0482        | 0.0488     | 
+| Apcu             | 0.0961        | 0.0556        | 0.0770     |
+| File            | 0.6881        | 0.3426        | 0.3107     | 
+| Mongo           | 13.8144       | 30.0203       | 24.4214    | 
+
+
+## how i run the test? 
+
+The test its the same for all Adapters and look like this.
+
+``` php
+    <?php
+
+    $timer = new Timer();
+    for ($i = 1; $i <= 10000; $i++) {
+        $cache->set(md5($i), md5($i), 3600);
+    }
+    $timer->mark('10.000 set');
+    for ($i = 1; $i <= 10000; $i++) {
+        $cache->has(md5($i));
+    }
+    $timer->mark('10.000 has');
+    for ($i = 1; $i <= 10000; $i++) {
+        $cache->get(md5($i));
+    }
+    $timer->mark('10.000 get');
+
+```
+
+ if you want run the tests them execute.
+
+``` sh
+    php test/performance/AdapterName.php
+```
\ No newline at end of file

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/phpcs.xml Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/phpstan.neon Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/phpunit.xml.dist Added

@@ -0,0 +1,42 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<phpunit
+  bootstrap="./vendor/autoload.php"
+  convertWarningsToExceptions="true"
+  convertNoticesToExceptions="true"
+  convertErrorsToExceptions="true"
+  backupStaticAttributes="false"
+  processIsolation="false"
+  stopOnFailure="false"
+  backupGlobals="false"
+  colors="true"
+>
+    <testsuites>
+        <testsuite name="Desarrolla2 Cache test suite">
+            <directory suffix="Test.php">./tests</directory>
+        </testsuite>
+    </testsuites>
+
+    <filter>
+        <whitelist>
+            <directory>./src</directory>
+        </whitelist>
+    </filter>
+
+    <php>
+        
+        
+        
+        <const name="CACHE_TESTS_MYSQLI_DATABASE" value="cache_tests" />
+
+        <const name="CACHE_TESTS_MONGO_DSN" value="mongodb://localhost:27017" />
+        <const name="CACHE_TESTS_MONGO_DATABASE" value="cache_tests" />
+
+        <const name="CACHE_TESTS_MEMCACHED_SERVER" value="localhost:11211" />
+
+        <const name="CACHE_TESTS_PREDIS_DSN" value="tcp://localhost:6379" />
+
+        <const name="CACHE_TESTS_REDIS_HOST" value="localhost" />
+        <const name="CACHE_TESTS_REDIS_PORT" value="6379" />
+    </php>
+</phpunit>

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/AbstractCache.php Added

@@ -0,0 +1,296 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Option\PrefixTrait as PrefixOption;
+use Desarrolla2\Cache\Option\TtlTrait as TtlOption;
+use Desarrolla2\Cache\Packer\PackingTrait as Packing;
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+use DateTimeImmutable;
+use DateInterval;
+use Traversable;
+
+/**
+ * AbstractAdapter
+ */
+abstract class AbstractCache implements CacheInterface
+{
+    use PrefixOption;
+    use TtlOption;
+    use Packing;
+
+    /**
+     * Make a clone of this object.
+     *
+     * @return static
+     */
+    protected function cloneSelf(): self
+    {
+        return clone $this;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function withOption(string $key, $value): self
+    {
+        return $this->withOptions($key => $value);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function withOptions(array $options): self
+    {
+        $cache = $this->cloneSelf();
+
+        foreach ($options as $key => $value) {
+            $method = "set" . str_replace('-', '', $key) . "Option";
+
+            if (empty($key) || !method_exists($cache, $method)) {
+                throw new InvalidArgumentException("unknown option '$key'");
+            }
+
+            $cache->$method($value);
+        }
+
+        return $cache;
+    }
+    
+    /**
+     * {@inheritdoc}
+     */
+    public function getOption($key)
+    {
+        $method = "get" . str_replace('-', '', $key) . "Option";
+        
+        if (empty($key) || !method_exists($this, $method)) {
+            throw new InvalidArgumentException("unknown option '$key'");
+        }
+        
+        return $this->$method();
+    }
+
+
+    /**
+     * Validate the key
+     *
+     * @param string $key
+     * @return void
+     * @throws InvalidArgumentException
+     */
+    protected function assertKey($key): void
+    {
+        if (!is_string($key)) {
+            $type = (is_object($key) ? get_class($key) . ' ' : '') . gettype($key);
+            throw new InvalidArgumentException("Expected key to be a string, not $type");
+        }
+
+        if ($key === '' || preg_match('~{}()/\\\\@:~', $key)) {
+            throw new InvalidArgumentException("Invalid key '$key'");
+        }
+    }
+
+    /**
+     * Assert that the keys are an array or traversable
+     * 
+     * @param iterable $subject
+     * @param string   $msg
+     * @return void
+     * @throws InvalidArgumentException if subject are not iterable
+     */
+    protected function assertIterable($subject, $msg): void
+    {
+        $iterable = function_exists('is_iterable')
+            ? is_iterable($subject)
+            : is_array($subject) || $subject instanceof Traversable;
+        
+        if (!$iterable) {
+            throw new InvalidArgumentException($msg);
+        }
+    }
+
+    /**
+     * Turn the key into a cache identifier
+     *
+     * @param string $key
+     * @return string
+     * @throws InvalidArgumentException
+     */
+    protected function keyToId($key): string
+    {
+        $this->assertKey($key);
+
+        return sprintf('%s%s', $this->prefix, $key);
+    }
+
+    /**
+     * Create a map with keys and ids
+     *
+     * @param iterable $keys
+     * @return array
+     * @throws InvalidArgumentException
+     */
+    protected function mapKeysToIds($keys): array
+    {
+        $this->assertIterable($keys, 'keys not iterable');
+
+        $map = ;
+
+        foreach ($keys as $key) {
+            $id = $this->keyToId($key);
+            $map$id = $key;
+        }
+
+        return $map;
+    }
+
+
+    /**
+     * Pack all values and turn keys into ids
+     *
+     * @param iterable $values
+     * @return array
+     */
+    protected function packValues(iterable $values): array
+    {
+        $packed = ;
+
+        foreach ($values as $key => $value) {
+            $id = $this->keyToId(is_int($key) ? (string)$key : $key);
+            $packed$id = $this->pack($value);
+        }
+
+        return $packed;
+    }
+
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        $this->assertIterable($keys, 'keys not iterable');
+        
+        $result = ;
+        
+        foreach ($keys as $key) {
+            $result$key = $this->get($key, $default);
+        }
+        
+        return $result;
+    }
+
+    /**

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/AbstractFile.php Added

@@ -0,0 +1,216 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+use Desarrolla2\Cache\Option\FilenameTrait as FilenameOption;
+
+/**
+ * Abstract class for using files as cache.
+ *
+ * @package Desarrolla2\Cache
+ */
+abstract class AbstractFile extends AbstractCache
+{
+    use FilenameOption;
+
+    /**
+     * @var string
+     */
+    protected $cacheDir;
+
+
+    /**
+     * Class constructor
+     *
+     * @param string|null $cacheDir
+     */
+    public function __construct(?string $cacheDir = null)
+    {
+        if (!$cacheDir) {
+            $cacheDir = realpath(sys_get_temp_dir()) . DIRECTORY_SEPARATOR . 'cache';
+            if(!is_dir($cacheDir)) {
+                mkdir($cacheDir, 0777, true);
+            }
+        }
+
+        $this->cacheDir = rtrim($cacheDir, '/');
+    }
+
+    /**
+     * Validate the key
+     *
+     * @param string $key
+     * @return void
+     * @throws InvalidArgumentException
+     */
+    protected function assertKey($key): void
+    {
+        parent::assertKey($key);
+
+        if (strpos($key, '*')) {
+            throw new InvalidArgumentException("Key may not contain the character '*'");
+        }
+    }
+
+
+    /**
+     * Get the contents of the cache file.
+     *
+     * @param string $cacheFile
+     * @return string
+     */
+    protected function readFile(string $cacheFile): string
+    {
+        return file_get_contents($cacheFile);
+    }
+
+    /**
+     * Read the first line of the cache file.
+     *
+     * @param string $cacheFile
+     * @return string
+     */
+    protected function readLine(string $cacheFile): string
+    {
+        $fp = fopen($cacheFile, 'r');
+        $line = fgets($fp);
+        fclose($fp);
+
+        return $line;
+    }
+
+    /**
+     * Create a cache file
+     *
+     * @param string $cacheFile
+     * @param string $contents
+     * @return bool
+     */
+    protected function writeFile(string $cacheFile, string $contents): bool
+    {
+        $dir = dirname($cacheFile);
+
+        if ($dir !== $this->cacheDir && !is_dir($dir)) {
+            mkdir($dir, 0775, true);
+        }
+
+        return (bool)file_put_contents($cacheFile, $contents);
+    }
+
+    /**
+     * Delete a cache file
+     *
+     * @param string $file
+     * @return bool
+     */
+    protected function deleteFile(string $file): bool
+    {
+        return !is_file($file) || unlink($file);
+    }
+
+    /**
+     * Remove all files from a directory.
+     */
+    protected function removeFiles(string $dir): bool
+    {
+        $success = true;
+
+        $generator = $this->getFilenameOption();
+        $objects = $this->streamSafeGlob($dir, $generator('*'));
+
+        foreach ($objects as $object) {
+            $success = $this->deleteFile($object) && $success;
+        }
+
+        return $success;
+    }
+
+    /**
+     * Recursive delete an empty directory.
+     *
+     * @param string $dir
+     */
+    protected function removeRecursively(string $dir): bool
+    {
+        $success = $this->removeFiles($dir);
+
+        $objects = $this->streamSafeGlob($dir, '*');
+
+        foreach ($objects as $object) {
+            if (!is_dir($object)) {
+                continue;
+            }
+
+            if (is_link($object)) {
+                unlink($object);
+            } else {
+                $success = $this->removeRecursively($object) && $success;
+                rmdir($object);
+            }
+        }
+
+        return $success;
+    }
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function delete($key)
+    {
+        $cacheFile = $this->getFilename($key);
+
+        return $this->deleteFile($cacheFile);
+    }
+
+    /**
+     * Delete cache directory.
+     *
+     * {@inheritdoc}
+     */
+    public function clear()
+    {
+        $this->removeRecursively($this->cacheDir);
+
+        return true;
+    }
+
+    /**
+     * Glob that is safe with streams (vfs for example)
+     *
+     * @param string $directory
+     * @param string $filePattern
+     * @return array
+     */
+    protected function streamSafeGlob(string $directory, string $filePattern): array
+    {

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Apcu.php Added

@@ -0,0 +1,88 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Exception\CacheException;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\NopPacker;
+
+/**
+ * Apcu
+ */
+class Apcu extends AbstractCache
+{
+    /**
+     * Create the default packer for this cache implementation
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new NopPacker();
+    }
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $ttlSeconds = $this->ttlToSeconds($ttl);
+
+        if (isset($ttlSeconds) && $ttlSeconds <= 0) {
+            return $this->delete($key);
+        }
+
+        return apcu_store($this->keyToId($key), $this->pack($value), $ttlSeconds ?? 0);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        $packed = apcu_fetch($this->keyToId($key), $success);
+
+        return $success ? $this->unpack($packed) : $default;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        return apcu_exists($this->keyToId($key));
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function delete($key)
+    {
+        $id = $this->keyToId($key);
+
+        return apcu_delete($id) || !apcu_exists($id);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function clear()
+    {
+        return apcu_clear_cache();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/CacheInterface.php Added

@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+namespace Desarrolla2\Cache;
+
+use Psr\SimpleCache\CacheInterface as PsrCacheInterface;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\KeyMaker\KeyMakerInterface;
+
+/**
+ * CacheInterface
+ */
+interface CacheInterface extends PsrCacheInterface
+{
+    /**
+     * Set option for cache
+     *
+     * @param string $key
+     * @param mixed $value
+     * @return static
+     */
+    public function withOption(string $key, $value);
+
+    /**
+     * Set multiple options for cache
+     *
+     * @param array $options
+     * @return static
+     */
+    public function withOptions(array $options);
+
+    /**
+     * Get option for cache
+     *
+     * @param string $key
+     * @return mixed
+     */
+    public function getOption($key);
+
+    /**
+     * Set the packer
+     *
+     * @param PackerInterface $packer
+     * @return static
+     */
+    public function withPacker(PackerInterface $packer);
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Chain.php Added

@@ -0,0 +1,192 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Packer\NopPacker;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+
+/**
+ * Use multiple cache adapters.
+ */
+class Chain extends AbstractCache
+{
+    /**
+     * @var CacheInterface
+     */
+    protected $adapters;
+
+    /**
+     * Create the default packer for this cache implementation
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new NopPacker();
+    }
+
+
+    /**
+     * Chain constructor.
+     *
+     * @param CacheInterface $adapters  Fastest to slowest
+     */
+    public function __construct(array $adapters)
+    {
+        foreach ($adapters as $adapter) {
+            if (!$adapter instanceof CacheInterface) {
+                throw new InvalidArgumentException("All adapters should be a cache implementation");
+            }
+        }
+
+        $this->adapters = $adapters;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $success = true;
+
+        foreach ($this->adapters as $adapter) {
+            $success = $adapter->set($key, $value, $ttl) && $success;
+        }
+
+        return $success;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setMultiple($values, $ttl = null)
+    {
+        $success = true;
+
+        foreach ($this->adapters as $adapter) {
+            $success = $adapter->setMultiple($values, $ttl) && $success;
+        }
+
+        return $success;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        foreach ($this->adapters as $adapter) {
+            $result = $adapter->get($key); // Not using $default as we want to get null if the adapter doesn't have it
+
+            if (isset($result)) {
+                return $result;
+            }
+        }
+
+        return $default;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        $this->assertIterable($keys, 'keys are not iterable');
+
+        $missing = ;
+        $values = ;
+
+        foreach ($keys as $key) {
+            $this->assertKey($key);
+
+            $missing = $key;
+            $values$key = $default;
+        }
+
+        foreach ($this->adapters as $adapter) {
+            if (empty($missing)) {
+                break;
+            }
+
+            $found = ;
+            foreach ($adapter->getMultiple($missing) as $key => $value) {
+                if (isset($value)) {
+                    $found$key = $value;
+                }
+            }
+
+            $values = array_merge($values, $found);
+            $missing = array_values(array_diff($missing, array_keys($found)));
+        }
+
+        return $values;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        foreach ($this->adapters as $adapter) {
+            if ($adapter->has($key)) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function delete($key)
+    {
+        $success = true;
+
+        foreach ($this->adapters as $adapter) {
+            $success = $adapter->delete($key) && $success;
+        }
+
+        return $success;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function deleteMultiple($keys)
+    {
+        $success = true;
+
+        foreach ($this->adapters as $adapter) {
+            $success = $adapter->deleteMultiple($keys) && $success;
+        }
+
+        return $success;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function clear()
+    {
+        $success = true;
+
+        foreach ($this->adapters as $adapter) {
+            $success = $adapter->clear() && $success;
+        }
+
+        return $success;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Exception Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Exception/BadMethodCallException.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Exception/CacheException.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Exception/InvalidArgumentException.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Exception/UnexpectedValueException.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/File Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/File.php Added

@@ -0,0 +1,185 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+use Desarrolla2\Cache\Exception\UnexpectedValueException;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\SerializePacker;
+
+/**
+ * Cache file.
+ */
+class File extends AbstractFile
+{
+    /**
+     * @var string  'embed', 'file', 'mtime'
+     */
+    protected $ttlStrategy = 'embed';
+
+    /**
+     * Create the default packer for this cache implementation
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new SerializePacker();
+    }
+
+    /**
+     * Set TTL strategy
+     *
+     * @param string $strategy
+     */
+    protected function setTtlStrategyOption($strategy)
+    {
+        if (!in_array($strategy, 'embed', 'file', 'mtime')) {
+            throw new InvalidArgumentException("Unknown strategy '$strategy', should be 'embed', 'file' or 'mtime'");
+        }
+
+        $this->ttlStrategy = $strategy;
+    }
+
+    /**
+     * Get TTL strategy
+     *
+     * @return string
+     */
+    protected function getTtlStrategyOption(): string
+    {
+        return $this->ttlStrategy;
+    }
+
+
+    /**
+     * Get the TTL using one of the strategies
+     *
+     * @param string $cacheFile
+     * @return int
+     */
+    protected function getTtl(string $cacheFile)
+    {
+        switch ($this->ttlStrategy) {
+            case 'embed':
+                return (int)$this->readLine($cacheFile);
+            case 'file':
+                return file_exists("$cacheFile.ttl")
+                    ? (int)file_get_contents("$cacheFile.ttl")
+                    : PHP_INT_MAX;
+            case 'mtime':
+                return $this->ttl > 0 ? filemtime($cacheFile) + $this->ttl : PHP_INT_MAX;
+        }
+
+        throw new \InvalidArgumentException("Invalid TTL strategy '{$this->ttlStrategy}'");
+    }
+
+    /**
+     * Set the TTL using one of the strategies
+     *
+     * @param int|null $expiration
+     * @param string   $contents
+     * @param string   $cacheFile
+     * @return string  The (modified) contents
+     */
+    protected function setTtl($expiration, $contents, $cacheFile)
+    {
+        switch ($this->ttlStrategy) {
+            case 'embed':
+                $contents = ($expiration ?? PHP_INT_MAX) . "\n" . $contents;
+                break;
+            case 'file':
+                if ($expiration !== null) {
+                    file_put_contents("$cacheFile.ttl", $expiration);
+                }
+                break;
+            case 'mtime':
+                // nothing
+                break;
+        }
+
+        return $contents;
+    }
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        $cacheFile = $this->getFilename($key);
+        
+        if (!file_exists($cacheFile)) {
+            return $default;
+        }
+        
+        if ($this->ttlStrategy === 'embed') {
+            $ttl, $packed = explode("\n", $this->readFile($cacheFile), 2);
+        } else {
+            $ttl = $this->getTtl($cacheFile);
+        }
+
+        if ((int)$ttl <= time()) {
+            $this->deleteFile($cacheFile);
+            return $default;
+        }
+        
+        if (!isset($packed)) {
+            $packed = $this->readFile($cacheFile); // Other ttl strategy than embed
+        }
+        
+        return $this->unpack($packed);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        $cacheFile = $this->getFilename($key);
+
+        if (!file_exists($cacheFile)) {
+            return false;
+        }
+
+        $ttl = $this->getTtl($cacheFile);
+
+        if ($ttl <= time()) {
+            $this->deleteFile($cacheFile);
+            return false;
+        }
+
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $cacheFile = $this->getFilename($key);
+        $packed = $this->pack($value);
+
+        if (!is_string($packed)) {
+            throw new UnexpectedValueException("Packer must create a string for the data to be cached to file");
+        }
+
+        $contents = $this->setTtl($this->ttlToTimestamp($ttl), $packed, $cacheFile);
+
+        return $this->writeFile($cacheFile, $contents);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/File/BasicFilename.php Added

@@ -0,0 +1,68 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\File;
+
+/**
+ * Create a path for a key
+ */
+class BasicFilename
+{
+    /**
+     * @var string
+     */
+    protected $format;
+
+    /**
+     * BasicFilename constructor.
+     *
+     * @param string $format
+     */
+    public function __construct(string $format)
+    {
+        $this->format = $format;
+    }
+
+    /**
+     * Get the format
+     *
+     * @return string
+     */
+    public function getFormat(): string
+    {
+        return $this->format;
+    }
+
+    /**
+     * Create the path for a key
+     *
+     * @param string $key
+     * @return string
+     */
+    public function __invoke(string $key): string
+    {
+        return sprintf($this->format, $key ?: '*');
+    }
+
+    /**
+     * Cast to string
+     *
+     * @return string
+     */
+    public function __toString(): string
+    {
+        return $this->getFormat();
+    }
+}
\ No newline at end of file

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/File/TrieFilename.php Added

@@ -0,0 +1,121 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\File;
+
+/**
+ * Create a path for a key as prefix tree directory structure.
+ *
+ * @see https://en.wikipedia.org/wiki/Trie
+ */
+class TrieFilename
+{
+    /**
+     * @var string
+     */
+    protected $format;
+
+    /**
+     * @var int
+     */
+    protected $levels;
+
+    /**
+     * @var bool
+     */
+    protected $hash;
+
+
+    /**
+     * TrieFilename constructor.
+     *
+     * @param string $format
+     * @param int    $levels  The depth of the structure
+     * @param bool   $hash    MD5 hash the key to get a better spread
+     */
+    public function __construct(string $format, int $levels = 1, bool $hash = false)
+    {
+        $this->format = $format;
+        $this->levels = $levels;
+        $this->hash = $hash;
+    }
+
+    /**
+     * Get the format
+     *
+     * @return string
+     */
+    public function getFormat(): string
+    {
+        return $this->format;
+    }
+
+    /**
+     * Get the depth of the structure
+     *
+     * @return int
+     */
+    public function getLevels(): int
+    {
+        return $this->levels;
+    }
+
+    /**
+     * Will the key be hashed to create the trie.
+     *
+     * @return bool
+     */
+    public function isHashed(): bool
+    {
+        return $this->hash;
+    }
+
+
+    /**
+     * Create the path for a key
+     *
+     * @param string $key
+     * @return string
+     */
+    public function __invoke(string $key): string
+    {
+        if (empty($key)) {
+            return $this->wildcardPath();
+        }
+
+        $dirname = $this->hash ? base_convert(md5($key), 16, 36) : $key;
+        $filename = sprintf($this->format, $key);
+
+        $path = '';
+
+        for ($length = 1; $length <= $this->levels; $length++) {
+            $path .= substr($dirname, 0, $length) . DIRECTORY_SEPARATOR;
+        }
+
+        return $path . $filename;
+    }
+
+    /**
+     * Get a path for all files (using glob)
+     *
+     * @return string
+     */
+    protected function wildcardPath(): string
+    {
+        $filename = sprintf($this->format, '*');
+
+        return str_repeat('*' . DIRECTORY_SEPARATOR, $this->levels) . $filename;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Memcached.php Added

@@ -0,0 +1,218 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\NopPacker;
+use Memcached as MemcachedServer;
+
+/**
+ * Memcached
+ */
+class Memcached extends AbstractCache
+{
+    /**
+     * @var MemcachedServer
+     */
+    protected $server;
+
+    /**
+     * @param MemcachedServer $server
+     */
+    public function __construct(MemcachedServer $server)
+    {
+        $this->server = $server;
+    }
+
+
+    /**
+     * Create the default packer for this cache implementation
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new NopPacker();
+    }
+
+    /**
+     * Validate the key
+     *
+     * @param string $key
+     * @return void
+     * @throws InvalidArgumentException
+     */
+    protected function assertKey($key): void
+    {
+        parent::assertKey($key);
+
+        if (strlen($key) > 250) {
+            throw new InvalidArgumentException("Key to long, max 250 characters");
+        }
+    }
+
+    /**
+     * Pack all values and turn keys into ids
+     *
+     * @param iterable $values
+     * @return array
+     */
+    protected function packValues(iterable $values): array
+    {
+        $packed = ;
+
+        foreach ($values as $key => $value) {
+            $this->assertKey(is_int($key) ? (string)$key : $key);
+            $packed$key = $this->pack($value);
+        }
+
+        return $packed;
+    }
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        $this->assertKey($key);
+
+        $data = $this->server->get($key);
+
+        if ($this->server->getResultCode() !== MemcachedServer::RES_SUCCESS) {
+            return $default;
+        }
+
+        return $this->unpack($data);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        $this->assertKey($key);
+        $this->server->get($key);
+
+        $result = $this->server->getResultCode();
+
+        return $result === MemcachedServer::RES_SUCCESS;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $this->assertKey($key);
+
+        $packed = $this->pack($value);
+        $ttlTime = $this->ttlToMemcachedTime($ttl);
+
+        if ($ttlTime === false) {
+            return $this->delete($key);
+        }
+
+        $success = $this->server->set($key, $packed, $ttlTime);
+
+        return $success;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function delete($key)
+    {
+        $this->server->delete($this->keyToId($key));
+
+        $result = $this->server->getResultCode();
+
+        return $result === MemcachedServer::RES_SUCCESS || $result === MemcachedServer::RES_NOTFOUND;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        $this->assertIterable($keys, 'keys not iterable');
+        $keysArr = is_array($keys) ? $keys : iterator_to_array($keys, false);
+        array_walk($keysArr, $this, 'assertKey');
+
+        $result = $this->server->getMulti($keysArr);
+
+        if ($result === false) {
+            return false;
+        }
+
+        $items = array_fill_keys($keysArr, $default);
+
+        foreach ($result as $key => $value) {
+            $items$key = $this->unpack($value);
+        }
+
+        return $items;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setMultiple($values, $ttl = null)
+    {
+        $this->assertIterable($values, 'values not iterable');
+
+        $packed = $this->packValues($values);
+        $ttlTime = $this->ttlToMemcachedTime($ttl);
+
+        if ($ttlTime === false) {
+            return $this->server->deleteMulti(array_keys($packed));
+        }
+
+        return $this->server->setMulti($packed, $ttlTime);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function clear()
+    {
+       return $this->server->flush();
+    }
+
+
+    /**
+     * Convert ttl to timestamp or seconds.

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Memory.php Added

@@ -0,0 +1,165 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\SerializePacker;
+
+/**
+ * Memory
+ */
+class Memory extends AbstractCache
+{
+    /**
+     * Limit the amount of entries
+     * @var int
+     */
+    protected $limit = PHP_INT_MAX;
+
+
+    /**
+     * @var array
+     */
+    protected $cache = ;
+
+    /**
+     * @var array
+     */
+    protected $cacheTtl = ;
+
+
+    /**
+     * Create the default packer for this cache implementation.
+     * {@internal NopPacker might fail PSR-16, as cached objects would change}
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new SerializePacker();
+    }
+
+    /**
+     * Make a clone of this object.
+     * Set by cache reference, thus using the same pool.
+     *
+     * @return static
+     */
+    protected function cloneSelf(): AbstractCache
+    {
+        $clone = clone $this;
+
+        $clone->cache =& $this->cache;
+        $clone->cacheTtl =& $this->cacheTtl;
+
+        return $clone;
+    }
+
+    /**
+     * Set the max number of items
+     *
+     * @param int $limit
+     */
+    protected function setLimitOption($limit)
+    {
+        $this->limit = (int)$limit ?: PHP_INT_MAX;
+    }
+
+    /**
+     * Get the max number of items
+     *
+     * @return int
+     */
+    protected function getLimitOption()
+    {
+        return $this->limit;
+    }
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        if (!$this->has($key)) {
+            return $default;
+        }
+
+        $id = $this->keyToId($key);
+
+        return $this->unpack($this->cache$id);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        $id = $this->keyToId($key);
+
+        if (!isset($this->cacheTtl$id)) {
+            return false;
+        }
+
+        if ($this->cacheTtl$id <= time()) {
+            unset($this->cache$id, $this->cacheTtl$id);
+            return false;
+        }
+
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        if (count($this->cache) >= $this->limit) {
+            $deleteKey = key($this->cache);
+            unset($this->cache$deleteKey, $this->cacheTtl$deleteKey);
+        }
+
+        $id = $this->keyToId($key);
+
+        $this->cache$id = $this->pack($value);
+        $this->cacheTtl$id = $this->ttlToTimestamp($ttl) ?? PHP_INT_MAX;
+
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function delete($key)
+    {
+        $id = $this->keyToId($key);
+        unset($this->cache$id, $this->cacheTtl$id);
+
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function clear()
+    {
+        $this->cache = ;
+        $this->cacheTtl = ;
+
+        return true;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/MongoDB.php Added

@@ -0,0 +1,273 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\MongoDBBinaryPacker;
+use Desarrolla2\Cache\Option\InitializeTrait as InitializeOption;
+use MongoDB\Collection;
+use MongoDB\BSON\UTCDatetime as BSONUTCDateTime;
+use MongoDB\Driver\Exception\RuntimeException as MongoDBRuntimeException;
+
+/**
+ * MongoDB cache implementation
+ */
+class MongoDB extends AbstractCache
+{
+    use InitializeOption;
+
+    /**
+     * @var Collection
+     */
+    protected $collection;
+
+    /**
+     * Class constructor
+     *
+     * @param Collection $collection
+     */
+    public function __construct(Collection $collection)
+    {
+        $this->collection = $collection;
+    }
+
+    /**
+     * Initialize the DB collection.
+     * Set TTL index.
+     */
+    protected function initialize(): void
+    {
+        $this->collection->createIndex('ttl' => 1, 'expireAfterSeconds' => 0);
+    }
+
+
+    /**
+     * Create the default packer for this cache implementation.
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new MongoDBBinaryPacker();
+    }
+
+    /**
+     * Get filter for key and ttl.
+     *
+     * @param string|iterable $key
+     * @return array
+     */
+    protected function filter($key)
+    {
+        if (is_array($key)) {
+            $key = '$in' => $key;
+        }
+
+        return 
+            '_id' => $key,
+            '$or' => 
+                'ttl' => '$gt' => new BSONUTCDateTime($this->currentTimestamp() * 1000),
+                'ttl' => null
+            
+        ;
+    }
+
+    /**
+     * {@inheritdoc }
+     */
+    public function get($key, $default = null)
+    {
+        $filter = $this->filter($this->keyToId($key));
+
+        try {
+            $data = $this->collection->findOne($filter);
+        } catch (MongoDBRuntimeException $e) {
+            return $default;
+        }
+
+        return isset($data) ? $this->unpack($data'value') : $default;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        $idKeyPairs = $this->mapKeysToIds($keys);
+
+        if (empty($idKeyPairs)) {
+            return ;
+        }
+
+        $filter = $this->filter(array_keys($idKeyPairs));
+        $items = array_fill_keys(array_values($idKeyPairs), $default);
+
+        try {
+            $rows = $this->collection->find($filter);
+        } catch (MongoDBRuntimeException $e) {
+            return $items;
+        }
+
+        foreach ($rows as $row) {
+            $id = $row'_id';
+            $key = $idKeyPairs$id;
+
+            $items$key = $this->unpack($row'value');
+        }
+
+        return $items;
+    }
+
+    /**
+     * {@inheritdoc }
+     */
+    public function has($key)
+    {
+        $filter = $this->filter($this->keyToId($key));
+
+        try {
+            $count = $this->collection->count($filter);
+        } catch (MongoDBRuntimeException $e) {
+            return false;
+        }
+
+        return $count  > 0;
+    }
+
+    /**
+     * {@inheritdoc }
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $id = $this->keyToId($key);
+
+        $item = 
+            '_id' => $id,
+            'ttl' => $this->getTtlBSON($ttl),
+            'value' => $this->pack($value)
+        ;
+
+        try {
+            $this->collection->replaceOne('_id' => $id, $item, 'upsert' => true);
+        } catch (MongoDBRuntimeException $e) {
+            return false;
+        }
+
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setMultiple($values, $ttl = null)
+    {
+        $this->assertIterable($values, 'values not iterable');
+
+        if (empty($values)) {
+            return true;
+        }
+
+        $bsonTtl = $this->getTtlBSON($ttl);
+        $items = ;
+
+        foreach ($values as $key => $value) {
+            $id = $this->keyToId(is_int($key) ? (string)$key : $key);
+
+            $items = 
+                'replaceOne' => 
+                    '_id' => $id,
+                    
+                        '_id' => $id,
+                        'ttl' => $bsonTtl,
+                        'value' => $this->pack($value)
+                    ,
+                     'upsert' => true 
+

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Mysqli.php Added

@@ -0,0 +1,312 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Option\InitializeTrait;
+use mysqli as Server;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\SerializePacker;
+
+/**
+ * Mysqli cache adapter.
+ *
+ * Errors are silently ignored but exceptions are **not** caught. Beware when using `mysqli_report()` to throw a
+ * `mysqli_sql_exception` on error.
+ */
+class Mysqli extends AbstractCache
+{
+    use InitializeTrait;
+
+    /**
+     * @var Server
+     */
+    protected $server;
+
+    /**
+     * @var string
+     */
+    protected $table  = 'cache';
+
+
+    /**
+     * Class constructor
+     *
+     * @param Server $server
+     */
+    public function __construct(Server $server)
+    {
+        $this->server = $server;
+    }
+
+
+    /**
+     * Initialize table.
+     * Automatically delete old cache.
+     */
+    protected function initialize(): void
+    {
+        if ($this->initialized !== false) {
+            return;
+        }
+
+        $this->query(
+            "CREATE TABLE IF NOT EXISTS `{table}` "
+            . "( `key` VARCHAR(255), `value` BLOB, `ttl` BIGINT UNSIGNED, PRIMARY KEY (`key`) )"
+        );
+
+        $this->query(
+            "CREATE EVENT IF NOT EXISTS `apply_ttl_{$this->table}` ON SCHEDULE EVERY 1 HOUR DO BEGIN"
+            . " DELETE FROM {table} WHERE `ttl` < UNIX_TIMESTAMP();"
+            . " END"
+        );
+
+        $this->initialized = true;
+    }
+
+    /**
+     * Create the default packer for this cache implementation.
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new SerializePacker();
+    }
+
+
+    /**
+     * Set the table name
+     *
+     * @param string $table
+     */
+    public function setTableOption(string $table)
+    {
+        $this->table = $table;
+        $this->requireInitialization();
+    }
+
+    /**
+     * Get the table name
+     *
+     * @return string
+     */
+    public function getTableOption(): string
+    {
+        return $this->table;
+    }
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        $this->initialize();
+
+        $result = $this->query(
+            'SELECT `value` FROM {table} WHERE `key` = ? AND (`ttl` > ? OR `ttl` IS NULL) LIMIT 1',
+            'si',
+            $this->keyToId($key),
+            $this->currentTimestamp()
+        );
+
+        $row = $result !== false ? $result->fetch_row() : null;
+
+        return $row ? $this->unpack($row0) : $default;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        $idKeyPairs = $this->mapKeysToIds($keys);
+
+        if (empty($idKeyPairs)) {
+            return ;
+        }
+
+        $this->initialize();
+
+        $values = array_fill_keys(array_values($idKeyPairs), $default);
+
+        $placeholders = rtrim(str_repeat('?, ', count($idKeyPairs)), ', ');
+        $paramTypes = str_repeat('s', count($idKeyPairs)) . 'i';
+        $params = array_keys($idKeyPairs);
+        $params = $this->currentTimestamp();
+
+        $result = $this->query(
+            "SELECT `key`, `value` FROM {table} WHERE `key` IN ($placeholders) AND (`ttl` > ? OR `ttl` IS NULL)",
+            $paramTypes,
+            ...$params
+        );
+
+        while (($id, $value = $result->fetch_row())) {
+            $key = $idKeyPairs$id;
+            $values$key = $this->unpack($value);
+        }
+
+        return $values;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        $this->initialize();
+
+        $result = $this->query(
+            'SELECT COUNT(`key`) FROM {table} WHERE `key` = ? AND (`ttl` > ? OR `ttl` IS NULL) LIMIT 1',
+            'si',
+            $this->keyToId($key),
+            $this->currentTimestamp()
+        );
+
+        $count = $result ? $result->fetch_row() : null;
+
+        return isset($count) && $count > 0;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $this->initialize();
+
+        $result = $this->query(
+            'REPLACE INTO {table} (`key`, `value`, `ttl`) VALUES (?, ?, ?)',
+            'ssi',
+            $this->keyToId($key),
+            $this->pack($value),
+            $this->ttlToTimestamp($ttl)
+        );
+
+        return $result !== false;

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/NotCache.php Added

@@ -0,0 +1,93 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\AbstractCache;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\NopPacker;
+
+/**
+ * Dummy cache handler
+ */
+class NotCache extends AbstractCache
+{
+    /**
+     * Create the default packer for this cache implementation.
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new NopPacker();
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function delete($key)
+    {
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setMultiple($values, $ttl = null)
+    {
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function clear()
+    {
+        return true;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Option Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Option/FilenameTrait.php Added

@@ -0,0 +1,91 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Option;
+
+use TypeError;
+use Desarrolla2\Cache\File\BasicFilename;
+
+/**
+ * Use filename generator
+ */
+trait FilenameTrait
+{
+    /**
+     * @var callable
+     */
+    protected $filename;
+
+
+    /**
+     * Filename format or callable.
+     * The filename format will be applied using sprintf, replacing `%s` with the key.
+     *
+     * @param string|callable $filename
+     * @return void
+     */
+    protected function setFilenameOption($filename): void
+    {
+        if (is_string($filename)) {
+            $filename = new BasicFilename($filename);
+        }
+
+        if (!is_callable($filename)) {
+            throw new TypeError("Filename should be a string or callable");
+        }
+
+        $this->filename = $filename;
+    }
+
+    /**
+     * Get the filename callable
+     *
+     * @return callable
+     */
+    protected function getFilenameOption(): callable
+    {
+        if (!isset($this->filename)) {
+            $this->filename = new BasicFilename('%s.' . $this->getPacker()->getType());
+        }
+
+        return $this->filename;
+    }
+
+    /**
+     * Create a filename based on the key
+     *
+     * @param string|mixed $key
+     * @return string
+     */
+    protected function getFilename($key): string
+    {
+        $id = $this->keyToId($key);
+        $generator = $this->getFilenameOption();
+
+        return $this->cacheDir . DIRECTORY_SEPARATOR . $generator($id);
+    }
+
+    /**
+     * Get a wildcard for all files
+     *
+     * @return string
+     */
+    protected function getWildcard(): string
+    {
+        $generator = $this->getFilenameOption();
+
+        return $this->cacheDir . DIRECTORY_SEPARATOR . $generator('');
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Option/InitializeTrait.php Added

@@ -0,0 +1,65 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Option;
+
+/**
+ * Auto initialize the cache
+ */
+trait InitializeTrait
+{
+    /**
+     * Is cache initialized
+     * @var bool|null
+     */
+    protected $initialized = false;
+
+
+    /**
+     * Enable/disable initialization
+     *
+     * @param bool $enabled
+     */
+    public function setInitializeOption(bool $enabled)
+    {
+        $this->initialized = $enabled ? (bool)$this->initialized : null;
+    }
+
+    /**
+     * Should initialize
+     *
+     * @return bool
+     */
+    protected function getInitializeOption(): bool
+    {
+        return $this->initialized !== null;
+    }
+
+    /**
+     * Mark as initialization required (if enabled)
+     */
+    protected function requireInitialization()
+    {
+        $this->initialized = isset($this->initialized) ? false : null;
+    }
+
+
+    /**
+     * Initialize
+     *
+     * @return void
+     */
+    abstract protected function initialize(): void;
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Option/PrefixTrait.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Option/TtlTrait.php Added

@@ -0,0 +1,54 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Option;
+
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+
+/**
+ * TTL option
+ */
+trait TtlTrait
+{
+    /**
+     * @var int|null
+     */
+    protected $ttl = null;
+
+    /**
+     * Set the maximum time to live (ttl)
+     *
+     * @param int|null $value  Seconds or null to live forever
+     * @throws InvalidArgumentException
+     */
+    protected function setTtlOption(?int $value): void
+    {
+        if (isset($value) && $value < 1) {
+            throw new InvalidArgumentException('ttl cant be lower than 1');
+        }
+
+        $this->ttl = $value;
+    }
+
+    /**
+     * Get the maximum time to live (ttl)
+     *
+     * @return int|null
+     */
+    protected function getTtlOption(): ?int
+    {
+        return $this->ttl;
+    }
+}
\ No newline at end of file

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Packer Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Packer/JsonPacker.php Added

@@ -0,0 +1,69 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Packer;
+
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+
+/**
+ * Pack value through serialization
+ */
+class JsonPacker implements PackerInterface
+{
+    /**
+     * Get cache type (might be used as file extension)
+     *
+     * @return string
+     */
+    public function getType()
+    {
+        return 'json';
+    }
+
+    /**
+     * Pack the value
+     * 
+     * @param mixed $value
+     * @return string
+     */
+    public function pack($value)
+    {
+        return json_encode($value);
+    }
+    
+    /**
+     * Unpack the value
+     * 
+     * @param string $packed
+     * @return mixed
+     * @throws InvalidArgumentException
+     */
+    public function unpack($packed)
+    {
+        if (!is_string($packed)) {
+            throw new InvalidArgumentException("packed value should be a string");
+        }
+
+        $ret = json_decode($packed);
+
+        if (!isset($ret) && json_last_error()) {
+            throw new \UnexpectedValueException("packed value is not a valid JSON string");
+        }
+
+        return $ret;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Packer/MongoDBBinaryPacker.php Added

@@ -0,0 +1,77 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+namespace Desarrolla2\Cache\Packer;
+
+use Desarrolla2\Cache\Packer\PackerInterface;
+use MongoDB\BSON\Binary;
+
+/**
+ * Pack as BSON binary
+ *
+ * @todo Don't use serialize when packer chain is here.
+ */
+class MongoDBBinaryPacker implements PackerInterface
+{
+    /**
+     * @var array
+     */
+    protected $options;
+
+    /**
+     * SerializePacker constructor
+     *
+     * @param array $options  Any options to be provided to unserialize()
+     */
+    public function __construct(array $options = 'allowed_classes' => true)
+    {
+        $this->options = $options;
+    }
+
+    /**
+     * Get cache type (might be used as file extension)
+     *
+     * @return string
+     */
+    public function getType()
+    {
+        return 'bson';
+    }
+
+    /**
+     * Pack the value
+     *
+     * @param mixed $value
+     * @return string
+     */
+    public function pack($value)
+    {
+        return new Binary(serialize($value), Binary::TYPE_GENERIC);
+    }
+
+    /**
+     * Unpack the value
+     *
+     * @param string $packed
+     * @return string
+     * @throws \UnexpectedValueException if he value can't be unpacked
+     */
+    public function unpack($packed)
+    {
+        if (!$packed instanceof Binary) {
+            throw new \InvalidArgumentException("packed value should be BSON binary");
+        }
+
+        return unserialize((string)$packed, $this->options);
+    }
+}
\ No newline at end of file

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Packer/NopPacker.php Added

@@ -0,0 +1,57 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Packer;
+
+use Desarrolla2\Cache\Packer\PackerInterface;
+
+/**
+ * Don't pack, just straight passthrough
+ */
+class NopPacker implements PackerInterface
+{
+    /**
+     * Get cache type (might be used as file extension)
+     *
+     * @return string
+     */
+    public function getType()
+    {
+        return 'data';
+    }
+
+    /**
+     * Pack the value
+     * 
+     * @param mixed $value
+     * @return mixed
+     */
+    public function pack($value)
+    {
+        return $value;
+    }
+    
+    /**
+     * Unpack the value
+     * 
+     * @param mixed $packed
+     * @return mixed
+     */
+    public function unpack($packed)
+    {
+        return $packed;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Packer/PackerInterface.php Added

@@ -0,0 +1,47 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Packer;
+
+/**
+ * Interface for packer / unpacker
+ */
+interface PackerInterface
+{
+    /**
+     * Get cache type (might be used as file extension)
+     *
+     * @return string
+     */
+    public function getType();
+
+    /**
+     * Pack the value
+     * 
+     * @param mixed $value
+     * @return string|mixed
+     */
+    public function pack($value);
+    
+    /**
+     * Unpack the value
+     * 
+     * @param string|mixed $packed
+     * @return string
+     * @throws \UnexpectedValueException if the value can't be unpacked
+     */
+    public function unpack($packed);
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Packer/PackingTrait.php Added

@@ -0,0 +1,86 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Packer;
+
+/**
+ * Support packing for Caching adapter
+ */
+trait PackingTrait
+{
+    /**
+     * @var PackerInterface
+     */
+    protected $packer;
+
+
+    /**
+     * Create the default packer for this cache implementation
+     *
+     * @return PackerInterface
+     */
+    abstract protected static function createDefaultPacker(): PackerInterface;
+
+    /**
+     * Set a packer to pack (serialialize) and unpack (unserialize) the data.
+     *
+     * @param PackerInterface $packer
+     * @return static
+     */
+    public function withPacker(PackerInterface $packer)
+    {
+        $cache = $this->cloneSelf();
+        $cache->packer = $packer;
+
+        return $cache;
+    }
+
+    /**
+     * Get the packer
+     *
+     * @return PackerInterface
+     */
+    protected function getPacker(): PackerInterface
+    {
+        if (!isset($this->packer)) {
+            $this->packer = static::createDefaultPacker();
+        }
+
+        return $this->packer;
+    }
+
+    /**
+     * Pack the value
+     *
+     * @param mixed $value
+     * @return string|mixed
+     */
+    protected function pack($value)
+    {
+        return $this->getPacker()->pack($value);
+    }
+
+    /**
+     * Unpack the data to retrieve the value
+     *
+     * @param string|mixed $packed
+     * @return mixed
+     * @throws \UnexpectedValueException
+     */
+    protected function unpack($packed)
+    {
+        return $this->getPacker()->unpack($packed);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Packer/SerializePacker.php Added

@@ -0,0 +1,78 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache\Packer;
+
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+
+/**
+ * Pack value through serialization
+ */
+class SerializePacker implements PackerInterface
+{
+    /**
+     * @var array
+     */
+    protected $options;
+
+    /**
+     * SerializePacker constructor
+     *
+     * @param array $options  Any options to be provided to unserialize()
+     */
+    public function __construct(array $options = 'allowed_classes' => true)
+    {
+        $this->options = $options;
+    }
+
+    /**
+     * Get cache type (might be used as file extension)
+     *
+     * @return string
+     */
+    public function getType()
+    {
+        return 'php.cache';
+    }
+
+    /**
+     * Pack the value
+     * 
+     * @param mixed $value
+     * @return string
+     */
+    public function pack($value)
+    {
+        return serialize($value);
+    }
+    
+    /**
+     * Unpack the value
+     * 
+     * @param string $packed
+     * @return string
+     * @throws \UnexpectedValueException if he value can't be unpacked
+     */
+    public function unpack($packed)
+    {
+        if (!is_string($packed)) {
+            throw new InvalidArgumentException("packed value should be a string");
+        }
+
+        return unserialize($packed, $this->options);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/PhpFile.php Added

@@ -0,0 +1,111 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\AbstractFile;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\SerializePacker;
+use Desarrolla2\Cache\File\BasicFilename;
+
+/**
+ * Cache file as PHP script.
+ */
+class PhpFile extends AbstractFile
+{
+    /**
+     * Create the default packer for this cache implementation.
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new SerializePacker();
+    }
+
+    /**
+     * Get the filename callable
+     *
+     * @return callable
+     */
+    protected function getFilenameOption(): callable
+    {
+        if (!isset($this->filename)) {
+            $this->filename = new BasicFilename('%s.php');
+        }
+
+        return $this->filename;
+    }
+
+    /**
+     * Create a PHP script returning the cached value
+     *
+     * @param mixed    $value
+     * @param int|null $ttl
+     * @return string
+     */
+    public function createScript($value, ?int $ttl): string
+    {
+        $macro = var_export($value, true);
+
+        if (strpos($macro, 'stdClass::__set_state') !== false) {
+            $macro = preg_replace_callback("/('(^'\\\\++|''\\.)')|stdClass::__set_state/", $macro, function($match) {
+                return empty($match1) ? '(object)' : $match1;
+            });
+        }
+
+        return $ttl !== null
+            ? "<?php return time() < {$ttl} ? {$macro} : false;"
+            : "<?php return {$macro};";
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        $cacheFile = $this->getFilename($key);
+
+        if (!file_exists($cacheFile)) {
+            return $default;
+        }
+
+        $packed = include $cacheFile;
+
+        return $packed === false ? $default : $this->unpack($packed);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        return $this->get($key) !== null;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $cacheFile = $this->getFilename($key);
+
+        $packed = $this->pack($value);
+        $script = $this->createScript($packed, $this->ttlToTimestamp($ttl));
+
+        return $this->writeFile($cacheFile, $script);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Predis.php Added

@@ -0,0 +1,245 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\AbstractCache;
+use Desarrolla2\Cache\Exception\UnexpectedValueException;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\SerializePacker;
+use Predis\Client;
+use Predis\Response\ServerException;
+use Predis\Response\Status;
+use Predis\Response\ErrorInterface;
+
+/**
+ * Predis cache adapter.
+ *
+ * Errors are silently ignored but ServerExceptions are **not** caught. To PSR-16 compliant disable the `exception`
+ * option.
+ */
+class Predis extends AbstractCache
+{
+    /**
+     * @var Client
+     */
+    protected $predis;
+
+    /**
+     * Class constructor
+     * @see predis documentation about how know your configuration https://github.com/nrk/predis
+     *
+     * @param Client $client
+     */
+    public function __construct(Client $client)
+    {
+        $this->predis = $client;
+    }
+
+    /**
+     * Create the default packer for this cache implementation.
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new SerializePacker();
+    }
+
+
+    /**
+     * Run a predis command.
+     *
+     * @param string $cmd
+     * @param mixed ...$args
+     * @return mixed|bool
+     */
+    protected function execCommand(string $cmd, ...$args)
+    {
+        $command = $this->predis->createCommand($cmd, $args);
+        $response = $this->predis->executeCommand($command);
+
+        if ($response instanceof ErrorInterface) {
+            return false;
+        }
+
+        if ($response instanceof Status) {
+            return $response->getPayload() === 'OK';
+        }
+
+        return $response;
+    }
+
+    /**
+     * Set multiple (mset) with expire
+     *
+     * @param array    $dictionary
+     * @param int|null $ttlSeconds
+     * @return bool
+     */
+    protected function msetExpire(array $dictionary, ?int $ttlSeconds): bool
+    {
+        if (empty($dictionary)) {
+            return true;
+        }
+
+        if (!isset($ttlSeconds)) {
+            return $this->execCommand('MSET', $dictionary);
+        }
+
+        $transaction = $this->predis->transaction();
+
+        foreach ($dictionary as $key => $value) {
+            $transaction->set($key, $value, 'EX', $ttlSeconds);
+        }
+
+        try {
+            $responses = $transaction->execute();
+        } catch (ServerException $e) {
+            return false;
+        }
+
+        $ok = array_reduce($responses, function($ok, $response) {
+            return $ok && $response instanceof Status && $response->getPayload() === 'OK';
+        }, true);
+
+        return $ok;
+    }
+
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        $id = $this->keyToId($key);
+        $response = $this->execCommand('GET', $id);
+
+        return !empty($response) ? $this->unpack($response) : $default;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        $idKeyPairs = $this->mapKeysToIds($keys);
+        $ids = array_keys($idKeyPairs);
+
+        $response = $this->execCommand('MGET', $ids);
+
+        if ($response === false) {
+            return false;
+        }
+
+        $items = ;
+        $packedItems = array_combine(array_values($idKeyPairs), $response);
+
+        foreach ($packedItems as $key => $packed) {
+            $items$key = isset($packed) ? $this->unpack($packed) : $default;
+        }
+
+        return $items;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        return $this->execCommand('EXISTS', $this->keyToId($key));
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $id = $this->keyToId($key);
+        $packed = $this->pack($value);
+
+        if (!is_string($packed)) {
+            throw new UnexpectedValueException("Packer must create a string for the data");
+        }
+
+        $ttlSeconds = $this->ttlToSeconds($ttl);
+
+        if (isset($ttlSeconds) && $ttlSeconds <= 0) {
+            return $this->execCommand('DEL', $id);
+        }
+
+        return !isset($ttlSeconds)
+            ? $this->execCommand('SET', $id, $packed)
+            : $this->execCommand('SETEX', $id, $ttlSeconds, $packed);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setMultiple($values, $ttl = null)
+    {
+        $this->assertIterable($values, 'values not iterable');
+
+        $dictionary = ;
+
+        foreach ($values as $key => $value) {
+            $id = $this->keyToId(is_int($key) ? (string)$key : $key);

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/src/Redis.php Added

@@ -0,0 +1,205 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Julián Gutiérrez <juliangut@gmail.com>
+ */
+
+declare(strict_types=1);
+
+namespace Desarrolla2\Cache;
+
+use Desarrolla2\Cache\Exception\UnexpectedValueException;
+use Desarrolla2\Cache\Packer\PackerInterface;
+use Desarrolla2\Cache\Packer\SerializePacker;
+use Redis as PhpRedis;
+
+/**
+ * PHP Redis cache adapter.
+ *
+ * Errors are silently ignored but ServerExceptions are **not** caught. To PSR-16 compliant disable the `exception`
+ * option.
+ */
+class Redis extends AbstractCache
+{
+    /**
+     * @var PhpRedis
+     */
+    protected $client;
+
+    /**
+     * Redis constructor.
+     *
+     * @param PhpRedis $client
+     */
+    public function __construct(PhpRedis $client)
+    {
+        $this->client = $client;
+    }
+
+    /**
+     * Create the default packer for this cache implementation.
+     *
+     * @return PackerInterface
+     */
+    protected static function createDefaultPacker(): PackerInterface
+    {
+        return new SerializePacker();
+    }
+
+    /**
+     * Set multiple (mset) with expire
+     *
+     * @param array    $dictionary
+     * @param int|null $ttlSeconds
+     * @return bool
+     */
+    protected function msetExpire(array $dictionary, ?int $ttlSeconds): bool
+    {
+        if (empty($dictionary)) {
+            return true;
+        }
+
+        if (!isset($ttlSeconds)) {
+            return $this->client->mset($dictionary);
+        }
+
+        $transaction = $this->client->multi();
+
+        foreach ($dictionary as $key => $value) {
+            $transaction->set($key, $value, $ttlSeconds);
+        }
+
+        $responses = $transaction->exec();
+
+        return array_reduce(
+            $responses,
+            function ($ok, $response) {
+                return $ok && $response;
+            },
+            true
+        );
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function get($key, $default = null)
+    {
+        $response = $this->client->get($this->keyToId($key));
+        
+        return !empty($response) ? $this->unpack($response) : $default;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getMultiple($keys, $default = null)
+    {
+        $idKeyPairs = $this->mapKeysToIds($keys);
+
+        $response = $this->client->mget(array_keys($idKeyPairs));
+
+        return array_map(
+            function ($packed) use ($default) {
+                return !empty($packed) ? $this->unpack($packed) : $default;
+            },
+            array_combine(array_values($idKeyPairs), $response)
+        );
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function has($key)
+    {
+        return $this->client->exists($this->keyToId($key)) !== 0;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function set($key, $value, $ttl = null)
+    {
+        $id = $this->keyToId($key);
+        $packed = $this->pack($value);
+
+        if (!is_string($packed)) {
+            throw new UnexpectedValueException("Packer must create a string for the data");
+        }
+
+        $ttlSeconds = $this->ttlToSeconds($ttl);
+
+        if (isset($ttlSeconds) && $ttlSeconds <= 0) {
+            return $this->client->del($id);
+        }
+        
+        return !isset($ttlSeconds)
+            ? $this->client->set($id, $packed)
+            : $this->client->setex($id, $ttlSeconds, $packed);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setMultiple($values, $ttl = null)
+    {
+        $this->assertIterable($values, 'values not iterable');
+
+        $dictionary = ;
+
+        foreach ($values as $key => $value) {
+            $id = $this->keyToId(is_int($key) ? (string)$key : $key);
+            $packed = $this->pack($value);
+
+            if (!is_string($packed)) {
+                throw new UnexpectedValueException("Packer must create a string for the data");
+            }
+
+            $dictionary$id = $packed;
+        }
+
+        $ttlSeconds = $this->ttlToSeconds($ttl);
+
+        if (isset($ttlSeconds) && $ttlSeconds <= 0) {
+            return $this->client->del(array_keys($dictionary));
+        }
+
+        return $this->msetExpire($dictionary, $ttlSeconds);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function delete($key)
+    {
+        $id = $this->keyToId($key);
+
+        return $this->client->del($id) !== false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function deleteMultiple($keys)
+    {
+        $ids = array_keys($this->mapKeysToIds($keys));
+
+        return empty($ids) || $this->client->del($ids) !== false;
+    }
+
+    /**
+     * {@inheritdoc}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/AbstractCacheTest.php Added

@@ -0,0 +1,93 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Cache\IntegrationTests\SimpleCacheTest;
+use Desarrolla2\Cache\Exception\InvalidArgumentException;
+
+/**
+ * AbstractCacheTest
+ */
+abstract class AbstractCacheTest extends SimpleCacheTest
+{
+    /**
+     * @return array
+     */
+    public function dataProviderForOptions()
+    {
+        return 
+            'ttl', 100,
+            'prefix', 'test'
+        ;
+    }
+
+    /**
+     * @dataProvider dataProviderForOptions
+     *
+     * @param string $key
+     * @param mixed  $value
+     */
+    public function testWithOption($key, $value)
+    {
+        $cache = $this->cache->withOption($key, $value);
+        $this->assertEquals($value, $cache->getOption($key));
+
+        // Check immutability
+        $this->assertNotSame($this->cache, $cache);
+        $this->assertNotEquals($value, $this->cache->getOption($key));
+    }
+
+    public function testWithOptions()
+    {
+        $data = $this->dataProviderForOptions();
+        $options = array_combine(array_column($data, 0), array_column($data, 1));
+
+        $cache = $this->cache->withOptions($options);
+
+        foreach ($options as $key => $value) {
+            $this->assertEquals($value, $cache->getOption($key));
+        }
+
+        // Check immutability
+        $this->assertNotSame($this->cache, $cache);
+
+        foreach ($options as $key => $value) {
+            $this->assertNotEquals($value, $this->cache->getOption($key));
+        }
+    }
+
+
+    /**
+     * @return array
+     */
+    public function dataProviderForOptionsException()
+    {
+        return 
+            'ttl', 0, InvalidArgumentException::class,
+            'foo', 'bar', InvalidArgumentException::class
+        ;
+    }
+
+    /**
+     * @dataProvider dataProviderForOptionsException
+     *
+     * @param string   $key
+     * @param mixed    $value
+     * @param string   $expectedException
+     */
+    public function testWithOptionException($key, $value, $expectedException)
+    {
+        $this->expectException($expectedException);
+        $this->createSimpleCache()->withOption($key, $value);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/ApcuCacheTest.php Added

@@ -0,0 +1,44 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\Apcu as ApcuCache;
+
+/**
+ * ApcuCacheTest
+ */
+class ApcuCacheTest extends AbstractCacheTest
+{
+    public static function setUpBeforeClass(): void
+    {
+        // Required to check the TTL for new entries
+        ini_set('apc.use_request_time', false);
+    }
+
+    public function createSimpleCache()
+    {
+        if (!extension_loaded('apcu')) {
+            $this->markTestSkipped(
+                'The APCu extension is not available.'
+            );
+        }
+        if (!ini_get('apc.enable_cli')) {
+            $this->markTestSkipped(
+                'You need to enable apc.enable_cli'
+            );
+        }
+        
+        return new ApcuCache();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/ChainTest.php Added

@@ -0,0 +1,216 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\Chain as CacheChain;
+use Desarrolla2\Cache\Memory as MemoryCache;
+
+/**
+ * ChainTest
+ */
+class ChainTest extends AbstractCacheTest
+{
+    public function createSimpleCache()
+    {
+        $adapters = new MemoryCache(); // For the general PSR-16 tests, we don't need more than 1 adapter
+
+        return new CacheChain($adapters);
+    }
+
+
+    public function tearDown(): void
+    {
+        // No need to clear cache, as the adapters don't persist between tests.
+    }
+
+
+    public function testChainSet()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('set')->with("foo", "bar", 300);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('set')->with("foo", "bar", 300);
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $cache->set("foo", "bar", 300);
+    }
+
+    public function testChainSetMultiple()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('setMultiple')->with("foo" => 1, "bar" => 2, 300);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('setMultiple')->with("foo" => 1, "bar" => 2, 300);
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $cache->setMultiple("foo" => 1, "bar" => 2, 300);
+    }
+
+
+    public function testChainGetFirst()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('get')->with("foo")->willReturn("bar");
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->never())->method('get');
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $this->assertEquals("bar", $cache->get("foo", 42));
+    }
+
+    public function testChainGetSecond()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('get')->with("foo")->willReturn(null);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('get')->with("foo")->willReturn("car");
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $this->assertEquals("car", $cache->get("foo", 42));
+    }
+
+    public function testChainGetNone()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('get')->with("foo")->willReturn(null);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('get')->with("foo")->willReturn(null);
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $this->assertEquals(42, $cache->get("foo", 42));
+    }
+
+
+    public function testChainGetMultipleFirst()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('getMultiple')->with("foo", "bar")
+            ->willReturn("foo" => 1, "bar" => 2);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->never())->method('getMultiple');
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $this->assertEquals("foo" => 1, "bar" => 2, $cache->getMultiple("foo", "bar"));
+    }
+
+    public function testChainGetMultipleMixed()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('getMultiple')
+            ->with($this->equalTo("foo", "bar", "wux", "lot"))
+            ->willReturn("foo" => null, "bar" => 2, "wux" => null, "lot" => null);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('getMultiple')
+            ->with($this->equalTo("foo", "wux", "lot"))
+            ->willReturn("foo" => 11, "wux" => 15, "lot" => null);
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $expected = "foo" => 11, "bar" => 2, "wux" => 15, "lot" => 42;
+        $this->assertEquals($expected, $cache->getMultiple("foo", "bar", "wux", "lot", 42));
+    }
+    
+
+    public function testChainHasFirst()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('has')->with("foo")->willReturn(true);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->never())->method('has');
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $this->assertTrue($cache->has("foo"));
+    }
+
+    public function testChainHasSecond()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('has')->with("foo")->willReturn(false);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('has')->with("foo")->willReturn(true);
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $this->assertTrue($cache->has("foo"));
+    }
+
+    public function testChainHasNone()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('has')->with("foo")->willReturn(false);
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('has')->with("foo")->willReturn(false);
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $this->assertFalse($cache->has("foo"));
+    }
+
+
+    public function testChainDelete()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('delete')->with("foo");
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('delete')->with("foo");
+
+        $cache = new CacheChain($adapter1, $adapter2);
+
+        $cache->delete("foo");
+    }
+
+    public function testChainDeleteMultiple()
+    {
+        $adapter1 = $this->createMock(MemoryCache::class);
+        $adapter1->expects($this->once())->method('deleteMultiple')->with("foo", "bar");
+
+        $adapter2 = $this->createMock(MemoryCache::class);
+        $adapter2->expects($this->once())->method('deleteMultiple')->with("foo", "bar");
+
+        $cache = new CacheChain($adapter1, $adapter2);

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/FileTest.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/FileTrieTest.php Added

@@ -0,0 +1,43 @@
+<?php
+
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ * @author Arnold Daniels <arnold@jasny.net>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\File as FileCache;
+use Desarrolla2\Cache\File\TrieFilename;
+use org\bovigo\vfs\vfsStream;
+use org\bovigo\vfs\vfsStreamDirectory;
+
+/**
+ * FileTest with Trie structure
+ */
+class FileTrieTest extends AbstractCacheTest
+{
+    /**
+     * @var vfsStreamDirectory
+     */
+    private $root;
+
+    protected $skippedTests = 
+        'testBasicUsageWithLongKey' => 'Only support keys up to 64 bytes'
+    ;
+
+    public function createSimpleCache()
+    {
+        $this->root = vfsStream::setup('cache');
+
+        return (new FileCache(vfsStream::url('cache')))
+            ->withOption('filename', new TrieFilename('%s.php.cache',4));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/FileTtlFileTest.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/MemcachedTest.php Added

@@ -0,0 +1,54 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\Memcached as MemcachedCache;
+use Memcached;
+
+/**
+ * MemcachedTest
+ */
+class MemcachedTest extends AbstractCacheTest
+{
+    protected $skippedTests = 
+        'testBasicUsageWithLongKey' => 'Only support keys up to 250 bytes'
+    ;
+
+    public function createSimpleCache()
+    {
+        if (!extension_loaded('memcached') || !class_exists('\Memcached')) {
+            $this->markTestSkipped(
+                'The Memcached extension is not available.'
+            );
+        }
+
+        // See https://github.com/php-memcached-dev/php-memcached/issues/509
+        if (version_compare(PHP_VERSION, '8.1.0', '>=')) {
+            $this->markTestSkipped(
+                'The Memcached extension is does not work with PHP 8.1 yet.'
+            );
+        }
+
+        list($host, $port) = explode(':', CACHE_TESTS_MEMCACHED_SERVER) + 1 => 11211;
+
+        $adapter = new Memcached();
+        $adapter->addServer($host, (int)$port);
+
+        if (!$adapter->flush()) {
+            $this->markTestSkipped("Unable to flush Memcached; not running?");
+        }
+
+        return new MemcachedCache($adapter);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/MemoryTest.php Added

@@ -0,0 +1,44 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\Memory as MemoryCache;
+
+/**
+ * MemoryTest
+ */
+class MemoryTest extends AbstractCacheTest
+{
+    public function createSimpleCache()
+    {
+        return new MemoryCache();
+    }
+
+    public function tearDown(): void
+    {
+        // No need to clear cache, as the adapters don't persist between tests.
+    }
+
+    public function testExceededLimit()
+    {
+        $cache = $this->createSimpleCache()->withOption('limit', 1);
+
+        $cache->set('foo', 1);
+        $this->assertTrue($cache->has('foo'));
+
+        $cache->set('bar', 1);
+        $this->assertFalse($cache->has('foo'));
+        $this->assertTrue($cache->has('bar'));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/MongoDBTest.php Added

@@ -0,0 +1,53 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\MongoDB as MongoDBCache;
+use MongoDB\Client;
+
+/**
+ * MongoDBTest
+ */
+class MongoDBTest extends AbstractCacheTest
+{
+    /**
+     * @var Client
+     */
+    protected static $client;
+
+    /**
+     * Use one client per test, as the MongoDB extension leaves connections open
+     */
+    public static function setUpBeforeClass(): void
+    {
+        if (!extension_loaded('mongodb')) {
+            return;
+        }
+
+        self::$client = new Client(CACHE_TESTS_MONGO_DSN);
+        self::$client->listDatabases(); // Fail if unable to connect
+    }
+
+    public function createSimpleCache()
+    {
+        if (!isset(self::$client)) {
+            $this->markTestSkipped('The mongodb extension is not available');
+        }
+
+        $collection = self::$client->selectCollection(CACHE_TESTS_MONGO_DATABASE, 'cache');
+
+        return (new MongoDBCache($collection))
+            ->withOption('initialize', false);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/MysqliTest.php Added

@@ -0,0 +1,75 @@
+<?php
+/**
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\Mysqli as MysqliCache;
+
+/**
+ * MysqliTest
+ */
+class MysqliTest extends AbstractCacheTest
+{
+    /**
+     * @var \mysqli
+     */
+    protected static $mysqli;
+
+    protected $skippedTests = 
+        'testBasicUsageWithLongKey' => 'Only support keys up to 255 bytes'
+    ;
+
+    public static function setUpBeforeClass(): void
+    {
+        if (class_exists('mysqli')) {
+            static::$mysqli = new \mysqli(
+                ini_get('mysqli.default_host') ?: 'localhost',
+                ini_get('mysqli.default_user') ?: 'root'
+            );
+        }
+    }
+
+    public function init(): void
+    {
+        if (!class_exists('mysqli')) {
+            $this->markTestSkipped("mysqli extension not loaded");
+        }
+
+        try {
+            static::$mysqli->query('CREATE DATABASE IF NOT EXISTS `' . CACHE_TESTS_MYSQLI_DATABASE . '`');
+            static::$mysqli->select_db(CACHE_TESTS_MYSQLI_DATABASE);
+
+            static::$mysqli->query("CREATE TABLE IF NOT EXISTS `cache` "
+                ."( `key` VARCHAR(255), `value` BLOB, `ttl` INT UNSIGNED, PRIMARY KEY (`key`) )");
+        } catch (\Exception $e) {
+            $this->markTestSkipped("skipping mysqli test; " . $e->getMessage());
+        }
+
+        if (static::$mysqli->error) {
+            $this->markTestSkipped(static::$mysqli->error);
+        }
+    }
+
+    public function createSimpleCache()
+    {
+        $this->init();
+
+        return (new MysqliCache(static::$mysqli))
+            ->withOption('initialize', false);
+    }
+
+    public static function tearDownAfterClass(): void
+    {
+        static::$mysqli->query('DROP DATABASE IF EXISTS `' . CACHE_TESTS_MYSQLI_DATABASE . '`');
+        static::$mysqli->close();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/NotCacheTest.php Added

@@ -0,0 +1,88 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\NotCache as NotCache;
+use PHPUnit\Framework\TestCase;
+
+/**
+ * NotCacheTest
+ */
+class NotCacheTest extends TestCase
+{
+    /**
+     * @var \Desarrolla2\Cache\NotCache
+     */
+    protected $cache;
+
+    public function setUp(): void
+    {
+        $this->cache = new NotCache();
+    }
+
+    /**
+     * @return array
+     */
+    public function dataProvider()
+    {
+        return array(
+            array(),
+        );
+    }
+
+    /**
+     * @dataProvider dataProvider
+     */
+    public function testHas()
+    {
+        $this->cache->set('key', 'value');
+        $this->assertFalse($this->cache->has('key'));
+    }
+
+    /**
+     * @dataProvider dataProvider
+     */
+    public function testGet()
+    {
+        $this->cache->set('key', 'value');
+        $this->assertFalse($this->cache->get('key', false));
+    }
+
+    /**
+     * @dataProvider dataProvider
+     */
+    public function testSet()
+    {
+        $this->assertFalse($this->cache->set('key', 'value'));
+    }
+
+    /**
+     * @dataProvider dataProvider
+     */
+    public function testDelete()
+    {
+        $this->assertTrue($this->cache->delete('key'));
+    }
+
+    /**
+     * @dataProvider dataProvider
+     */
+    public function testWithOption()
+    {
+        $cache = $this->cache->withOption('ttl', 3600);
+        $this->assertSame(3600, $cache->getOption('ttl'));
+
+        $this->assertNotSame($this->cache, $cache);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/PhpFileTest.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/PredisTest.php Added

@@ -0,0 +1,54 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\Predis as PredisCache;
+use Predis\Client;
+use Predis\Connection\ConnectionException;
+
+/**
+ * PredisTest
+ */
+class PredisTest extends AbstractCacheTest
+{
+    /**
+     * @var Client
+     */
+    protected $client;
+
+    public function createSimpleCache()
+    {
+        if (!class_exists('Predis\Client')) {
+            $this->markTestSkipped('The predis library is not available');
+        }
+
+        try {
+            $this->client = new Client(CACHE_TESTS_PREDIS_DSN, 'exceptions' => false);
+            $this->client->connect();
+        } catch (ConnectionException $e) {
+            $this->markTestSkipped($e->getMessage());
+        }
+
+        return new PredisCache($this->client);
+    }
+
+    public function tearDown(): void
+    {
+        parent::tearDown();
+
+        if ($this->client) {
+            $this->client->disconnect();
+        }
+    }
+}

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/RedisTest.php Added

@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+namespace Desarrolla2\Test\Cache;
+
+use Desarrolla2\Cache\Redis as RedisCache;
+use Redis as PhpRedis;
+
+/**
+ * RedisTest
+ */
+class RedisTest extends AbstractCacheTest
+{
+    /**
+     * @var PhpRedis
+     */
+    protected $client;
+
+    public function createSimpleCache()
+    {
+        if (!\extension_loaded('redis')) {
+            $this->markTestSkipped('Redis extension not available.');
+        }
+
+        $client = new PhpRedis();
+
+        $success = @$client->connect(CACHE_TESTS_REDIS_HOST, CACHE_TESTS_REDIS_PORT);
+        if (!$success) {
+            $this->markTestSkipped('Cannot connect to Redis.');
+        }
+
+        $this->client = $client;
+        
+        return new RedisCache($this->client);
+    }
+
+    public function tearDown(): void
+    {
+        parent::tearDown();
+
+        if ($this->client && $this->client->isConnected()) {
+            $this->client->close();
+        }
+    }
+}
+

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/performance Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/performance/Apc.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/performance/File.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/performance/Mongo.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/performance/NoCache.php Added

roundcubemail-1.5.tar.gz/vendor/desarrolla2/cache/tests/performance/common.php Added

@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of the Cache package.
+ *
+ * Copyright (c) Daniel González
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ *
+ * @author Daniel González <daniel@desarrolla2.com>
+ */
+
+
+//build test data outside of timing loop
+$data = ;
+for ($i = 1; $i <= 10000; $i++) {
+    $data$i = md5($i);
+}
+
+$timer = new \Desarrolla2\Timer\Timer(new \Desarrolla2\Timer\Formatter\Human());
+for ($i = 1; $i <= 10000; $i++) {
+    $cache->set($data$i, $data$i, 3600);
+}
+$timer->mark('10.000 set');
+for ($i = 1; $i <= 10000; $i++) {
+    $cache->has($data$i);
+}
+$timer->mark('10.000 has');
+for ($i = 1; $i <= 10000; $i++) {
+    $cache->get($data$i);
+}
+$timer->mark('10.000 get');
+for ($i = 1; $i <= 10000; $i++) {
+    $cache->has($data$i);
+    $cache->get($data$i);
+}
+$timer->mark('10.000 has+get combos');
+
+$benchmarks = $timer->getAll();
+foreach ($benchmarks as $benchmark) {
+    ld($benchmark);
+}

roundcubemail-1.5.tar.gz/vendor/kolab/net_ldap3/.git/index Changed

roundcubemail-1.5.tar.gz/vendor/kolab/net_ldap3/.git/logs/HEAD Changed

@@ -1,3 +1,3 @@
-0000000000000000000000000000000000000000 5a319cf437d75aad564ce7fd076cc5423722868b Christian Mollekopf <mollekopf@apheleia-it.ch> 1686729194 +0200	clone: from /home/mollekopf/.cache/composer/vcs/https---git.kolab.org-diffusion-PNL-php-net-ldap.git/
-5a319cf437d75aad564ce7fd076cc5423722868b 5a319cf437d75aad564ce7fd076cc5423722868b Christian Mollekopf <mollekopf@apheleia-it.ch> 1686729194 +0200	checkout: moving from master to master
-5a319cf437d75aad564ce7fd076cc5423722868b 5a319cf437d75aad564ce7fd076cc5423722868b Christian Mollekopf <mollekopf@apheleia-it.ch> 1686729194 +0200	reset: moving to 5a319cf437d75aad564ce7fd076cc5423722868b
+0000000000000000000000000000000000000000 5a319cf437d75aad564ce7fd076cc5423722868b Christian Mollekopf <mollekopf@apheleia-it.ch> 1686733415 +0200	clone: from /home/mollekopf/.cache/composer/vcs/https---git.kolab.org-diffusion-PNL-php-net-ldap.git/
+5a319cf437d75aad564ce7fd076cc5423722868b 5a319cf437d75aad564ce7fd076cc5423722868b Christian Mollekopf <mollekopf@apheleia-it.ch> 1686733415 +0200	checkout: moving from master to master
+5a319cf437d75aad564ce7fd076cc5423722868b 5a319cf437d75aad564ce7fd076cc5423722868b Christian Mollekopf <mollekopf@apheleia-it.ch> 1686733415 +0200	reset: moving to 5a319cf437d75aad564ce7fd076cc5423722868b

roundcubemail-1.5.tar.gz/vendor/kolab/net_ldap3/.git/logs/refs/heads/master Changed

roundcubemail-1.5.tar.gz/vendor/kolab/net_ldap3/.git/logs/refs/remotes/origin/HEAD Changed

roundcubemail-1.5.tar.gz/vendor/monolog Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/.gitignore Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/.travis.yml Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/CHANGELOG.mdown Added

@@ -0,0 +1,60 @@
+* 1.2.1 (2012-08-29)
+
+  Changes:
+
+    * Added new $logopts arg to SyslogHandler to provide custom openlog options
+    * Fixed fatal error in SyslogHandler
+
+* 1.2.0 (2012-08-18)
+
+  Changes:
+
+    * Added AmqpHandler (for use with AMQP servers)
+    * Added CubeHandler
+    * Added NativeMailerHandler::addHeader() to send custom headers in mails
+    * Added the possibility to specify more than one recipient in NativeMailerHandler
+    * Added the possibility to specify float timeouts in SocketHandler
+    * Added NOTICE and EMERGENCY levels to conform with RFC 5424
+    * Fixed the log records to use the php default timezone instead of UTC
+    * Fixed BufferHandler not being flushed properly on PHP fatal errors
+    * Fixed normalization of exotic resource types
+    * Fixed the default format of the SyslogHandler to avoid duplicating datetimes in syslog
+
+* 1.1.0 (2012-04-23)
+
+  Changes:
+
+    * Added Monolog\Logger::isHandling() to check if a handler will
+      handle the given log level
+    * Added ChromePHPHandler
+    * Added MongoDBHandler
+    * Added GelfHandler (for use with Graylog2 servers)
+    * Added SocketHandler (for use with syslog-ng for example)
+    * Added NormalizerFormatter
+    * Added the possibility to change the activation strategy of the FingersCrossedHandler
+    * Added possibility to show microseconds in logs
+    * Added `server` and `referer` to WebProcessor output
+
+* 1.0.2 (2011-10-24)
+
+  Changes:
+
+    * Fixed bug in IE with large response headers and FirePHPHandler
+
+* 1.0.1 (2011-08-25)
+
+  Changes:
+
+    * Added MemoryPeakUsageProcessor and MemoryUsageProcessor
+    * Added Monolog\Logger::getName() to get a logger's channel name
+
+* 1.0.0 (2011-07-06)
+
+  Changes:
+
+    * Added IntrospectionProcessor to get info from where the logger was called
+    * Fixed WebProcessor in CLI
+
+* 1.0.0-RC1 (2011-07-01)
+
+  * Initial release

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/LICENSE Added

@@ -0,0 +1,19 @@
+Copyright (c) Jordi Boggiano
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is furnished
+to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/README.mdown Added

@@ -0,0 +1,188 @@
+Monolog - Logging for PHP 5.3
+=============================
+
+!Build Status(https://secure.travis-ci.org/Seldaek/monolog.png)(http://travis-ci.org/Seldaek/monolog)
+
+Usage
+-----
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+
+// create a log channel
+$log = new Logger('name');
+$log->pushHandler(new StreamHandler('path/to/your.log', Logger::WARNING));
+
+// add records to the log
+$log->addWarning('Foo');
+$log->addError('Bar');
+```
+
+Core Concepts
+-------------
+
+Every `Logger` instance has a channel (name) and a stack of handlers. Whenever
+you add a record to the logger, it traverses the handler stack. Each handler
+decides whether it handled fully the record, and if so, the propagation of the
+record ends there.
+
+This allow for flexible logging setups, for example having a `StreamHandler` at
+the bottom of the stack that will log anything to disk, and on top of that add
+a `MailHandler` that will send emails only when an error message is logged.
+Handlers also have a `$bubble` property which defines whether they block the
+record or not if they handled it. In this example, setting the `MailHandler`'s
+`$bubble` argument to true means that all records will propagate to the
+`StreamHandler`, even the errors that are handled by the `MailHandler`.
+
+You can create many `Logger`s, each defining a channel (e.g.: db, request,
+router, ..) and each of them combining various handlers, which can be shared
+or not. The channel is reflected in the logs and allows you to easily see or
+filter records.
+
+Each Handler also has a Formatter, a default one with settings that make sense
+will be created if you don't set one. The formatters normalize and format
+incoming records so that they can be used by the handlers to output useful
+information.
+
+Custom severity levels are not available. Only the eight
+RFC 5424(http://tools.ietf.org/html/rfc5424) levels (debug, info, notice,
+warning, error, critical, alert, emergency) are present for basic filtering
+purposes, but for sorting and other use cases that would require
+flexibility, you should add Processors to the Logger that can add extra
+information (tags, user ip, ..) to the records before they are handled.
+
+Log Levels
+----------
+
+Monolog supports all 8 logging levels defined in
+RFC 5424(http://tools.ietf.org/html/rfc5424), but unless you specifically
+need syslog compatibility, it is advised to only use DEBUG, INFO, WARNING,
+ERROR, CRITICAL, ALERT.
+
+- **DEBUG** (100): Detailed debug information.
+
+- **INFO** (200): Interesting events. Examples: User logs in, SQL logs.
+
+- NOTICE (250): Normal but significant events.
+
+- **WARNING** (300): Exceptional occurrences that are not errors. Examples:
+  Use of deprecated APIs, poor use of an API, undesirable things that are not
+  necessarily wrong.
+
+- **ERROR** (400): Runtime errors that do not require immediate action but
+  should typically be logged and monitored.
+
+- **CRITICAL** (500): Critical conditions. Example: Application component
+  unavailable, unexpected exception.
+
+- **ALERT** (550): Action must be taken immediately. Example: Entire website
+  down, database unavailable, etc. This should trigger the SMS alerts and wake
+  you up.
+
+- EMERGENCY (600): Emergency: system is unusable.
+
+Docs
+====
+
+**See the `doc` directory for more detailed documentation.
+The following is only a list of all parts that come with Monolog.**
+
+Handlers
+--------
+
+- _StreamHandler_: Logs records into any PHP stream, use this for log files.
+- _RotatingFileHandler_: Logs records to a file and creates one logfile per day.
+  It will also delete files older than `$maxFiles`. You should use
+  logrotate(http://linuxcommand.org/man_pages/logrotate8.html) for high profile
+  setups though, this is just meant as a quick and dirty solution.
+- _FirePHPHandler_: Handler for FirePHP(http://www.firephp.org/), providing
+  inline `console` messages within FireBug(http://getfirebug.com/).
+- _ChromePHPHandler_: Handler for ChromePHP(http://www.chromephp.com/), providing
+  inline `console` messages within Chrome.
+- _MongoDBHandler_: Handler to write records in MongoDB via a
+  Mongo(http://pecl.php.net/package/mongo) extension connection.
+- _NativeMailHandler_: Sends emails using PHP's
+  `mail()`(http://php.net/manual/en/function.mail.php) function.
+- _SwiftMailerHandler_: Sends emails using a `Swift_Mailer`(http://swiftmailer.org/) instance.
+- _SyslogHandler_: Logs records to the syslog.
+- _GelfHandler_: Logs records to a Graylog2(http://www.graylog2.org) server.
+- _SocketHandler_: Logs records to sockets(http://php.net/fsockopen), use this
+  for UNIX and TCP sockets. See an example(https://github.com/Seldaek/monolog/blob/master/doc/sockets.md).
+- _AmqpHandler_: Logs records to an amqp(http://www.amqp.org/) compatible
+  server. Requires the php-amqp(http://pecl.php.net/package/amqp) extension (1.0+).
+- _CubeHandler_: Logs records to a Cube(http://square.github.com/cube/) server.
+
+Wrappers / Special Handlers
+---------------------------
+
+- _FingersCrossedHandler_: A very interesting wrapper. It takes a logger as
+  parameter and will accumulate log records of all levels until a record
+  exceeds the defined severity level. At which point it delivers all records,
+  including those of lower severity, to the handler it wraps. This means that
+  until an error actually happens you will not see anything in your logs, but
+  when it happens you will have the full information, including debug and info
+  records. This provides you with all the information you need, but only when
+  you need it.
+- _NullHandler_: Any record it can handle will be thrown away. This can be used
+  to put on top of an existing handler stack to disable it temporarily.
+- _BufferHandler_: This handler will buffer all the log records it receives
+  until `close()` is called at which point it will call `handleBatch()` on the
+  handler it wraps with all the log messages at once. This is very useful to
+  send an email with all records at once for example instead of having one mail
+  for every log record.
+- _GroupHandler_: This handler groups other handlers. Every record received is
+  sent to all the handlers it is configured with.
+- _TestHandler_: Used for testing, it records everything that is sent to it and
+  has accessors to read out the information.
+
+Formatters
+----------
+
+- _LineFormatter_: Formats a log record into a one-line string.
+- _NormalizerFormatter_: Normalizes objects/resources down to strings so a record can easily be serialized/encoded.
+- _JsonFormatter_: Encodes a log record into json.
+- _WildfireFormatter_: Used to format log records into the Wildfire/FirePHP protocol, only useful for the FirePHPHandler.
+- _ChromePHPFormatter_: Used to format log records into the ChromePHP format, only useful for the ChromePHPHandler.
+- _GelfFormatter_: Used to format log records into Gelf message instances, only useful for the GelfHandler.
+
+Processors
+----------
+
+- _IntrospectionProcessor_: Adds the line/file/class/method from which the log call originated.
+- _WebProcessor_: Adds the current request URI, request method and client IP to a log record.
+- _MemoryUsageProcessor_: Adds the current memory usage to a log record.
+- _MemoryPeakUsageProcessor_: Adds the peak memory usage to a log record.
+
+About
+=====
+
+Requirements
+------------
+
+- Any flavor of PHP 5.3 should do
+- optional PHPUnit 3.5+ to execute the test suite (phpunit --version)
+
+Submitting bugs and feature requests
+------------------------------------
+
+Bugs and feature request are tracked on GitHub(https://github.com/Seldaek/monolog/issues)
+
+Author
+------
+
+Jordi Boggiano - <j.boggiano@seld.be> - <http://twitter.com/seldaek><br />
+See also the list of contributors(https://github.com/Seldaek/monolog/contributors) which participated in this project.
+
+License
+-------
+
+Monolog is licensed under the MIT License - see the `LICENSE` file for details
+
+Acknowledgements
+----------------
+
+This library is heavily inspired by Python's Logbook(http://packages.python.org/Logbook/)
+library, although most concepts have been adjusted to fit to the PHP world.

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/composer.json Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/doc Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/doc/extending.md Added

@@ -0,0 +1,76 @@
+Extending Monolog
+=================
+
+Monolog is fully extensible, allowing you to adapt your logger to your needs.
+
+Writing your own handler
+------------------------
+
+Monolog provides many built-in handlers. But if the one you need does not
+exist, you can write it and use it in your logger. The only requirement is
+to implement `Monolog\Handler\HandlerInterface`.
+
+Let's write a PDOHandler to log records to a database. We will extend the
+abstract class provided by Monolog to keep things DRY.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\AbstractProcessingHandler;
+
+class PDOHandler extends AbstractProcessingHandler
+{
+    private $initialized = false;
+    private $pdo;
+    private $statement;
+
+    public function __construct(PDO $pdo, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->pdo = $pdo;
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        if (!$this->initialized) {
+            $this->initialize();
+        }
+
+        $this->statement->execute(array(
+            'channel' => $record'channel',
+            'level' => $record'level',
+            'message' => $record'formatted',
+            'time' => $record'datetime'->format('U'),
+        ));
+    }
+
+    private function initialize()
+    {
+        $this->pdo->exec(
+            'CREATE TABLE IF NOT EXISTS monolog '
+            .'(channel VARCHAR(255), level INTEGER, message LONGTEXT, time INTEGER UNSIGNED)'
+        );
+        $this->statement = $this->pdo->prepare(
+            'INSERT INTO monolog (channel, level, message, time) VALUES (:channel, :level, :message, :time)'
+        );
+
+        $this->initialized = true;
+    }
+}
+```
+
+You can now use this handler in your logger:
+
+```php
+<?php
+
+$logger->pushHandler(new PDOHandler(new PDO('sqlite:logs.sqlite'));
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+The `Monolog\Handler\AbstractProcessingHandler` class provides most of the
+logic needed for the handler, including the use of processors and the formatting
+of the record (which is why we use ``$record'formatted'`` instead of ``$record'message'``).

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/doc/sockets.md Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/doc/usage.md Added

@@ -0,0 +1,123 @@
+Using Monolog
+=============
+
+Installation
+------------
+
+Monolog is available on Packagist (monolog/monolog(http://packagist.org/packages/monolog/monolog))
+and as such installable via Composer(http://getcomposer.org/).
+
+If you do not use Composer, you can grab the code from GitHub, and use any
+PSR-0 compatible autoloader (e.g. the Symfony2 ClassLoader component(https://github.com/symfony/ClassLoader))
+to load Monolog classes.
+
+Configuring a logger
+--------------------
+
+Here is a basic setup to log to a file and to firephp on the DEBUG level:
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create the logger
+$logger = new Logger('my_logger');
+// Now add some handlers
+$logger->pushHandler(new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG));
+$logger->pushHandler(new FirePHPHandler());
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+Let's explain it. The first step is to create the logger instance which will
+be used in your code. The argument is a channel name, which is useful when
+you use several loggers (see below for more details about it).
+
+The logger itself does not know how to handle a record. It delegates it to
+some handlers. The code above registers two handlers in the stack to allow
+handling records in two different ways.
+
+Note that the FirePHPHandler is called first as it is added on top of the
+stack. This allows you to temporarily add a logger with bubbling disabled if
+you want to override other configured loggers.
+
+Adding extra data in the records
+--------------------------------
+
+Monolog provides two different ways to add extra informations along the simple
+textual message.
+
+### Using the logging context
+
+The first way is the context, allowing to pass an array of data along the
+record:
+
+```php
+<?php
+
+$logger->addInfo('Adding a new user', array('username' => 'Seldaek'));
+```
+
+Simple handlers (like the StreamHandler for instance) will simply format
+the array to a string but richer handlers can take advantage of the context
+(FirePHP is able to display arrays in pretty way for instance).
+
+### Using processors
+
+The second way is to add extra data for all records by using a processor.
+Processors can be any callable. They will get the record as parameter and
+must return it after having eventually changed the `extra` part of it. Let's
+write a processor adding some dummy data in the record:
+
+```php
+<?php
+
+$logger->pushProcessor(function ($record) {
+    $record'extra''dummy' = 'Hello world!';
+
+    return $record;
+});
+```
+
+Monolog provides some built-in processors that can be used in your project.
+Look at the README file for the list.
+
+> Tip: processors can also be registered on a specific handler instead of
+  the logger to apply only for this handler.
+
+Leveraging channels
+-------------------
+
+Channels are a great way to identify to which part of the application a record
+is related. This is useful in big applications (and is leveraged by
+MonologBundle in Symfony2).
+
+Picture two loggers sharing a handler that writes to a single log file.
+Channels would allow you to identify the logger that issued every record.
+You can easily grep through the log files filtering this or that channel.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create some handlers
+$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
+$firephp = new FirePHPHandler();
+
+// Create the main logger of the app
+$logger = new Logger('my_logger');
+$logger->pushHandler($stream);
+$logger->pushHandler($firephp);
+
+// Create a logger for the security-related stuff with a different channel
+$securityLogger = new Logger('security');
+$securityLogger->pushHandler($stream);
+$securityLogger->pushHandler($firephp);
+```

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/phpunit.xml.dist Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php Added

@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Formats a log message according to the ChromePHP array format
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPFormatter implements FormatterInterface
+{
+    /**
+     * Translates Monolog log levels to Wildfire levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 'log',
+        Logger::INFO      => 'info',
+        Logger::NOTICE    => 'info',
+        Logger::WARNING   => 'warn',
+        Logger::ERROR     => 'error',
+        Logger::CRITICAL  => 'error',
+        Logger::ALERT     => 'error',
+        Logger::EMERGENCY => 'error',
+    );
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        // Retrieve the line and file if set and remove them from the formatted extra
+        $backtrace = 'unknown';
+        if (isset($record'extra''file') && isset($record'extra''line')) {
+            $backtrace = $record'extra''file'.' : '.$record'extra''line';
+            unset($record'extra''file');
+            unset($record'extra''line');
+        }
+
+        $message = array('message' => $record'message');
+        if ($record'context') {
+            $message'context' = $record'context';
+        }
+        if ($record'extra') {
+            $message'extra' = $record'extra';
+        }
+        if (count($message) === 1) {
+            $message = reset($message);
+        }
+
+        return array(
+            $record'channel',
+            $message,
+            $backtrace,
+            $this->logLevels$record'level',
+        );
+    }
+
+    public function formatBatch(array $records)
+    {
+        $formatted = array();
+
+        foreach ($records as $record) {
+            $formatted = $this->format($record);
+        }
+
+        return $formatted;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php Added

@@ -0,0 +1,94 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Gelf\Message;
+
+/**
+ * Serializes a log message to GELF
+ * @see http://www.graylog2.org/about/gelf
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ */
+class GelfMessageFormatter extends NormalizerFormatter
+{
+    /**
+     * @var string the name of the system for the Gelf log message
+     */
+    protected $systemName;
+
+    /**
+     * @var string a prefix for 'extra' fields from the Monolog record (optional)
+     */
+    protected $extraPrefix;
+
+    /**
+     * @var string a prefix for 'context' fields from the Monolog record (optional)
+     */
+    protected $contextPrefix;
+
+    /**
+     * Translates Monolog log levels to Graylog2 log priorities.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => LOG_DEBUG,
+        Logger::INFO      => LOG_INFO,
+        Logger::NOTICE    => LOG_NOTICE,
+        Logger::WARNING   => LOG_WARNING,
+        Logger::ERROR     => LOG_ERR,
+        Logger::CRITICAL  => LOG_CRIT,
+        Logger::ALERT     => LOG_ALERT,
+        Logger::EMERGENCY => LOG_EMERG,
+    );
+
+    public function __construct($systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_')
+    {
+        parent::__construct('U.u');
+
+        $this->systemName = $systemName ?: gethostname();
+
+        $this->extraPrefix = $extraPrefix;
+        $this->contextPrefix = $contextPrefix;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $record = parent::format($record);
+        $message = new Message();
+        $message
+            ->setTimestamp($record'datetime')
+            ->setShortMessage((string) $record'message')
+            ->setFacility($record'channel')
+            ->setHost($this->systemName)
+            ->setLine(isset($record'extra''line') ? $record'extra''line' : null)
+            ->setFile(isset($record'extra''file') ? $record'extra''file' : null)
+            ->setLevel($this->logLevels$record'level');
+
+        // Do not duplicate these values in the additional fields
+        unset($record'extra''line');
+        unset($record'extra''file');
+
+        foreach ($record'extra' as $key => $val) {
+            $message->setAdditional($this->extraPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+        }
+
+        foreach ($record'context' as $key => $val) {
+            $message->setAdditional($this->contextPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+        }
+
+        return $message;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php Added

@@ -0,0 +1,90 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats incoming records into a one-line string
+ *
+ * This is especially useful for logging to files
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class LineFormatter extends NormalizerFormatter
+{
+    const SIMPLE_FORMAT = "%datetime% %channel%.%level_name%: %message% %context% %extra%\n";
+
+    protected $format;
+
+    /**
+     * @param string $format     The format of the message
+     * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+     */
+    public function __construct($format = null, $dateFormat = null)
+    {
+        $this->format = $format ?: static::SIMPLE_FORMAT;
+        parent::__construct($dateFormat);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $vars = parent::format($record);
+
+        $output = $this->format;
+        foreach ($vars'extra' as $var => $val) {
+            if (false !== strpos($output, '%extra.'.$var.'%')) {
+                $output = str_replace('%extra.'.$var.'%', $this->convertToString($val), $output);
+                unset($vars'extra'$var);
+            }
+        }
+        foreach ($vars as $var => $val) {
+            $output = str_replace('%'.$var.'%', $this->convertToString($val), $output);
+        }
+
+        return $output;
+    }
+
+    public function formatBatch(array $records)
+    {
+        $message = '';
+        foreach ($records as $record) {
+            $message .= $this->format($record);
+        }
+
+        return $message;
+    }
+
+    protected function normalize($data)
+    {
+        if (is_bool($data) || is_null($data)) {
+            return var_export($data, true);
+        }
+
+        return parent::normalize($data);
+    }
+
+    protected function convertToString($data)
+    {
+        if (null === $data || is_scalar($data)) {
+            return (string) $data;
+        }
+
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return json_encode($this->normalize($data), JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+        }
+
+        return stripslashes(json_encode($this->normalize($data)));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php Added

@@ -0,0 +1,92 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Normalizes incoming records to remove objects/resources so it's easier to dump to various targets
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NormalizerFormatter implements FormatterInterface
+{
+    const SIMPLE_DATE = "Y-m-d H:i:s";
+
+    protected $dateFormat;
+
+    /**
+     * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+     */
+    public function __construct($dateFormat = null)
+    {
+        $this->dateFormat = $dateFormat ?: static::SIMPLE_DATE;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        return $this->normalize($record);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function formatBatch(array $records)
+    {
+        foreach ($records as $key => $record) {
+            $records$key = $this->format($record);
+        }
+
+        return $records;
+    }
+
+    protected function normalize($data)
+    {
+        if (null === $data || is_scalar($data)) {
+            return $data;
+        }
+
+        if (is_array($data) || $data instanceof \Traversable) {
+            $normalized = array();
+
+            foreach ($data as $key => $value) {
+                $normalized$key = $this->normalize($value);
+            }
+
+            return $normalized;
+        }
+
+        if ($data instanceof \DateTime) {
+            return $data->format($this->dateFormat);
+        }
+
+        if (is_object($data)) {
+            return sprintf("object (%s: %s)", get_class($data), $this->toJson($data));
+        }
+
+        if (is_resource($data)) {
+            return 'resource';
+        }
+
+        return 'unknown('.gettype($data).')';
+    }
+
+    protected function toJson($data)
+    {
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+        }
+
+        return json_encode($data);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php Added

@@ -0,0 +1,99 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Serializes a log message according to Wildfire's header requirements
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Kirill chEbba Chebunin <iam@chebba.org>
+ */
+class WildfireFormatter extends NormalizerFormatter
+{
+    /**
+     * Translates Monolog log levels to Wildfire levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 'LOG',
+        Logger::INFO      => 'INFO',
+        Logger::NOTICE    => 'INFO',
+        Logger::WARNING   => 'WARN',
+        Logger::ERROR     => 'ERROR',
+        Logger::CRITICAL  => 'ERROR',
+        Logger::ALERT     => 'ERROR',
+        Logger::EMERGENCY => 'ERROR',
+    );
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        // Retrieve the line and file if set and remove them from the formatted extra
+        $file = $line = '';
+        if (isset($record'extra''file')) {
+            $file = $record'extra''file';
+            unset($record'extra''file');
+        }
+        if (isset($record'extra''line')) {
+            $line = $record'extra''line';
+            unset($record'extra''line');
+        }
+
+        $record = $this->normalize($record);
+        $message = array('message' => $record'message');
+        if ($record'context') {
+            $message'context' = $record'context';
+        }
+        if ($record'extra') {
+            $message'extra' = $record'extra';
+        }
+        if (count($message) === 1) {
+            $message = reset($message);
+        }
+
+        // Create JSON object describing the appearance of the message in the console
+        $json = json_encode(array(
+            array(
+                'Type'  => $this->logLevels$record'level',
+                'File'  => $file,
+                'Line'  => $line,
+                'Label' => $record'channel',
+            ),
+            $message,
+        ));
+
+        // The message itself is a serialization of the above JSON object + it's length
+        return sprintf(
+            '%s|%s|',
+            strlen($json),
+            $json
+        );
+    }
+
+    public function formatBatch(array $records)
+    {
+        throw new \BadMethodCallException('Batch formatting does not make sense for the WildfireFormatter');
+    }
+
+    protected function normalize($data)
+    {
+        if (is_object($data) && !$data instanceof \DateTime) {
+            return $data;
+        }
+
+        return parent::normalize($data);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php Added

@@ -0,0 +1,174 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+abstract class AbstractHandler implements HandlerInterface
+{
+    protected $level = Logger::DEBUG;
+    protected $bubble = false;
+
+    /**
+     * @var FormatterInterface
+     */
+    protected $formatter;
+    protected $processors = array();
+
+    /**
+     * @param integer $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($level = Logger::DEBUG, $bubble = true)
+    {
+        $this->level = $level;
+        $this->bubble = $bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        return $record'level' >= $this->level;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        foreach ($records as $record) {
+            $this->handle($record);
+        }
+    }
+
+    /**
+     * Closes the handler.
+     *
+     * This will be called automatically when the object is destroyed
+     */
+    public function close()
+    {
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function pushProcessor($callback)
+    {
+        if (!is_callable($callback)) {
+            throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+        }
+        array_unshift($this->processors, $callback);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function popProcessor()
+    {
+        if (!$this->processors) {
+            throw new \LogicException('You tried to pop from an empty processor stack.');
+        }
+
+        return array_shift($this->processors);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setFormatter(FormatterInterface $formatter)
+    {
+        $this->formatter = $formatter;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getFormatter()
+    {
+        if (!$this->formatter) {
+            $this->formatter = $this->getDefaultFormatter();
+        }
+
+        return $this->formatter;
+    }
+
+    /**
+     * Sets minimum logging level at which this handler will be triggered.
+     *
+     * @param integer $level
+     */
+    public function setLevel($level)
+    {
+        $this->level = $level;
+    }
+
+    /**
+     * Gets minimum logging level at which this handler will be triggered.
+     *
+     * @return integer
+     */
+    public function getLevel()
+    {
+        return $this->level;
+    }
+
+    /**
+     * Sets the bubbling behavior.
+     *
+     * @param Boolean $bubble True means that bubbling is not permitted.
+     *                        False means that this handler allows bubbling.
+     */
+    public function setBubble($bubble)
+    {
+        $this->bubble = $bubble;
+    }
+
+    /**
+     * Gets the bubbling behavior.
+     *
+     * @return Boolean True means that bubbling is not permitted.
+     *                 False means that this handler allows bubbling.
+     */
+    public function getBubble()
+    {
+        return $this->bubble;
+    }
+
+    public function __destruct()
+    {
+        try {
+            $this->close();
+        } catch (\Exception $e) {
+            // do nothing
+        }
+    }
+
+    /**
+     * Gets the default formatter.
+     *
+     * @return FormatterInterface
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php Added

@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * Classes extending it should (in most cases) only implement write($record)
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+abstract class AbstractProcessingHandler extends AbstractHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record'level' < $this->level) {
+            return false;
+        }
+
+        $record = $this->processRecord($record);
+
+        $record'formatted' = $this->getFormatter()->format($record);
+
+        $this->write($record);
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * Writes the record down to the log of the implementing handler
+     *
+     * @param  array $record
+     * @return void
+     */
+    abstract protected function write(array $record);
+
+    /**
+     * Processes a record.
+     *
+     * @param  array $record
+     * @return array
+     */
+    protected function processRecord(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        return $record;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php Added

@@ -0,0 +1,69 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\JsonFormatter;
+
+class AmqpHandler extends AbstractProcessingHandler
+{
+    /**
+     * @var \AMQPExchange $exchange
+     */
+    protected $exchange;
+
+    /**
+     * @param \AMQPExchange $exchange     AMQP exchange, ready for use
+     * @param string        $exchangeName
+     * @param int           $level
+     * @param bool          $bubble       Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(\AMQPExchange $exchange, $exchangeName = 'log', $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->exchange = $exchange;
+        $this->exchange->setName($exchangeName);
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $data = $record"formatted";
+
+        $routingKey = sprintf(
+            '%s.%s',
+            substr($record'level_name', 0, 4),
+            $record'channel'
+        );
+
+        $this->exchange->publish(
+            $data,
+            strtolower($routingKey),
+            0,
+            array(
+                'delivery_mode' => 2,
+                'Content-type' => 'application/json'
+            )
+        );
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new JsonFormatter();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php Added

@@ -0,0 +1,73 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Buffers all records until closing the handler and then pass them as batch.
+ *
+ * This is useful for a MailHandler to send only one mail per request instead of
+ * sending one per log message.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class BufferHandler extends AbstractHandler
+{
+    protected $handler;
+    protected $bufferSize;
+    protected $buffer = array();
+
+    /**
+     * @param HandlerInterface $handler    Handler.
+     * @param integer          $bufferSize How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+     * @param integer          $level      The minimum logging level at which this handler will be triggered
+     * @param Boolean          $bubble     Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(HandlerInterface $handler, $bufferSize = 0, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->handler = $handler;
+        $this->bufferSize = $bufferSize;
+
+        // __destructor() doesn't get called on Fatal errors
+        register_shutdown_function(array($this, 'close'));
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record'level' < $this->level) {
+            return false;
+        }
+
+        $this->buffer = $record;
+        if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) {
+            array_shift($this->buffer);
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        if ($this->buffer) {
+            $this->handler->handleBatch($this->buffer);
+            $this->buffer = array();
+        }
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php Added

@@ -0,0 +1,126 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ChromePHPFormatter;
+
+/**
+ * Handler sending logs to the ChromePHP extension (http://www.chromephp.com/)
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPHandler extends AbstractProcessingHandler
+{
+    /**
+     * Version of the extension
+     */
+    const VERSION = '3.0';
+
+    /**
+     * Header name
+     */
+    const HEADER_NAME = 'X-ChromePhp-Data';
+
+    protected static $initialized = false;
+
+    protected static $json = array(
+        'version' => self::VERSION,
+        'columns' => array('label', 'log', 'backtrace', 'type'),
+        'rows' => array(),
+    );
+
+    protected $sendHeaders = true;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $messages = array();
+
+        foreach ($records as $record) {
+            if ($record'level' < $this->level) {
+                continue;
+            }
+            $messages = $this->processRecord($record);
+        }
+
+        if (!empty($messages)) {
+            $messages = $this->getFormatter()->formatBatch($messages);
+            self::$json'rows' = array_merge(self::$json'rows', $messages);
+            $this->send();
+        }
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new ChromePHPFormatter();
+    }
+
+    /**
+     * Creates & sends header for a record
+     *
+     * @see sendHeader()
+     * @see send()
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        self::$json'rows' = $record'formatted';
+
+        $this->send();
+    }
+
+    /**
+     * Sends the log header
+     *
+     * @see sendHeader()
+     */
+    protected function send()
+    {
+        if (!self::$initialized) {
+            $this->sendHeaders = $this->headersAccepted();
+            self::$json'request_uri' = isset($_SERVER'REQUEST_URI') ? $_SERVER'REQUEST_URI' : '';
+
+            self::$initialized = true;
+        }
+
+        $this->sendHeader(self::HEADER_NAME, base64_encode(utf8_encode(json_encode(self::$json))));
+    }
+
+    /**
+     * Send header string to the client
+     *
+     * @param string $header
+     * @param string $content
+     */
+    protected function sendHeader($header, $content)
+    {
+        if (!headers_sent() && $this->sendHeaders) {
+            header(sprintf('%s: %s', $header, $content));
+        }
+    }
+
+    /**
+     * Verifies if the headers are accepted by the current user agent
+     *
+     * @return Boolean
+     */
+    protected function headersAccepted()
+    {
+        return !isset($_SERVER'HTTP_USER_AGENT')
+               || preg_match('{\bChrome/\d+\.\d+*\b}', $_SERVER'HTTP_USER_AGENT');
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php Added

@@ -0,0 +1,145 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to Cube.
+ *
+ * @link http://square.github.com/cube/
+ * @author Wan Chen <kami@kamisama.me>
+ */
+class CubeHandler extends AbstractProcessingHandler
+{
+    private $udpConnection = null;
+    private $httpConnection = null;
+    private $scheme = null;
+    private $host = null;
+    private $port = null;
+    private $acceptedSchemes = array('http', 'udp');
+
+    /**
+     * Create a Cube handler
+     *
+     * @throws UnexpectedValueException when given url is not a valid url.
+     * A valid url must consists of three parts : protocol://host:port
+     * Only valid protocol used by Cube are http and udp
+     */
+    public function __construct($url, $level = Logger::DEBUG, $bubble = true)
+    {
+        $urlInfos = parse_url($url);
+
+        if (!isset($urlInfos'scheme') || !isset($urlInfos'host') || !isset($urlInfos'port')) {
+            throw new \UnexpectedValueException('URL "'.$url.'" is not valid');
+        }
+
+        if (!in_array($urlInfos'scheme', $this->acceptedSchemes)) {
+            throw new \UnexpectedValueException(
+                'Invalid protocol (' . $urlInfos'scheme'  . ').'
+                . ' Valid options are ' . implode(', ', $this->acceptedSchemes));
+        }
+
+        $this->scheme = $urlInfos'scheme';
+        $this->host = $urlInfos'host';
+        $this->port = $urlInfos'port';
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * Establish a connection to an UDP socket
+     *
+     * @throws LogicException when unable to connect to the socket
+     */
+    protected function connectUdp()
+    {
+        if (!extension_loaded('sockets')) {
+            throw new \LogicException('The sockets extension is needed to use udp URLs with the CubeHandler');
+        }
+
+        $this->udpConnection = socket_create(AF_INET, SOCK_DGRAM, 0);
+        if (!$this->udpConnection) {
+            throw new \LogicException('Unable to create a socket');
+        }
+
+        if (!socket_connect($this->udpConnection, $this->host, $this->port)) {
+            throw new \LogicException('Unable to connect to the socket at ' . $this->host . ':' . $this->port);
+        }
+    }
+
+    /**
+     * Establish a connection to a http server
+     */
+    protected function connectHttp()
+    {
+        if (!extension_loaded('curl')) {
+            throw new \LogicException('The curl extension is needed to use http URLs with the CubeHandler');
+        }
+
+        $this->httpConnection = curl_init('http://'.$this->host.':'.$this->port.'/1.0/event/put');
+
+        if (!$this->httpConnection) {
+            throw new \LogicException('Unable to connect to ' . $this->host . ':' . $this->port);
+        }
+
+        curl_setopt($this->httpConnection, CURLOPT_CUSTOMREQUEST, "POST");
+        curl_setopt($this->httpConnection, CURLOPT_RETURNTRANSFER, true);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $date = $record'datetime';
+
+        $data = array('time' => $date->format('Y-m-d H:i:s'));
+        unset($record'datetime');
+
+        if (isset($record'context''type')) {
+            $data'type' = $record'context''type';
+            unset($record'context''type');
+        } else {
+            $data'type' = $record'channel';
+        }
+
+        $data'data' = $record'context';
+        $data'data''level' = $record'level';
+
+        $this->{'write'.$this->scheme}(json_encode($data));
+    }
+
+    private function writeUdp($data)
+    {
+        if (!$this->udpConnection) {
+            $this->connectUdp();
+        }
+
+        socket_send($this->udpConnection, $data, strlen($data), 0);
+    }
+
+    private function writeHttp($data)
+    {
+        if (!$this->httpConnection) {
+            $this->connectHttp();
+        }
+
+        curl_setopt($this->httpConnection, CURLOPT_POSTFIELDS, ''.$data.'');
+        curl_setopt($this->httpConnection, CURLOPT_HTTPHEADER, array(
+                'Content-Type: application/json',
+                'Content-Length: ' . strlen(''.$data.''))
+        );
+
+        return curl_exec($this->httpConnection);
+    }
+}
\ No newline at end of file

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php Added

@@ -0,0 +1,104 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ActivationStrategyInterface;
+use Monolog\Logger;
+
+/**
+ * Buffers all records until a certain level is reached
+ *
+ * The advantage of this approach is that you don't get any clutter in your log files.
+ * Only requests which actually trigger an error (or whatever your actionLevel is) will be
+ * in the logs, but they will contain all records, not only those above the level threshold.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class FingersCrossedHandler extends AbstractHandler
+{
+    protected $handler;
+    protected $activationStrategy;
+    protected $buffering = true;
+    protected $bufferSize;
+    protected $buffer = array();
+    protected $stopBuffering;
+
+    /**
+     * @param callback|HandlerInterface       $handler            Handler or factory callback($record, $fingersCrossedHandler).
+     * @param int|ActivationStrategyInterface $activationStrategy Strategy which determines when this handler takes action
+     * @param int                             $bufferSize         How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+     * @param Boolean                         $bubble             Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean                         $stopBuffering      Whether the handler should stop buffering after being triggered (default true)
+     */
+    public function __construct($handler, $activationStrategy = null, $bufferSize = 0, $bubble = true, $stopBuffering = true)
+    {
+        if (null === $activationStrategy) {
+            $activationStrategy = new ErrorLevelActivationStrategy(Logger::WARNING);
+        }
+        if (!$activationStrategy instanceof ActivationStrategyInterface) {
+            $activationStrategy = new ErrorLevelActivationStrategy($activationStrategy);
+        }
+
+        $this->handler = $handler;
+        $this->activationStrategy = $activationStrategy;
+        $this->bufferSize = $bufferSize;
+        $this->bubble = $bubble;
+        $this->stopBuffering = $stopBuffering;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($this->buffering) {
+            $this->buffer = $record;
+            if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) {
+                array_shift($this->buffer);
+            }
+            if ($this->activationStrategy->isHandlerActivated($record)) {
+                if ($this->stopBuffering) {
+                    $this->buffering = false;
+                }
+                if (!$this->handler instanceof HandlerInterface) {
+                    $this->handler = call_user_func($this->handler, $record, $this);
+                }
+                if (!$this->handler instanceof HandlerInterface) {
+                    throw new \RuntimeException("The factory callback should return a HandlerInterface");
+                }
+                $this->handler->handleBatch($this->buffer);
+                $this->buffer = array();
+            }
+        } else {
+            $this->handler->handle($record);
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * Resets the state of the handler. Stops forwarding records to the wrapped handler.
+     */
+    public function reset()
+    {
+        $this->buffering = true;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php Added

@@ -0,0 +1,160 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\WildfireFormatter;
+
+/**
+ * Simple FirePHP Handler (http://www.firephp.org/), which uses the Wildfire protocol.
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ */
+class FirePHPHandler extends AbstractProcessingHandler
+{
+    /**
+     * WildFire JSON header message format
+     */
+    const PROTOCOL_URI = 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2';
+
+    /**
+     * FirePHP structure for parsing messages & their presentation
+     */
+    const STRUCTURE_URI = 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1';
+
+    /**
+     * Must reference a "known" plugin, otherwise headers won't display in FirePHP
+     */
+    const PLUGIN_URI = 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3';
+
+    /**
+     * Header prefix for Wildfire to recognize & parse headers
+     */
+    const HEADER_PREFIX = 'X-Wf';
+
+    /**
+     * Whether or not Wildfire vendor-specific headers have been generated & sent yet
+     */
+    protected static $initialized = false;
+
+    /**
+     * Shared static message index between potentially multiple handlers
+     * @var int
+     */
+    protected static $messageIndex = 1;
+
+    protected $sendHeaders = true;
+
+    /**
+     * Base header creation function used by init headers & record headers
+     *
+     * @param  array  $meta    Wildfire Plugin, Protocol & Structure Indexes
+     * @param  string $message Log message
+     * @return array  Complete header string ready for the client as key and message as value
+     */
+    protected function createHeader(array $meta, $message)
+    {
+        $header = sprintf('%s-%s', self::HEADER_PREFIX, join('-', $meta));
+
+        return array($header => $message);
+    }
+
+    /**
+     * Creates message header from record
+     *
+     * @see createHeader()
+     * @param  array  $record
+     * @return string
+     */
+    protected function createRecordHeader(array $record)
+    {
+        // Wildfire is extensible to support multiple protocols & plugins in a single request,
+        // but we're not taking advantage of that (yet), so we're using "1" for simplicity's sake.
+        return $this->createHeader(
+            array(1, 1, 1, self::$messageIndex++),
+            $record'formatted'
+        );
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new WildfireFormatter();
+    }
+
+    /**
+     * Wildfire initialization headers to enable message parsing
+     *
+     * @see createHeader()
+     * @see sendHeader()
+     * @return array
+     */
+    protected function getInitHeaders()
+    {
+        // Initial payload consists of required headers for Wildfire
+        return array_merge(
+            $this->createHeader(array('Protocol', 1), self::PROTOCOL_URI),
+            $this->createHeader(array(1, 'Structure', 1), self::STRUCTURE_URI),
+            $this->createHeader(array(1, 'Plugin', 1), self::PLUGIN_URI)
+        );
+    }
+
+    /**
+     * Send header string to the client
+     *
+     * @param string $header
+     * @param string $content
+     */
+    protected function sendHeader($header, $content)
+    {
+        if (!headers_sent() && $this->sendHeaders) {
+            header(sprintf('%s: %s', $header, $content));
+        }
+    }
+
+    /**
+     * Creates & sends header for a record, ensuring init headers have been sent prior
+     *
+     * @see sendHeader()
+     * @see sendInitHeaders()
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        // WildFire-specific headers must be sent prior to any messages
+        if (!self::$initialized) {
+            $this->sendHeaders = $this->headersAccepted();
+
+            foreach ($this->getInitHeaders() as $header => $content) {
+                $this->sendHeader($header, $content);
+            }
+
+            self::$initialized = true;
+        }
+
+        $header = $this->createRecordHeader($record);
+        $this->sendHeader(key($header), current($header));
+    }
+
+    /**
+     * Verifies if the headers are accepted by the current user agent
+     *
+     * @return Boolean
+     */
+    protected function headersAccepted()
+    {
+        return !isset($_SERVER'HTTP_USER_AGENT')
+               || preg_match('{\bFirePHP/\d+\.\d+\b}', $_SERVER'HTTP_USER_AGENT')
+               || isset($_SERVER'HTTP_X_FIREPHP_VERSION');
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php Added

@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\IMessagePublisher;
+use Monolog\Logger;
+use Monolog\Handler\AbstractProcessingHandler;
+use Monolog\Formatter\GelfMessageFormatter;
+
+/**
+ * Handler to send messages to a Graylog2 (http://www.graylog2.org) server
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ */
+class GelfHandler extends AbstractProcessingHandler
+{
+    /**
+     * @var Gelf\IMessagePublisher the publisher object that sends the message to the server
+     */
+    protected $publisher;
+
+    /**
+     * @param Gelf\IMessagePublisher $publisher a publisher object
+     * @param integer                $level     The minimum logging level at which this handler will be triggered
+     * @param Boolean                $bubble    Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(IMessagePublisher $publisher, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        $this->publisher = $publisher;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        $this->publisher = null;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->publisher->publish($record'formatted');
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new GelfMessageFormatter();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php Added

@@ -0,0 +1,74 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Forwards records to multiple handlers
+ *
+ * @author Lenar Lõhmus <lenar@city.ee>
+ */
+class GroupHandler extends AbstractHandler
+{
+    protected $handlers;
+
+    /**
+     * @param array   $handlers Array of Handlers.
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(array $handlers, $bubble = true)
+    {
+        foreach ($handlers as $handler) {
+            if (!$handler instanceof HandlerInterface) {
+                throw new \InvalidArgumentException('The first argument of the GroupHandler must be an array of HandlerInterface instances.');
+            }
+        }
+
+        $this->handlers = $handlers;
+        $this->bubble = $bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        foreach ($this->handlers as $handler) {
+            if ($handler->isHandling($record)) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        foreach ($this->handlers as $handler) {
+            $handler->handle($record);
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        foreach ($this->handlers as $handler) {
+            $handler->handleBatch($records);
+        }
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php Added

@@ -0,0 +1,77 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * Interface that all Monolog Handlers must implement
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+interface HandlerInterface
+{
+    /**
+     * Checks whether the given record will be handled by this handler.
+     *
+     * This is mostly done for performance reasons, to avoid calling processors for nothing.
+     *
+     * @return Boolean
+     */
+    public function isHandling(array $record);
+
+    /**
+     * Handles a record.
+     *
+     * The return value of this function controls the bubbling process of the handler stack.
+     *
+     * @param  array   $record The record to handle
+     * @return Boolean True means that this handler handled the record, and that bubbling is not permitted.
+     *                 False means the record was either not processed or that this handler allows bubbling.
+     */
+    public function handle(array $record);
+
+    /**
+     * Handles a set of records at once.
+     *
+     * @param array $records The records to handle (an array of record arrays)
+     */
+    public function handleBatch(array $records);
+
+    /**
+     * Adds a processor in the stack.
+     *
+     * @param callable $callback
+     */
+    public function pushProcessor($callback);
+
+    /**
+     * Removes the processor on top of the stack and returns it.
+     *
+     * @return callable
+     */
+    public function popProcessor();
+
+    /**
+     * Sets the formatter.
+     *
+     * @param FormatterInterface $formatter
+     */
+    public function setFormatter(FormatterInterface $formatter);
+
+    /**
+     * Gets the formatter.
+     *
+     * @return FormatterInterface
+     */
+    public function getFormatter();
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php Added

@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base class for all mail handlers
+ *
+ * @author Gyula Sallai
+ */
+abstract class MailHandler extends AbstractProcessingHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $messages = array();
+
+        foreach ($records as $record) {
+            if ($record'level' < $this->level) {
+                continue;
+            }
+            $messages = $this->processRecord($record);
+        }
+
+        if (!empty($messages)) {
+            $this->send((string) $this->getFormatter()->formatBatch($messages), $messages);
+        }
+    }
+
+    /**
+     * Send a mail with the given content
+     *
+     * @param string $content
+     * @param array  $records the array of log records that formed this content
+     */
+    abstract protected function send($content, array $records);
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->send((string) $record'formatted', array($record));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php Added

@@ -0,0 +1,51 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Thomas Tourlourat <thomas@tourlourat.com>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+
+/**
+ * Logs to a MongoDB database.
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $mongodb = new MongoDBHandler(new \Mongo("mongodb://localhost:27017"), "logs", "prod");
+ *   $log->pushHandler($mongodb);
+ *
+ * @author Thomas Tourlourat <thomas@tourlourat.com>
+ */
+class MongoDBHandler extends AbstractProcessingHandler
+{
+    private $mongoCollection;
+
+    public function __construct(\Mongo $mongo, $database, $collection, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->mongoCollection = $mongo->selectCollection($database, $collection);
+
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        $this->mongoCollection->save($record"formatted");
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new NormalizerFormatter();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php Added

@@ -0,0 +1,65 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * NativeMailerHandler uses the mail() function to send the emails
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class NativeMailerHandler extends MailHandler
+{
+    protected $to;
+    protected $subject;
+    protected $headers = array(
+        'Content-type: text/plain; charset=utf-8'
+    );
+
+    /**
+     * @param string|array $to      The receiver of the mail
+     * @param string       $subject The subject of the mail
+     * @param string       $from    The sender of the mail
+     * @param integer      $level   The minimum logging level at which this handler will be triggered
+     * @param boolean      $bubble  Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($to, $subject, $from, $level = Logger::ERROR, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->to = is_array($to) ? $to : array($to);
+        $this->subject = $subject;
+        $this->headers = sprintf('From: %s', $from);
+    }
+
+    /**
+     * @param string|array $header Custom added headers
+     */
+    public function addHeader($headers)
+    {
+        if (is_array($headers)) {
+            $this->headers = array_merge($this->headers, $headers);
+        } else {
+            $this->headers = $headers;
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function send($content, array $records)
+    {
+        foreach ($this->to as $to) {
+            mail($to, $this->subject, wordwrap($content, 70), implode("\r\n", $this->headers) . "\r\n");
+        }
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php Added

@@ -0,0 +1,45 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Blackhole
+ *
+ * Any record it can handle will be thrown away. This can be used
+ * to put on top of an existing stack to override it temporarily.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NullHandler extends AbstractHandler
+{
+    /**
+     * @param integer $level The minimum logging level at which this handler will be triggered
+     */
+    public function __construct($level = Logger::DEBUG)
+    {
+        parent::__construct($level, false);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record'level' < $this->level) {
+            return false;
+        }
+
+        return true;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php Added

@@ -0,0 +1,109 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores logs to files that are rotated every day and a limited number of files are kept.
+ *
+ * This rotation is only intended to be used as a workaround. Using logrotate to
+ * handle the rotation is strongly encouraged when you can use it.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class RotatingFileHandler extends StreamHandler
+{
+    protected $filename;
+    protected $maxFiles;
+    protected $mustRotate;
+
+    /**
+     * @param string  $filename
+     * @param integer $maxFiles The maximal amount of files to keep (0 means unlimited)
+     * @param integer $level    The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($filename, $maxFiles = 0, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->filename = $filename;
+        $this->maxFiles = (int) $maxFiles;
+
+        $fileInfo = pathinfo($this->filename);
+        $timedFilename = $fileInfo'dirname'.'/'.$fileInfo'filename'.'-'.date('Y-m-d');
+        if (!empty($fileInfo'extension')) {
+            $timedFilename .= '.'.$fileInfo'extension';
+        }
+
+        // disable rotation upfront if files are unlimited
+        if (0 === $this->maxFiles) {
+            $this->mustRotate = false;
+        }
+
+        parent::__construct($timedFilename, $level, $bubble);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        parent::close();
+
+        if (true === $this->mustRotate) {
+            $this->rotate();
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        // on the first record written, if the log is new, we should rotate (once per day)
+        if (null === $this->mustRotate) {
+            $this->mustRotate = !file_exists($this->url);
+        }
+
+        parent::write($record);
+    }
+
+    /**
+     * Rotates the files.
+     */
+    protected function rotate()
+    {
+        $fileInfo = pathinfo($this->filename);
+        $glob = $fileInfo'dirname'.'/'.$fileInfo'filename'.'-*';
+        if (!empty($fileInfo'extension')) {
+            $glob .= '.'.$fileInfo'extension';
+        }
+        $iterator = new \GlobIterator($glob);
+        $count = $iterator->count();
+        if ($this->maxFiles >= $count) {
+            // no files to remove
+            return;
+        }
+
+        // Sorting the files by name to remove the older ones
+        $array = iterator_to_array($iterator);
+        usort($array, function($a, $b) {
+            return strcmp($b->getFilename(), $a->getFilename());
+        });
+
+        foreach (array_slice($array, $this->maxFiles) as $file) {
+            if ($file->isWritable()) {
+                unlink($file->getRealPath());
+            }
+        }
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php Added

@@ -0,0 +1,279 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any socket - uses fsockopen() or pfsockopen().
+ *
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ * @see    http://php.net/manual/en/function.fsockopen.php
+ */
+class SocketHandler extends AbstractProcessingHandler
+{
+    private $connectionString;
+    private $connectionTimeout;
+    private $resource;
+    private $timeout = 0;
+    private $persistent = false;
+    private $errno;
+    private $errstr;
+
+    /**
+     * @param string  $connectionString Socket connection string
+     * @param integer $level            The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble           Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($connectionString, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->connectionString = $connectionString;
+        $this->connectionTimeout = (float) ini_get('default_socket_timeout');
+    }
+
+    /**
+     * Connect (if necessary) and write to the socket
+     *
+     * @param array $record
+     *
+     * @throws \UnexpectedValueException
+     * @throws \RuntimeException
+     */
+    public function write(array $record)
+    {
+        $this->connectIfNotConnected();
+        $this->writeToSocket((string) $record'formatted');
+    }
+
+    /**
+     * We will not close a PersistentSocket instance so it can be reused in other requests.
+     */
+    public function close()
+    {
+        if (!$this->isPersistent()) {
+            $this->closeSocket();
+        }
+    }
+
+    /**
+     * Close socket, if open
+     */
+    public function closeSocket()
+    {
+        if (is_resource($this->resource)) {
+            fclose($this->resource);
+            $this->resource = null;
+        }
+    }
+
+    /**
+     * Set socket connection to nbe persistent. It only has effect before the connection is initiated.
+     *
+     * @param type $boolean
+     */
+    public function setPersistent($boolean)
+    {
+        $this->persistent = (boolean) $boolean;
+    }
+
+    /**
+     * Set connection timeout.  Only has effect before we connect.
+     *
+     * @param float $seconds
+     *
+     * @see http://php.net/manual/en/function.fsockopen.php
+     */
+    public function setConnectionTimeout($seconds)
+    {
+        $this->validateTimeout($seconds);
+        $this->connectionTimeout = (float) $seconds;
+    }
+
+    /**
+     * Set write timeout. Only has effect before we connect.
+     *
+     * @param float $seconds
+     *
+     * @see http://php.net/manual/en/function.stream-set-timeout.php
+     */
+    public function setTimeout($seconds)
+    {
+        $this->validateTimeout($seconds);
+        $this->timeout = (float) $seconds;
+    }
+
+    /**
+     * Get current connection string
+     *
+     * @return string
+     */
+    public function getConnectionString()
+    {
+        return $this->connectionString;
+    }
+
+    /**
+     * Get persistent setting
+     *
+     * @return boolean
+     */
+    public function isPersistent()
+    {
+        return $this->persistent;
+    }
+
+    /**
+     * Get current connection timeout setting
+     *
+     * @return float
+     */
+    public function getConnectionTimeout()
+    {
+        return $this->connectionTimeout;
+    }
+
+    /**
+     * Get current in-transfer timeout
+     *
+     * @return float
+     */
+    public function getTimeout()
+    {
+        return $this->timeout;
+    }
+
+    /**
+     * Check to see if the socket is currently available.
+     *
+     * UDP might appear to be connected but might fail when writing.  See http://php.net/fsockopen for details.
+     *
+     * @return boolean
+     */
+    public function isConnected()
+    {
+        return is_resource($this->resource)
+            && !feof($this->resource);  // on TCP - other party can close connection.
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function pfsockopen()
+    {
+        return @pfsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function fsockopen()
+    {
+        return @fsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     *
+     * @see http://php.net/manual/en/function.stream-set-timeout.php
+     */
+    protected function streamSetTimeout()
+    {
+        $seconds = floor($this->timeout);
+        $microseconds = round(($this->timeout - $seconds)*1e6);
+        
+        return stream_set_timeout($this->resource, $seconds, $microseconds);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php Added

@@ -0,0 +1,76 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any stream resource
+ *
+ * Can be used to store into php://stderr, remote and local files, etc.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class StreamHandler extends AbstractProcessingHandler
+{
+    protected $stream;
+    protected $url;
+
+    /**
+     * @param string  $stream
+     * @param integer $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($stream, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        if (is_resource($stream)) {
+            $this->stream = $stream;
+        } else {
+            $this->url = $stream;
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        if (is_resource($this->stream)) {
+            fclose($this->stream);
+        }
+        $this->stream = null;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        if (null === $this->stream) {
+            if (!$this->url) {
+                throw new \LogicException('Missing stream url, the stream can not be opened. This may be caused by a premature call to close().');
+            }
+            $errorMessage = null;
+            set_error_handler(function ($code, $msg) use (&$errorMessage) {
+                $errorMessage = preg_replace('{^fopen$.*?$: }', '', $msg);
+            });
+            $this->stream = fopen($this->url, 'a');
+            restore_error_handler();
+            if (!is_resource($this->stream)) {
+                $this->stream = null;
+                throw new \UnexpectedValueException(sprintf('The stream or file "%s" could not be opened: '.$errorMessage, $this->url));
+            }
+        }
+        fwrite($this->stream, (string) $record'formatted');
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php Added

@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * SwiftMailerHandler uses Swift_Mailer to send the emails
+ *
+ * @author Gyula Sallai
+ */
+class SwiftMailerHandler extends MailHandler
+{
+    protected $mailer;
+    protected $message;
+
+    /**
+     * @param \Swift_Mailer           $mailer  The mailer to use
+     * @param callback|\Swift_Message $message An example message for real messages, only the body will be replaced
+     * @param integer                 $level   The minimum logging level at which this handler will be triggered
+     * @param Boolean                 $bubble  Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(\Swift_Mailer $mailer, $message, $level = Logger::ERROR, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->mailer  = $mailer;
+        if (!$message instanceof \Swift_Message && is_callable($message)) {
+            $message = call_user_func($message);
+        }
+        if (!$message instanceof \Swift_Message) {
+            throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callback returning it');
+        }
+        $this->message = $message;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function send($content, array $records)
+    {
+        $message = clone $this->message;
+        $message->setBody($content);
+
+        $this->mailer->send($message);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php Added

@@ -0,0 +1,121 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+
+/**
+ * Logs to syslog service.
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $syslog = new SyslogHandler('myfacility', 'local6');
+ *   $formatter = new LineFormatter("%channel%.%level_name%: %message% %extra%");
+ *   $syslog->setFormatter($formatter);
+ *   $log->pushHandler($syslog);
+ *
+ * @author Sven Paulus <sven@karlsruhe.org>
+ */
+class SyslogHandler extends AbstractProcessingHandler
+{
+    /**
+     * Translates Monolog log levels to syslog log priorities.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => LOG_DEBUG,
+        Logger::INFO      => LOG_INFO,
+        Logger::NOTICE    => LOG_NOTICE,
+        Logger::WARNING   => LOG_WARNING,
+        Logger::ERROR     => LOG_ERR,
+        Logger::CRITICAL  => LOG_CRIT,
+        Logger::ALERT     => LOG_ALERT,
+        Logger::EMERGENCY => LOG_EMERG,
+    );
+
+    /**
+     * List of valid log facility names.
+     */
+    private $facilities = array(
+        'auth'     => LOG_AUTH,
+        'authpriv' => LOG_AUTHPRIV,
+        'cron'     => LOG_CRON,
+        'daemon'   => LOG_DAEMON,
+        'kern'     => LOG_KERN,
+        'lpr'      => LOG_LPR,
+        'mail'     => LOG_MAIL,
+        'news'     => LOG_NEWS,
+        'syslog'   => LOG_SYSLOG,
+        'user'     => LOG_USER,
+        'uucp'     => LOG_UUCP,
+    );
+
+    /**
+     * @param string  $ident
+     * @param mixed   $facility
+     * @param integer $level    The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     * @param int     $logopts  Option flags for the openlog() call, defaults to LOG_PID
+     */
+    public function __construct($ident, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true, $logopts = LOG_PID)
+    {
+        parent::__construct($level, $bubble);
+
+        if (!defined('PHP_WINDOWS_VERSION_BUILD')) {
+            $this->facilities'local0' = LOG_LOCAL0;
+            $this->facilities'local1' = LOG_LOCAL1;
+            $this->facilities'local2' = LOG_LOCAL2;
+            $this->facilities'local3' = LOG_LOCAL3;
+            $this->facilities'local4' = LOG_LOCAL4;
+            $this->facilities'local5' = LOG_LOCAL5;
+            $this->facilities'local6' = LOG_LOCAL6;
+            $this->facilities'local7' = LOG_LOCAL7;
+        }
+
+        // convert textual description of facility to syslog constant
+        if (array_key_exists(strtolower($facility), $this->facilities)) {
+            $facility = $this->facilitiesstrtolower($facility);
+        } elseif (!in_array($facility, array_values($this->facilities), true)) {
+            throw new \UnexpectedValueException('Unknown facility value "'.$facility.'" given');
+        }
+
+        if (!openlog($ident, $logopts, $facility)) {
+            throw new \LogicException('Can\'t open syslog for ident "'.$ident.'" and facility "'.$facility.'"');
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        closelog();
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        syslog($this->logLevels$record'level', (string) $record'formatted');
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter('%channel%.%level_name%: %message% %context% %extra%\n');
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php Added

@@ -0,0 +1,140 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Used for testing purposes.
+ *
+ * It records all records and gives you access to them for verification.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class TestHandler extends AbstractProcessingHandler
+{
+    protected $records = array();
+    protected $recordsByLevel = array();
+
+    public function getRecords()
+    {
+        return $this->records;
+    }
+
+    public function hasEmergency($record)
+    {
+        return $this->hasRecord($record, Logger::EMERGENCY);
+    }
+
+    public function hasAlert($record)
+    {
+        return $this->hasRecord($record, Logger::ALERT);
+    }
+
+    public function hasCritical($record)
+    {
+        return $this->hasRecord($record, Logger::CRITICAL);
+    }
+
+    public function hasError($record)
+    {
+        return $this->hasRecord($record, Logger::ERROR);
+    }
+
+    public function hasWarning($record)
+    {
+        return $this->hasRecord($record, Logger::WARNING);
+    }
+
+    public function hasNotice($record)
+    {
+        return $this->hasRecord($record, Logger::NOTICE);
+    }
+
+    public function hasInfo($record)
+    {
+        return $this->hasRecord($record, Logger::INFO);
+    }
+
+    public function hasDebug($record)
+    {
+        return $this->hasRecord($record, Logger::DEBUG);
+    }
+
+    public function hasEmergencyRecords()
+    {
+        return isset($this->recordsByLevelLogger::EMERGENCY);
+    }
+
+    public function hasAlertRecords()
+    {
+        return isset($this->recordsByLevelLogger::ALERT);
+    }
+
+    public function hasCriticalRecords()
+    {
+        return isset($this->recordsByLevelLogger::CRITICAL);
+    }
+
+    public function hasErrorRecords()
+    {
+        return isset($this->recordsByLevelLogger::ERROR);
+    }
+
+    public function hasWarningRecords()
+    {
+        return isset($this->recordsByLevelLogger::WARNING);
+    }
+
+    public function hasNoticeRecords()
+    {
+        return isset($this->recordsByLevelLogger::NOTICE);
+    }
+
+    public function hasInfoRecords()
+    {
+        return isset($this->recordsByLevelLogger::INFO);
+    }
+
+    public function hasDebugRecords()
+    {
+        return isset($this->recordsByLevelLogger::DEBUG);
+    }
+
+    protected function hasRecord($record, $level)
+    {
+        if (!isset($this->recordsByLevel$level)) {
+            return false;
+        }
+
+        if (is_array($record)) {
+            $record = $record'message';
+        }
+
+        foreach ($this->recordsByLevel$level as $rec) {
+            if ($rec'message' === $record) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->recordsByLevel$record'level' = $record;
+        $this->records = $record;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Logger.php Added

@@ -0,0 +1,466 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\HandlerInterface;
+use Monolog\Handler\StreamHandler;
+
+/**
+ * Monolog log channel
+ *
+ * It contains a stack of Handlers and a stack of Processors,
+ * and uses them to store records that are added to it.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class Logger
+{
+    /**
+     * Detailed debug information
+     */
+    const DEBUG = 100;
+
+    /**
+     * Interesting events
+     *
+     * Examples: User logs in, SQL logs.
+     */
+    const INFO = 200;
+
+    /**
+     * Uncommon events
+     */
+    const NOTICE = 250;
+
+    /**
+     * Exceptional occurrences that are not errors
+     *
+     * Examples: Use of deprecated APIs, poor use of an API,
+     * undesirable things that are not necessarily wrong.
+     */
+    const WARNING = 300;
+
+    /**
+     * Runtime errors
+     */
+    const ERROR = 400;
+
+    /**
+     * Critical conditions
+     *
+     * Example: Application component unavailable, unexpected exception.
+     */
+    const CRITICAL = 500;
+
+    /**
+     * Action must be taken immediately
+     *
+     * Example: Entire website down, database unavailable, etc.
+     * This should trigger the SMS alerts and wake you up.
+     */
+    const ALERT = 550;
+
+    /**
+     * Urgent alert.
+     */
+    const EMERGENCY = 600;
+
+    protected static $levels = array(
+        100 => 'DEBUG',
+        200 => 'INFO',
+        250 => 'NOTICE',
+        300 => 'WARNING',
+        400 => 'ERROR',
+        500 => 'CRITICAL',
+        550 => 'ALERT',
+        600 => 'EMERGENCY',
+    );
+
+    /**
+     * @var DateTimeZone
+     */
+    protected static $timezone;
+
+    protected $name;
+
+    /**
+     * The handler stack
+     *
+     * @var array of Monolog\Handler\HandlerInterface
+     */
+    protected $handlers = array();
+
+    protected $processors = array();
+
+    /**
+     * @param string $name The logging channel
+     */
+    public function __construct($name)
+    {
+        $this->name = $name;
+
+        if (!self::$timezone) {
+            self::$timezone = new \DateTimeZone(date_default_timezone_get() ?: 'UTC');
+        }
+    }
+
+    /**
+     * @return string
+     */
+    public function getName()
+    {
+        return $this->name;
+    }
+
+    /**
+     * Pushes a handler on to the stack.
+     *
+     * @param HandlerInterface $handler
+     */
+    public function pushHandler(HandlerInterface $handler)
+    {
+        array_unshift($this->handlers, $handler);
+    }
+
+    /**
+     * Pops a handler from the stack
+     *
+     * @return HandlerInterface
+     */
+    public function popHandler()
+    {
+        if (!$this->handlers) {
+            throw new \LogicException('You tried to pop from an empty handler stack.');
+        }
+
+        return array_shift($this->handlers);
+    }
+
+    /**
+     * Adds a processor on to the stack.
+     *
+     * @param callable $callback
+     */
+    public function pushProcessor($callback)
+    {
+        if (!is_callable($callback)) {
+            throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+        }
+        array_unshift($this->processors, $callback);
+    }
+
+    /**
+     * Removes the processor on top of the stack and returns it.
+     *
+     * @return callable
+     */
+    public function popProcessor()
+    {
+        if (!$this->processors) {
+            throw new \LogicException('You tried to pop from an empty processor stack.');
+        }
+
+        return array_shift($this->processors);
+    }
+
+    /**
+     * Adds a log record.
+     *
+     * @param  integer $level   The logging level
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addRecord($level, $message, array $context = array())
+    {
+        if (!$this->handlers) {
+            $this->pushHandler(new StreamHandler('php://stderr', self::DEBUG));
+        }
+        $record = array(
+            'message' => (string) $message,
+            'context' => $context,
+            'level' => $level,
+            'level_name' => self::getLevelName($level),
+            'channel' => $this->name,
+            'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true)))->setTimeZone(self::$timezone),
+            'extra' => array(),
+        );
+        // check if any message will handle this message
+        $handlerKey = null;
+        foreach ($this->handlers as $key => $handler) {

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Processor Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php Added

@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects line/file:class/function where the log message came from
+ *
+ * Warning: This only works if the handler processes the logs directly.
+ * If you put the processor on a handler that is behind a FingersCrossedHandler
+ * for example, the processor will only be called once the trigger level is reached,
+ * and all the log records will have the same file/line/.. data from the call that
+ * triggered the FingersCrossedHandler.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class IntrospectionProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $trace = debug_backtrace();
+
+        // skip first since it's always the current method
+        array_shift($trace);
+        // the call_user_func call is also skipped
+        array_shift($trace);
+
+        $i = 0;
+        while (isset($trace$i'class') && false !== strpos($trace$i'class', 'Monolog\\')) {
+            $i++;
+        }
+
+        // we should have the call source now
+        $record'extra' = array_merge(
+            $record'extra',
+            array(
+                'file'      => isset($trace$i-1'file') ? $trace$i-1'file' : null,
+                'line'      => isset($trace$i-1'line') ? $trace$i-1'line' : null,
+                'class'     => isset($trace$i'class') ? $trace$i'class' : null,
+                'function'  => isset($trace$i'function') ? $trace$i'function' : null,
+            )
+        );
+
+        return $record;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php Added

@@ -0,0 +1,50 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Some methods that are common for all memory processors
+ *
+ * @author Rob Jensen
+ */
+abstract class MemoryProcessor
+{
+    protected $realUsage;
+
+    /**
+     * @param boolean $realUsage
+     */
+    public function __construct($realUsage = true)
+    {
+        $this->realUsage = (boolean) $realUsage;
+    }
+
+    /**
+     * Formats bytes into a human readable string
+     *
+     * @param  int    $bytes
+     * @return string
+     */
+    protected static function formatBytes($bytes)
+    {
+        $bytes = (int) $bytes;
+
+        if ($bytes > 1024*1024) {
+            return round($bytes/1024/1024, 2).' MB';
+        } elseif ($bytes > 1024) {
+            return round($bytes/1024, 2).' KB';
+        }
+
+        return $bytes . ' B';
+    }
+
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php Added

@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects url/method and remote IP of the current web request in all records
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class WebProcessor
+{
+    protected $serverData;
+
+    /**
+     * @param mixed $serverData array or object w/ ArrayAccess that provides access to the $_SERVER data
+     */
+    public function __construct($serverData = null)
+    {
+        if (null === $serverData) {
+            $this->serverData =& $_SERVER;
+        } elseif (is_array($serverData) || $serverData instanceof \ArrayAccess) {
+            $this->serverData = $serverData;
+        } else {
+            throw new \UnexpectedValueException('$serverData must be an array or object implementing ArrayAccess.');
+        }
+    }
+
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        // skip processing if for some reason request data
+        // is not present (CLI or wonky SAPIs)
+        if (!isset($this->serverData'REQUEST_URI')) {
+            return $record;
+        }
+
+        if (!isset($this->serverData'HTTP_REFERER')) {
+            $this->serverData'HTTP_REFERER' = null;
+        }
+
+        $record'extra' = array_merge(
+            $record'extra',
+            array(
+                'url'         => $this->serverData'REQUEST_URI',
+                'ip'          => $this->serverData'REMOTE_ADDR',
+                'http_method' => $this->serverData'REQUEST_METHOD',
+                'server'      => $this->serverData'SERVER_NAME',
+                'referrer'    => $this->serverData'HTTP_REFERER',
+            )
+        );
+
+        return $record;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Formatter Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php Added

@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'unknown',
+                'error'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::CRITICAL,
+            'level_name' => 'CRITICAL',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'test : 14',
+                'error'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::DEBUG,
+            'level_name' => 'DEBUG',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                'log',
+                'unknown',
+                'log'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
+     */
+    public function testBatchFormatThrowException()
+    {
+        $formatter = new ChromePHPFormatter();
+        $records = array(
+            array(
+                'level' => Logger::INFO,
+                'level_name' => 'INFO',
+                'channel' => 'meh',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log',
+            ),
+            array(
+                'level' => Logger::WARNING,
+                'level_name' => 'WARNING',
+                'channel' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log2',
+            ),
+        );
+
+        $this->assertEquals(
+            array(
+                array(
+                    'meh',
+                    'log',
+                    'unknown',
+                    'info'
+                ),
+                array(
+                    'foo',
+                    'log2',
+                    'unknown',
+                    'warn'
+                ),
+            ),
+            $formatter->formatBatch($records)
+        );
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php Added

@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Gelf\Message")) {
+            $this->markTestSkipped("mlehner/gelf-php not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testDefaultFormatter()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals(0, $message->getTimestamp());
+        $this->assertEquals('log', $message->getShortMessage());
+        $this->assertEquals('meh', $message->getFacility());
+        $this->assertEquals(null, $message->getLine());
+        $this->assertEquals(null, $message->getFile());
+        $this->assertEquals(LOG_ERR, $message->getLevel());
+        $this->assertNotEmpty($message->getHost());
+
+        $formatter = new GelfMessageFormatter('mysystem');
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('mysystem', $message->getHost());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('test', $message->getFile());
+        $this->assertEquals(14, $message->getLine());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithContext()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_ctxt_from', $message_array);
+        $this->assertEquals('logger', $message_array'_ctxt_from');
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, null, 'CTX');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_CTXfrom', $message_array);
+        $this->assertEquals('logger', $message_array'_CTXfrom');
+
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithExtra()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_key', $message_array);
+        $this->assertEquals('pair', $message_array'_key');
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, 'EXT');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_EXTkey', $message_array);
+        $this->assertEquals('pair', $message_array'_EXTkey');
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php Added

@@ -0,0 +1,41 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class JsonFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new JsonFormatter();
+        $record = $this->getRecord();
+        $this->assertEquals(json_encode($record), $formatter->format($record));
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::formatBatch
+     */
+    public function testFormatBatch()
+    {
+        $formatter = new JsonFormatter();
+        $records = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        $this->assertEquals(json_encode($records), $formatter->formatBatch($records));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php Added

@@ -0,0 +1,132 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\LineFormatter
+ */
+class LineFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function testDefFormatWithString()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'WARNING',
+            'channel' => 'log',
+            'context' => array(),
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+        $this->assertEquals(''.date('Y-m-d').' log.WARNING: foo  '."\n", $message);
+    }
+
+    public function testDefFormatWithArrayContext()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            )
+        ));
+        $this->assertEquals(''.date('Y-m-d').' meh.ERROR: foo {"foo":"bar","baz":"qux"} '."\n", $message);
+    }
+
+    public function testDefFormatExtras()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        ));
+        $this->assertEquals(''.date('Y-m-d').' meh.ERROR: log  {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testFormatExtras()
+    {
+        $formatter = new LineFormatter("%datetime% %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
+            'message' => 'log',
+        ));
+        $this->assertEquals(''.date('Y-m-d').' meh.ERROR: log  test {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testDefFormatWithObject()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'message' => 'foobar',
+        ));
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            $this->assertEquals(''.date('Y-m-d').' meh.ERROR: foobar  {"foo":"object (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"object (Monolog\\\\Formatter\\\\TestBar: {})","baz":,"res":"resource"}'."\n", $message);
+        } else {
+            $this->assertEquals(''.date('Y-m-d').' meh.ERROR: foobar  {"foo":"object (Monolog\\Formatter\\TestFoo: {"foo":"foo"})","bar":"object (Monolog\\Formatter\\TestBar: {})","baz":,"res":"resource"}'."\n", $message);
+        }
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals(''.date('Y-m-d').' test.CRITICAL: bar  '."\n".''.date('Y-m-d').' log.WARNING: foo  '."\n", $message);
+    }
+}
+
+class TestFoo
+{
+    public $foo = 'foo';
+}
+
+class TestBar
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php Added

@@ -0,0 +1,105 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\NormalizerFormatter
+ */
+class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function testFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            )
+        ));
+
+        $this->assertEquals(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => date('Y-m-d'),
+            'extra' => array(
+                'foo' => 'object (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
+                'bar' => 'object (Monolog\\Formatter\\TestBarNorm: {})',
+                'baz' => array(),
+                'res' => 'resource',
+            ),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            )
+        ), $formatted);
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+        ), $formatted);
+    }
+}
+
+class TestFooNorm
+{
+    public $foo = 'foo';
+}
+
+class TestBarNorm
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php Added

@@ -0,0 +1,111 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '125|{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '129|{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '58|{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::formatBatch
+     * @expectedException BadMethodCallException
+     */
+    public function testBatchFormatThrowException()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $wildfire->formatBatch(array($record));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Functional Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Functional/Handler Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php Added

@@ -0,0 +1,104 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\WebProcessor;
+
+class AbstractHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractHandler::__construct
+     * @covers Monolog\Handler\AbstractHandler::getLevel
+     * @covers Monolog\Handler\AbstractHandler::setLevel
+     * @covers Monolog\Handler\AbstractHandler::getBubble
+     * @covers Monolog\Handler\AbstractHandler::setBubble
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::setFormatter
+     */
+    public function testConstructAndGetSet()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertEquals(Logger::WARNING, $handler->getLevel());
+        $this->assertEquals(false, $handler->getBubble());
+
+        $handler->setLevel(Logger::ERROR);
+        $handler->setBubble(true);
+        $handler->setFormatter($formatter = new LineFormatter);
+        $this->assertEquals(Logger::ERROR, $handler->getLevel());
+        $this->assertEquals(true, $handler->getBubble());
+        $this->assertSame($formatter, $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $handler->expects($this->exactly(2))
+            ->method('handle');
+        $handler->handleBatch(array($this->getRecord(), $this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->isHandling($this->getRecord()));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
+     */
+    public function testGetFormatterInitializesDefault()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @covers Monolog\Handler\AbstractHandler::popProcessor
+     * @expectedException LogicException
+     */
+    public function testPushPopProcessor()
+    {
+        $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+
+        $logger->pushProcessor($processor1);
+        $logger->pushProcessor($processor2);
+
+        $this->assertEquals($processor2, $logger->popProcessor());
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $logger->popProcessor();
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @expectedException InvalidArgumentException
+     */
+    public function testPushProcessorWithNonCallable()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+
+        $handler->pushProcessor(new \stdClass());
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php Added

@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Processor\WebProcessor;
+
+class AbstractProcessingHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleLowerLevelMessage()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
+        $this->assertFalse($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleNotBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleIsFalseWhenNotHandled()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::processRecord
+     */
+    public function testProcessRecord()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
+        $handler->pushProcessor(new WebProcessor(array(
+            'REQUEST_URI' => '',
+            'REQUEST_METHOD' => '',
+            'REMOTE_ADDR' => '',
+            'SERVER_NAME' => '',
+        )));
+        $handledRecord = null;
+        $handler->expects($this->once())
+            ->method('write')
+            ->will($this->returnCallback(function($record) use (&$handledRecord){
+                $handledRecord = $record;
+            }))
+        ;
+        $handler->handle($this->getRecord());
+        $this->assertEquals(5, count($handledRecord'extra'));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/AmqpExchangeMock.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php Added

@@ -0,0 +1,74 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class AmqpHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
+            $this->markTestSkipped("amqp-php not installed");
+        }
+
+        if (!class_exists('AMQPChannel')) {
+            $this->markTestSkipped("Please update AMQP to version >= 1.0");
+        }
+    }
+
+    public function testHandle()
+    {
+        $exchange = $this->getExchange();
+
+        $handler = new AmqpHandler($exchange, 'log');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            array(
+                'message' => 'test',
+                'context' => array(
+                    'data' => array(),
+                    'foo' => 34,
+                ),
+                'level' => 300,
+                'level_name' => 'WARNING',
+                'channel' => 'test',
+                'extra' => array(),
+            ),
+            'warn.test',
+            0,
+            array(
+                'delivery_mode' => 2,
+                'Content-type' => 'application/json'
+            )
+        );
+
+        $handler->handle($record);
+
+        $messages = $exchange->getMessages();
+        $this->assertCount(1, $messages);
+        $messages00 = json_decode($messages00, true);
+        unset($messages00'datetime');
+        $this->assertEquals($expected, $messages0);
+    }
+
+    protected function getExchange()
+    {
+        return new AmqpExchangeMock();
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php Added

@@ -0,0 +1,84 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class BufferHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\BufferHandler::__construct
+     * @covers Monolog\Handler\BufferHandler::handle
+     * @covers Monolog\Handler\BufferHandler::close
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->close();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 2);
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::close
+     */
+    public function testDestructPropagatesRecords()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->__destruct();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleLevel()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 0, Logger::INFO);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php Added

@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\ChromePHPHandler
+ */
+class ChromePHPHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        TestChromePHPHandler::reset();
+    }
+
+    public function testHeaders()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromePhp-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestChromePHPHandler();
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromePhp-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler2->getHeaders());
+    }
+}
+
+class TestChromePHPHandler extends ChromePHPHandler
+{
+    protected $headers = array();
+
+    public static function reset()
+    {
+        self::$initialized = false;
+        self::$json'rows' = array();
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers$header = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php Added

@@ -0,0 +1,151 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+
+class FingersCrossedHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleStopsBufferingAfterTrigger()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::reset
+     */
+    public function testHandleRestartBufferingAfterReset()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->reset();
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleWithCallback()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler(function($record, $handler) use ($test) {
+                    return $test;
+                });
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @expectedException RuntimeException
+     */
+    public function testHandleWithBadCallbackThrowsException()
+    {
+        $handler = new FingersCrossedHandler(function($record, $handler) {
+                    return 'foo';
+                });
+        $handler->handle($this->getRecord(Logger::WARNING));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::isHandling
+     */
+    public function testIsHandlingAlways()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::ERROR);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     */
+    public function testActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php Added

@@ -0,0 +1,94 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\FirePHPHandler
+ */
+class FirePHPHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        TestFirePHPHandler::reset();
+    }
+
+    public function testHeaders()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestFirePHPHandler;
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $expected2 = array(
+            'X-Wf-1-1-1-3'       => 'test',
+            'X-Wf-1-1-1-4'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+        $this->assertEquals($expected2, $handler2->getHeaders());
+    }
+}
+
+class TestFirePHPHandler extends FirePHPHandler
+{
+    protected $headers = array();
+
+    public static function reset()
+    {
+        self::$initialized = false;
+        self::$messageIndex = 1;
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers$header = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/Fixtures Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/Fixtures/.gitkeep Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php Added

@@ -0,0 +1,94 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Gelf\MessagePublisher") || !class_exists("Gelf\Message")) {
+            $this->markTestSkipped("mlehner/gelf-php not installed");
+        }
+
+        require_once __DIR__ . '/GelfMocks.php';
+    }
+
+    /**
+     * @covers Monolog\Handler\GelfHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new GelfHandler($this->getMessagePublisher());
+        $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+    }
+
+    protected function getHandler($messagePublisher)
+    {
+        $handler = new GelfHandler($messagePublisher);
+
+        return $handler;
+    }
+
+    protected function getMessagePublisher()
+    {
+        return new MockMessagePublisher('localhost');
+    }
+
+    public function testDebug()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $handler->handle($record);
+
+        $this->assertEquals(LOG_DEBUG, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record'message', $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testWarning()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $handler->handle($record);
+
+        $this->assertEquals(LOG_WARNING, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record'message', $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testInjectedGelfMessageFormatter()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $record'extra''blarg' = 'yep';
+        $record'context''from' = 'logger';
+        $handler->handle($record);
+
+        $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost());
+        $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray());
+        $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray());
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/GelfMocks.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php Added

@@ -0,0 +1,71 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class GroupHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorOnlyTakesHandler()
+    {
+        new GroupHandler(array(new TestHandler(), "foo"));
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandle()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+        $handler = new GroupHandler($testHandlers);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php Added

@@ -0,0 +1,75 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class MailHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())
+            ->method('formatBatch'); // Each record is formatted
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->once())
+            ->method('send');
+        $handler->expects($this->never())
+            ->method('write'); // write is for individual records
+
+        $handler->setFormatter($formatter);
+
+        $handler->handleBatch($this->getMultipleRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+        );
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->never())
+            ->method('send');
+        $handler->setLevel(Logger::ERROR);
+
+        $handler->handleBatch($records);
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::write
+     */
+    public function testHandle()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+
+        $record = $this->getRecord();
+        $records = array($record);
+        $records0'formatted' = ''.$record'datetime'->format('Y-m-d H:i:s').' test.WARNING: test  '."\n";
+
+        $handler->expects($this->once())
+            ->method('send')
+            ->with($records0'formatted', $records);
+
+        $handler->handle($record);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php Added

@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class MongoDBHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $mongo = $this->getMock('Mongo', array('selectCollection'));
+        $collection = $this->getMock('stdClass', array('save'));
+
+        $mongo->expects($this->once())
+            ->method('selectCollection')
+            ->with('DB', 'Collection')
+            ->will($this->returnValue($collection));
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => 'object (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record'datetime'->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $collection->expects($this->once())
+            ->method('save')
+            ->with($expected);
+
+        $handler = new MongoDBHandler($mongo, 'DB', 'Collection');
+        $handler->handle($record);
+    }
+}
+
+if (!class_exists('Mongo')) {
+    class Mongo
+    {
+        public function selectCollection() {}
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php Added

@@ -0,0 +1,99 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class RotatingFileHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        $dir = __DIR__.'/Fixtures';
+        chmod($dir, 0777);
+        if (!is_writable($dir)) {
+            $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.');
+        }
+    }
+
+    public function testRotationCreatesNewFile()
+    {
+        touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        $this->assertTrue(file_exists($log));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    /**
+     * @dataProvider rotationTests
+     */
+    public function testRotation($createFile)
+    {
+        touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+        touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot');
+        touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot');
+        touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot');
+
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+
+        if ($createFile) {
+            touch($log);
+        }
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+
+        $handler->close();
+
+        $this->assertTrue(file_exists($log));
+        $this->assertTrue(file_exists($old1));
+        $this->assertEquals($createFile, file_exists($old2));
+        $this->assertEquals($createFile, file_exists($old3));
+        $this->assertEquals($createFile, file_exists($old4));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    public function rotationTests()
+    {
+        return array(
+            'Rotation is triggered when the file of the current day is not present'
+                => array(true),
+            'Rotation is not triggered when the file is already present'
+                => array(false),
+        );
+    }
+
+    public function testReuseCurrentFile()
+    {
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        file_put_contents($log, "foo");
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+        $this->assertEquals('footest', file_get_contents($log));
+    }
+
+    public function tearDown()
+    {
+        foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) {
+            unlink($file);
+        }
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php Added

@@ -0,0 +1,283 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ */
+class SocketHandlerTest extends TestCase
+{
+    /**
+     * @var Monolog\Handler\SocketHandler
+     */
+    private $handler;
+
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testInvalidHostname()
+    {
+        $this->createHandler('garbage://here');
+        $this->writeRecord('data');
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(-1);
+    }
+
+    public function testSetConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(10.1);
+        $this->assertEquals(10.1, $this->handler->getConnectionTimeout());
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(-1);
+    }
+
+    public function testSetTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(10.25);
+        $this->assertEquals(10.25, $this->handler->getTimeout());
+    }
+
+    public function testSetConnectionString()
+    {
+        $this->createHandler('tcp://localhost:9090');
+        $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnFsockopenError()
+    {
+        $this->setMockHandler(array('fsockopen'));
+        $this->handler->expects($this->once())
+            ->method('fsockopen')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnPfsockopenError()
+    {
+        $this->setMockHandler(array('pfsockopen'));
+        $this->handler->expects($this->once())
+            ->method('pfsockopen')
+            ->will($this->returnValue(false));
+        $this->handler->setPersistent(true);
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownIfCannotSetTimeout()
+    {
+        $this->setMockHandler(array('streamSetTimeout'));
+        $this->handler->expects($this->once())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIfFwriteReturnsFalse()
+    {
+        $this->setMockHandler(array('fwrite'));
+
+        $callback = function($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => false,
+            );
+
+            return $map$arg;
+        };
+
+        $this->handler->expects($this->exactly(2))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsIfStreamTimesOut()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $callback = function($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => 5,
+            );
+
+            return $map$arg;
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => true)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIncompleteWrite()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $res = $this->res;
+        $callback = function($string) use ($res) {
+            fclose($res);
+
+            return strlen('Hello');
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => false)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    public function testWriteWithMemoryFile()
+    {
+        $this->setMockHandler();
+        $this->writeRecord('test1');
+        $this->writeRecord('test2');
+        $this->writeRecord('test3');
+        fseek($this->res, 0);
+        $this->assertEquals('test1test2test3', fread($this->res, 1024));
+    }
+
+    public function testWriteWithMock()

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php Added

@@ -0,0 +1,88 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class StreamHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWrite()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test2'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test3'));
+        fseek($handle, 0);
+        $this->assertEquals('testtest2test3', fread($handle, 100));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::close
+     */
+    public function testClose()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $this->assertTrue(is_resource($handle));
+        $handler->close();
+        $this->assertFalse(is_resource($handle));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteCreatesTheStreamResource()
+    {
+        $handler = new StreamHandler('php://memory');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException LogicException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteMissingResource()
+    {
+        $handler = new StreamHandler(null);
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteInvalidResource()
+    {
+        $handler = new StreamHandler('bogus://url');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingResource()
+    {
+        $handler = new StreamHandler('/foo/bar/baz/'.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php Added

@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+use Monolog\Logger;
+
+class SyslogHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new SyslogHandler('test');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', 'user');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+    }
+
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstructInvalidFacility()
+    {
+        $this->setExpectedException('UnexpectedValueException');
+        $handler = new SyslogHandler('test', 'unknown');
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php Added

@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\TestHandler
+ */
+class TestHandlerTest extends TestCase
+{
+    /**
+     * @dataProvider methodProvider
+     */
+    public function testHandler($method, $level)
+    {
+        $handler = new TestHandler;
+        $record = $this->getRecord($level, 'test'.$method);
+        $this->assertFalse($handler->{'has'.$method}($record));
+        $this->assertFalse($handler->{'has'.$method.'Records'}());
+        $handler->handle($record);
+
+        $this->assertFalse($handler->{'has'.$method}('bar'));
+        $this->assertTrue($handler->{'has'.$method}($record));
+        $this->assertTrue($handler->{'has'.$method}('test'.$method));
+        $this->assertTrue($handler->{'has'.$method.'Records'}());
+
+        $records = $handler->getRecords();
+        unset($records0'formatted');
+        $this->assertEquals(array($record), $records);
+    }
+
+    public function methodProvider()
+    {
+        return array(
+            array('Emergency', Logger::EMERGENCY),
+            array('Alert'    , Logger::ALERT),
+            array('Critical' , Logger::CRITICAL),
+            array('Error'    , Logger::ERROR),
+            array('Warning'  , Logger::WARNING),
+            array('Info'     , Logger::INFO),
+            array('Notice'   , Logger::NOTICE),
+            array('Debug'    , Logger::DEBUG),
+        );
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/LoggerTest.php Added

@@ -0,0 +1,372 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Processor\WebProcessor;
+use Monolog\Handler\TestHandler;
+
+class LoggerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Logger::getName
+     */
+    public function testGetName()
+    {
+        $logger = new Logger('foo');
+        $this->assertEquals('foo', $logger->getName());
+    }
+
+    /**
+     * @covers Monolog\Logger::__construct
+     */
+    public function testChannel()
+    {
+        $logger = new Logger('foo');
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->addWarning('test');
+        list($record) = $handler->getRecords();
+        $this->assertEquals('foo', $record'channel');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testLog()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'));
+        $handler->expects($this->once())
+            ->method('handle');
+        $logger->pushHandler($handler);
+
+        $this->assertTrue($logger->addWarning('test'));
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testLogNotHandled()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR));
+        $handler->expects($this->never())
+            ->method('handle');
+        $logger->pushHandler($handler);
+
+        $this->assertFalse($logger->addWarning('test'));
+    }
+
+    /**
+     * @covers Monolog\Logger::pushHandler
+     * @covers Monolog\Logger::popHandler
+     * @expectedException LogicException
+     */
+    public function testPushPopHandler()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler1 = new TestHandler;
+        $handler2 = new TestHandler;
+
+        $logger->pushHandler($handler1);
+        $logger->pushHandler($handler2);
+
+        $this->assertEquals($handler2, $logger->popHandler());
+        $this->assertEquals($handler1, $logger->popHandler());
+        $logger->popHandler();
+    }
+
+    /**
+     * @covers Monolog\Logger::pushProcessor
+     * @covers Monolog\Logger::popProcessor
+     * @expectedException LogicException
+     */
+    public function testPushPopProcessor()
+    {
+        $logger = new Logger(__METHOD__);
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+
+        $logger->pushProcessor($processor1);
+        $logger->pushProcessor($processor2);
+
+        $this->assertEquals($processor2, $logger->popProcessor());
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $logger->popProcessor();
+    }
+
+    /**
+     * @covers Monolog\Logger::pushProcessor
+     * @expectedException InvalidArgumentException
+     */
+    public function testPushProcessorWithNonCallable()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $logger->pushProcessor(new \stdClass());
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsAreExecuted()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->pushProcessor(function($record) {
+            $record'extra''win' = true;
+
+            return $record;
+        });
+        $logger->addError('test');
+        list($record) = $handler->getRecords();
+        $this->assertTrue($record'extra''win');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsAreCalledOnlyOnce()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler->expects($this->any())
+            ->method('handle')
+            ->will($this->returnValue(true))
+        ;
+        $logger->pushHandler($handler);
+
+        $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor')
+            ->disableOriginalConstructor()
+            ->setMethods(array('__invoke'))
+            ->getMock()
+        ;
+        $processor->expects($this->once())
+            ->method('__invoke')
+            ->will($this->returnArgument(0))
+        ;
+        $logger->pushProcessor($processor);
+
+        $logger->addError('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsNotCalledWhenNotHandled()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler);
+        $that = $this;
+        $logger->pushProcessor(function($record) use ($that){
+            $that->fail('The processor should not be called');
+        });
+        $logger->addAlert('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testHandlersNotCalledBeforeFirstHandling()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->never())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Processor Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php Added

@@ -0,0 +1,65 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+use Monolog\Handler\TestHandler;
+
+class IntrospectionProcessorTest extends TestCase
+{
+    public function getHandler()
+    {
+        $processor = new IntrospectionProcessor();
+        $handler = new TestHandler();
+        $handler->pushProcessor($processor);
+
+        return $handler;
+    }
+
+    public function testProcessorFromClass()
+    {
+        $handler = $this->getHandler();
+        $tester = new \Acme\Tester;
+        $tester->test($handler, $this->getRecord());
+        list($record) = $handler->getRecords();
+        $this->assertEquals(__FILE__, $record'extra''file');
+        $this->assertEquals(58, $record'extra''line');
+        $this->assertEquals('Acme\Tester', $record'extra''class');
+        $this->assertEquals('test', $record'extra''function');
+    }
+
+    public function testProcessorFromFunc()
+    {
+        $handler = $this->getHandler();
+        \Acme\tester($handler, $this->getRecord());
+        list($record) = $handler->getRecords();
+        $this->assertEquals(__FILE__, $record'extra''file');
+        $this->assertEquals(64, $record'extra''line');
+        $this->assertEquals(null, $record'extra''class');
+        $this->assertEquals('Acme\tester', $record'extra''function');
+    }
+}
+
+namespace Acme;
+
+class Tester
+{
+    public function test($handler, $record)
+    {
+        $handler->handle($record);
+    }
+}
+
+function tester($handler, $record)
+{
+    $handler->handle($record);
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php Added

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php Added

@@ -0,0 +1,68 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class WebProcessorTest extends TestCase
+{
+    public function testProcessor()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'HTTP_REFERER'   => 'D',
+            'SERVER_NAME'    => 'F',
+        );
+
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertEquals($server'REQUEST_URI', $record'extra''url');
+        $this->assertEquals($server'REMOTE_ADDR', $record'extra''ip');
+        $this->assertEquals($server'REQUEST_METHOD', $record'extra''http_method');
+        $this->assertEquals($server'HTTP_REFERER', $record'extra''referrer');
+        $this->assertEquals($server'SERVER_NAME', $record'extra''server');
+    }
+
+    public function testProcessorDoNothingIfNoRequestUri()
+    {
+        $server = array(
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertEmpty($record'extra');
+    }
+
+    public function testProcessorReturnNullIfNoHttpReferer()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertNull($record'extra''referrer');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testInvalidData()
+    {
+        new WebProcessor(new \stdClass);
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/Monolog/TestCase.php Added

@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+class TestCase extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @return array Record
+     */
+    protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array())
+    {
+        return array(
+            'message' => $message,
+            'context' => $context,
+            'level' => $level,
+            'level_name' => Logger::getLevelName($level),
+            'channel' => 'test',
+            'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))),
+            'extra' => array(),
+        );
+    }
+
+    /**
+     * @return array
+     */
+    protected function getMultipleRecords()
+    {
+        return array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+            $this->getRecord(Logger::WARNING, 'warning'),
+            $this->getRecord(Logger::ERROR, 'error')
+        );
+    }
+
+    /**
+     * @return Monolog\Formatter\FormatterInterface
+     */
+    protected function getIdentityFormatter()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->any())
+            ->method('format')
+            ->will($this->returnCallback(function($record) { return $record'message'; }));
+
+        return $formatter;
+    }
+}

roundcubemail-1.5.tar.gz/vendor/monolog/monolog/tests/bootstrap.php Added

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache Added

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/.editorconfig Added

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/LICENSE.md Added

@@ -0,0 +1,21 @@
+# The MIT License (MIT)
+
+Copyright (c) 2016 PHP Framework Interoperability Group
+
+> Permission is hereby granted, free of charge, to any person obtaining a copy
+> of this software and associated documentation files (the "Software"), to deal
+> in the Software without restriction, including without limitation the rights
+> to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+> copies of the Software, and to permit persons to whom the Software is
+> furnished to do so, subject to the following conditions:
+>
+> The above copyright notice and this permission notice shall be included in
+> all copies or substantial portions of the Software.
+>
+> THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+> IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+> FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+> AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+> LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+> OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+> THE SOFTWARE.

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/README.md Added

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/composer.json Added

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/src Added

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/src/CacheException.php Added

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/src/CacheInterface.php Added

@@ -0,0 +1,114 @@
+<?php
+
+namespace Psr\SimpleCache;
+
+interface CacheInterface
+{
+    /**
+     * Fetches a value from the cache.
+     *
+     * @param string $key     The unique key of this item in the cache.
+     * @param mixed  $default Default value to return if the key does not exist.
+     *
+     * @return mixed The value of the item from the cache, or $default in case of cache miss.
+     *
+     * @throws \Psr\SimpleCache\InvalidArgumentException
+     *   MUST be thrown if the $key string is not a legal value.
+     */
+    public function get($key, $default = null);
+
+    /**
+     * Persists data in the cache, uniquely referenced by a key with an optional expiration TTL time.
+     *
+     * @param string                 $key   The key of the item to store.
+     * @param mixed                  $value The value of the item to store, must be serializable.
+     * @param null|int|\DateInterval $ttl   Optional. The TTL value of this item. If no value is sent and
+     *                                      the driver supports TTL then the library may set a default value
+     *                                      for it or let the driver take care of that.
+     *
+     * @return bool True on success and false on failure.
+     *
+     * @throws \Psr\SimpleCache\InvalidArgumentException
+     *   MUST be thrown if the $key string is not a legal value.
+     */
+    public function set($key, $value, $ttl = null);
+
+    /**
+     * Delete an item from the cache by its unique key.
+     *
+     * @param string $key The unique cache key of the item to delete.
+     *
+     * @return bool True if the item was successfully removed. False if there was an error.
+     *
+     * @throws \Psr\SimpleCache\InvalidArgumentException
+     *   MUST be thrown if the $key string is not a legal value.
+     */
+    public function delete($key);
+
+    /**
+     * Wipes clean the entire cache's keys.
+     *
+     * @return bool True on success and false on failure.
+     */
+    public function clear();
+
+    /**
+     * Obtains multiple cache items by their unique keys.
+     *
+     * @param iterable $keys    A list of keys that can obtained in a single operation.
+     * @param mixed    $default Default value to return for keys that do not exist.
+     *
+     * @return iterable A list of key => value pairs. Cache keys that do not exist or are stale will have $default as value.
+     *
+     * @throws \Psr\SimpleCache\InvalidArgumentException
+     *   MUST be thrown if $keys is neither an array nor a Traversable,
+     *   or if any of the $keys are not a legal value.
+     */
+    public function getMultiple($keys, $default = null);
+
+    /**
+     * Persists a set of key => value pairs in the cache, with an optional TTL.
+     *
+     * @param iterable               $values A list of key => value pairs for a multiple-set operation.
+     * @param null|int|\DateInterval $ttl    Optional. The TTL value of this item. If no value is sent and
+     *                                       the driver supports TTL then the library may set a default value
+     *                                       for it or let the driver take care of that.
+     *
+     * @return bool True on success and false on failure.
+     *
+     * @throws \Psr\SimpleCache\InvalidArgumentException
+     *   MUST be thrown if $values is neither an array nor a Traversable,
+     *   or if any of the $values are not a legal value.
+     */
+    public function setMultiple($values, $ttl = null);
+
+    /**
+     * Deletes multiple cache items in a single operation.
+     *
+     * @param iterable $keys A list of string-based keys to be deleted.
+     *
+     * @return bool True if the items were successfully removed. False if there was an error.
+     *
+     * @throws \Psr\SimpleCache\InvalidArgumentException
+     *   MUST be thrown if $keys is neither an array nor a Traversable,
+     *   or if any of the $keys are not a legal value.
+     */
+    public function deleteMultiple($keys);
+
+    /**
+     * Determines whether an item is present in the cache.
+     *
+     * NOTE: It is recommended that has() is only to be used for cache warming type purposes
+     * and not to be used within your live applications operations for get/set, as this method
+     * is subject to a race condition where your has() will return true and immediately after,
+     * another script can remove it making the state of your app out of date.
+     *
+     * @param string $key The cache item key.
+     *
+     * @return bool
+     *
+     * @throws \Psr\SimpleCache\InvalidArgumentException
+     *   MUST be thrown if the $key string is not a legal value.
+     */
+    public function has($key);
+}

roundcubemail-1.5.tar.gz/vendor/psr/simple-cache/src/InvalidArgumentException.php Added

Changes of Revision 25